Homework Answers
Add Answer to:
predict the major products of the following reactions with
appeopriate stereochemistry
mCPBA lal H2O OH (b)...
predict the major products and if it's undergoing oxidation or reduction 23 a. mCPBA) b. Noh...
predict the major products and if it's undergoing
oxidation or reduction
23 a. mCPBA) b. Noh H2O H2SO4 C. 79E+OH ) H₂SO4 d. Bar tok e. F 1) O3 2) DMS f. K. Hz Pt ->
9. Predict the major products for the following reactions. Show the stereochemistry of the products) when applicable...
9. Predict the major products for the following reactions. Show the stereochemistry of the products) when applicable.. (a) HIB ROOR (1) Hg(OAc), HO (2) NaBH (1) BH, THE (2) 1,0, OH Br. H.O Pt (1) Oso (2) NaHSOHO (1) 03 (2) DMS (1) CHCO,H (2) H0+ Page 2 of 2
11-41 Predict the major products of the following reactions, including stereochemistry where appropriate. 1,41 X) CH,OH...
11-41 Predict the major products of the following reactions, including stereochemistry where appropriate. 1,41 X) CH,OH + pha Z) a oua - 7) W--butanol Play Br →
2. Predict the major organic product(s) of the reactions below. Assume 1 equivalent of reagent unless...
2. Predict the major organic product(s) of the
reactions below. Assume 1 equivalent of reagent unless otherwise
stated, it's a solvent, or an oxidizing/reducing agent. Do consider
stereochemistry and regioselectivity.
2. Predict the major organic product(s) of the reactions below. Assume 1 equivalent of reagent unless otherwise stated, it's a solvent, or an oxidizing/reducing agent. Do consider stereochemistry and regioselectivity. (3 points each; 15 points total) A. Me 1. HNO3 2. O3 3. DMS 1. mCPBA, DCM (1 equiv) 2....
1. Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry...
1. Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry in your products if it is important. (12 pts) Pd/C u o H2O H2SO4
complete the following reactions with the proper stereochemistry as need оCHbb H2SO4 (dilute) OH H2O HBr...
complete the following reactions with the proper
stereochemistry as need
оCHbb H2SO4 (dilute) OH H2O HBr (conc) но H но heat но но H CHs MCPBA OH Jones (CrO3. H,SO4) H2O, acetone 1. MCPBA OH PCC 2. NaCN 3. Hy0 pyridinium chlorochromate CH2CI2, 25 C 1. MCPBA PCC OH pyridinium chlorochromate 2. HBr Cн-Cl, 25 C NaBH OH Hао 1. DMSO, (COCI)2, -60C 1. LIAIH 2. Et N 2. H,0
оCHbb H2SO4 (dilute) OH H2O HBr (conc) но H но...
1. Predict the major organic products of the following reactions. Draw all stereoisomers that are formed....
1. Predict the major organic products of the following reactions. Draw all stereoisomers that are formed. НО, OH 1 eq ,H2SO4 (assume H2O workup of reaction to neutralize product) 1. LDA 2. (assume H,O workup of reaction to neutralize product) 3. Hg(OAC)2 4. NaBH, EtOH 1eq HBr EtOH ambiente 1. Brz. CCL 2. NaOET, ETOH OH
1. Predict the major substitution product(s) for the following reactions. Include stereochemistry if appropriate. You may...
1. Predict the major substitution product(s) for the following reactions. Include stereochemistry if appropriate. You may assume an aqueous workup is performed after each reaction. 1. Nah, DMF ТОН 2. Mel BrMg-Ph KCN 16 { ad ton ot MeOH HD Na Br Me DMSO EtOH Br ~ Br DMSO * Me OH LNH2 M HO Me-S (1 equiv) Me DMF
Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry in...
Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry in your products if it is important. H2 Pd/C HCI H2O H2SO4 Br2 Draw a stepwise, detailed mechanism for the acid-catalyzed hydration reaction in question 2 above. Use curved arrows to indicate the flow of electrons. (Note: use hydronium ion, H307, in your mechanism to indicate “acidic water”).
Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry in...
Predict the major organic products formed in the
following reactions. Be certain to indicate stereochemistry in
products if it is important.
H2O H2SO4 Br2 3. Draw a stepwise, detailed mechanism for the acid-catalyzed hydration reaction in question 2 above. Use curved arrows to indicate the flow of electrons. (Note: use hydronium ion, H:07, in your mechanism to indicate "acidic water"). (6 pts)
predict the major products and if it's undergoing
oxidation or reduction
23 a. mCPBA) b. Noh H2O H2SO4 C. 79E+OH ) H₂SO4 d. Bar tok e. F 1) O3 2) DMS f. K. Hz Pt ->
9. Predict the major products for the following reactions. Show the stereochemistry of the products) when applicable.. (a) HIB ROOR (1) Hg(OAc), HO (2) NaBH (1) BH, THE (2) 1,0, OH Br. H.O Pt (1) Oso (2) NaHSOHO (1) 03 (2) DMS (1) CHCO,H (2) H0+ Page 2 of 2
11-41 Predict the major products of the following reactions, including stereochemistry where appropriate. 1,41 X) CH,OH + pha Z) a oua - 7) W--butanol Play Br →
2. Predict the major organic product(s) of the
reactions below. Assume 1 equivalent of reagent unless otherwise
stated, it's a solvent, or an oxidizing/reducing agent. Do consider
stereochemistry and regioselectivity.
2. Predict the major organic product(s) of the reactions below. Assume 1 equivalent of reagent unless otherwise stated, it's a solvent, or an oxidizing/reducing agent. Do consider stereochemistry and regioselectivity. (3 points each; 15 points total) A. Me 1. HNO3 2. O3 3. DMS 1. mCPBA, DCM (1 equiv) 2....
1. Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry in your products if it is important. (12 pts) Pd/C u o H2O H2SO4
complete the following reactions with the proper
stereochemistry as need
оCHbb H2SO4 (dilute) OH H2O HBr (conc) но H но heat но но H CHs MCPBA OH Jones (CrO3. H,SO4) H2O, acetone 1. MCPBA OH PCC 2. NaCN 3. Hy0 pyridinium chlorochromate CH2CI2, 25 C 1. MCPBA PCC OH pyridinium chlorochromate 2. HBr Cн-Cl, 25 C NaBH OH Hао 1. DMSO, (COCI)2, -60C 1. LIAIH 2. Et N 2. H,0
оCHbb H2SO4 (dilute) OH H2O HBr (conc) но H но...
1. Predict the major organic products of the following reactions. Draw all stereoisomers that are formed. НО, OH 1 eq ,H2SO4 (assume H2O workup of reaction to neutralize product) 1. LDA 2. (assume H,O workup of reaction to neutralize product) 3. Hg(OAC)2 4. NaBH, EtOH 1eq HBr EtOH ambiente 1. Brz. CCL 2. NaOET, ETOH OH
1. Predict the major substitution product(s) for the following reactions. Include stereochemistry if appropriate. You may assume an aqueous workup is performed after each reaction. 1. Nah, DMF ТОН 2. Mel BrMg-Ph KCN 16 { ad ton ot MeOH HD Na Br Me DMSO EtOH Br ~ Br DMSO * Me OH LNH2 M HO Me-S (1 equiv) Me DMF
Predict the major organic products formed in the following reactions. Be certain to indicate stereochemistry in your products if it is important. H2 Pd/C HCI H2O H2SO4 Br2 Draw a stepwise, detailed mechanism for the acid-catalyzed hydration reaction in question 2 above. Use curved arrows to indicate the flow of electrons. (Note: use hydronium ion, H307, in your mechanism to indicate “acidic water”).
Predict the major organic products formed in the
following reactions. Be certain to indicate stereochemistry in
products if it is important.
H2O H2SO4 Br2 3. Draw a stepwise, detailed mechanism for the acid-catalyzed hydration reaction in question 2 above. Use curved arrows to indicate the flow of electrons. (Note: use hydronium ion, H:07, in your mechanism to indicate "acidic water"). (6 pts)
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago