Why is the wild type allele dominant in Aspidoscelis inornata?
Why is the wild type allele dominant in Aspidoscelis inornata?
Homework Answers
12) A particular allele of a gene (including the wild-type allele) can be expressed in a...
12) A particular allele of a gene (including the wild-type allele) can be expressed in a dominant fashion for several reasons A) Explain why wild-type alleles are usually dominant to mutant alleles (5 pts.). 20 B) Describe three ways in which mutant alleles can be dominant to a wild-type allele (6 pts.).
12) A particular allele of a gene (including the wild-type allele) can be expressed in a...
12) A particular allele of a gene (including the wild-type allele) can be expressed in a dominant fashion for several reasons- A) Explain why wild-type alleles are usually dominant to mutant alleles (5 pts.). B) Describe three ways in which mutant alleles can be dominant to a wild-type allele (6 pts.). 13) Explain how chromatids/chromosomes move to opposite poles of the cell during anaphase. Be sure to mention in your answer how the force that propels this movement is generated...
A certain disease is caused by a recessive mutant allele. (The wild-type allele is dominant.) However,...
A certain disease is caused by a recessive mutant allele. (The wild-type allele is dominant.) However, the penetrance of the disease is 75%. Two individuals known to be heterozygotes have a child. What is the probability that the child exhibits the disease?
MONOHYBRID CROSS In mice the allele for wild color is dominant to the allele for albino....
MONOHYBRID CROSS In mice the allele for wild color is dominant to the allele for albino. Two wild color mice mate and have 13 wild colored pups and 7 albino pups. 1. What are the genotypes of the parents? 2. What percentage of the offspring are albino? How close is this to the theoretical percentage? 3. Theoretically, what percentage of the offspring should be heterozygous? 4. A cross between a heterozygous mouse and an albino yields 20 offspring. How many...
In wild petunias, the allele for red flower color (R) is dominant over the allele for...
In wild petunias, the allele for red flower color (R) is dominant over the allele for white flower color (r). We sample a population and find 240 plants have white flowers and 85 have red flowers. If the population is in HWE, what are the allele frequencies of R and r in this population? How many of the 85 plants that have red flowers are homozygous and how many are heterozygous at the flower color locus?
In wild petunias, the allele for red flower color (R) is dominant over the allele for...
In wild petunias, the allele for red flower color (R) is dominant over the allele for white flower color (r). We sample a population and find 750 plants have white flowers and 270 have red flowers. If the population is in HWE, what are the allele frequencies of R and r in this population? How many of the 270 plants that have red flowers are homozygous and how many are heterozygous at the flower color locus? Show your work and...
A mutated allele is a variant of the original “wild type” allele. A mutated allele can...
A mutated allele is a variant of the original “wild type” allele. A mutated allele can mutate again. The first mutation discovered receives the primary code for that locus, for example, 1xxxxx. How do we code for other mutations at the same gene locus when they are found? Please give an example.
In mice, the dominant allele Gs of the X-linked gene Greasy produces shiny fur, while the...
In mice, the dominant allele Gs of the X-linked gene Greasy produces shiny fur, while the recessive wild type Gs+ allele determines normal fur. The dominant allele Bhd of the X-linked Broadhead gene causes skeletal abnormalities including broad heads and snouts, while the recessive wild-type Bhd+ allele yields normal skeletons. Female mice heterozygous for the two alleles of both genes were mated with wild-type males. Among 100 male progeny of this cross, 49 had shiny fur, 48 had skeletal abnormalities,...
Help with both please! 10. In a wild-type diploid fungus, protein E (encoded by the haplosufficient...
Help with both please!
10. In a wild-type diploid fungus, protein E (encoded by the haplosufficient gene “E”') normally homodimerizes, and the E-E dimer catalyzes a biochemical reaction necessary for the production of a dark pigment. E represents a mutant, dominant negative allele of gene E. What is the predicted phenotype of a fungus cell of genotype ET/E”, and why? A) mutant (no pigment production), as E is haplosufficient B) mutant (no pigment production), as no E-E dimers will form...
Please answer parts A and B please!!! Thank you! 12) A particular allele of a gene...
Please answer parts A and B please!!! Thank you!
12) A particular allele of a gene (including the wild-type allele) can be expressed in a dominant fashion for several reasons- A) Explain why wild-type alleles are usually dominant to mutant alleles (5 pts.). B) Deseribe three ways in which mutant alleles can be dominant to a wild-type allele (6 pts.).
12) A particular allele of a gene (including the wild-type allele) can be expressed in a dominant fashion for several reasons A) Explain why wild-type alleles are usually dominant to mutant alleles (5 pts.). 20 B) Describe three ways in which mutant alleles can be dominant to a wild-type allele (6 pts.).
12) A particular allele of a gene (including the wild-type allele) can be expressed in a dominant fashion for several reasons- A) Explain why wild-type alleles are usually dominant to mutant alleles (5 pts.). B) Describe three ways in which mutant alleles can be dominant to a wild-type allele (6 pts.). 13) Explain how chromatids/chromosomes move to opposite poles of the cell during anaphase. Be sure to mention in your answer how the force that propels this movement is generated...
Help with both please!
10. In a wild-type diploid fungus, protein E (encoded by the haplosufficient gene “E”') normally homodimerizes, and the E-E dimer catalyzes a biochemical reaction necessary for the production of a dark pigment. E represents a mutant, dominant negative allele of gene E. What is the predicted phenotype of a fungus cell of genotype ET/E”, and why? A) mutant (no pigment production), as E is haplosufficient B) mutant (no pigment production), as no E-E dimers will form...
Please answer parts A and B please!!! Thank you!
12) A particular allele of a gene (including the wild-type allele) can be expressed in a dominant fashion for several reasons- A) Explain why wild-type alleles are usually dominant to mutant alleles (5 pts.). B) Deseribe three ways in which mutant alleles can be dominant to a wild-type allele (6 pts.).
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 13 seconds from now -
How would you train your employees to avoid risks of using
mobile devices?
asked 22 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago