We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
1. Name the following lipids. (8 pts - 4 ea.) a) b) w ents 2. For...
1. Name the following lipids. (8 pts - 4 ea.) a) b) w ents 2. For each fatty acid drawn below, state its lipid number (e.g. 14:0) and, when applicable, its O-x designation. (8 pts) b) a) Ho
name the lipids
mosphorylation), 11 lipids), and 12 (beta- oxidation, ketogenesis, and fatty acid biosynthesis). Look it over briefly and do first those questions easiest for you. Extra credit is provided at the end. 1. Name the following lipids. (8 pts - 4 ea.) b) w ^
identify your answer. (2 pts ea) 12) Which statement is NOT true? A) There are many different types of lipids. B) Lipids are found in cell membranes. C) Some hormones are lipids D) Lipids are soluble in organic solvents. E) All lipids contain fatty acids. 13) The process of building up new molecules in the coll is called A) glycolysis. B) catabolism. C) anabolism. D) metabolism E) transamination. 14) Which of the following does not require energy from ATP hydrolysis?...
1. Which of the following statements describes lipids? A) Lipids all have the steroid backbone. B) The body stores excess calories as lipids. C) Lipids are insoluble in water, but soluble in nonpolar solvents. D) Lipids are soluble in water, but insoluble in nonpolar solvents. E) Lipids are insoluble in all solvents 2. Which of the following type of molecule is not a lipid? A) amino acid B) triglyceride C) phospholipid D) steroid E) eicosanoid 3. Which type of lipid...
1. Review. Using your notes and the nomenclature packet for carbohydrates and lipids, name the follow monosaccharide derivatives (e.g. mannose-4-phosphate, glucitol). (8 pts - 2 ea.) a) LON (goH oH yo HA OH 2. Review. Draw the following monosaccharide derivatives. Assume all sugars are in their normal ring forms. (6 pts - 2 ea.) a) fructose-2-phosphate c) D-mannonic acid b) B-D-2-amino-2-deoxyribose
match
4. Matching. Below are structures of coenzymes and lipids. For each structure below, write in the blank provided the number that corresponds to the term that best names or describes it. (16 pts -2 ea.) b) c) 40 events and saus HO HO h) bordo HO 1. ATP 2. biotin 3. cerebroside 4. FAD 5. glycerophospholipid 6. 2Fe-2S iron sulfur center 7. lipoic acid 8. NAD 9. NADP 10. prostaglandin 13. steroid 14. thiamine pyrophosphate 15. thromboxane 16. triacylglycerol...
Chemistry 1604 In class Lipids Name: Malio Gomez 1. Draw the following two fatty acids and circle the unsaturated fatty acid. 18:2412.15 20:0 w Which of the following molecules is NOT a naturally occurring fatty acid? 2. а но" с. Но b. CH3(CH2) CH=CH(CH2) CO2H d. Which of the fatty acids below has the highest melting point? 3. stearic acid но arachidonic acid palmitic acid c. arachidonic acid b. palmitic acid stearic acid a. for for short-term energy storage and...
Footings Schedule Designation Quantity Size 10 ea. 4-0 x 4'-0 x 2-0 Deep 8 ea. 8-Ox 5'-Ox 2'-O Deep 6 ea. 5-0 x 5'-Ox 2-0 Deep A. Compute the volume of concrete in CF for all footings. B. If we use a 5% material waste factor, how many 9 CY ready-mix concrete truck loads will be required? C. If all footings must be formed, what contact area of forms will be fabricated and erected on the jobsite.
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
please help
1. Review. Name the following biomolecules. (8 pts - 2 ea.) a) -D) CH2 OW aloh می پر ой c) d) mambo mengine