Can someone create the balanced equation and find the oxidation number of Maganese? NaHSO3 + Na2CO3...

Question

Question

Can someone create the balanced equation and find the oxidation number of Maganese?

NaHSO₃ + Na₂CO₃ +KMnO₄

science chemistry

Answer 1

Answer #1

Answer:-

NaHSO₃ + Na₂CO₃ +KMnO₄

The equation is not complete (products are missing).
Please complete this equation by adding products.

Oxidation number of K = +1, thus MnO4 = −1
Mn+4 O = −1
Mn+4(−2) = −1
Mn = +7

Answer 2

Similar Homework Help Questions

Can someone help me with both questions. 1. Write a balanced oxidation-reduction equation for the oxidation...

Can someone help me with both questions. 1. Write a balanced oxidation-reduction equation for the oxidation of benzoin by ammonium nitrate (the cupric ion catalysis need not be considered). 2. In the benzoin oxidation, the initial blue color changes to a green color as the reaction proceeds. Explain this observation.
1. (2d) From mixing NaHSo3 with HCl and then adding K2Cr2O7. Write the balanced half-reation equation...

1. (2d) From mixing NaHSo3 with HCl and then adding K2Cr2O7. Write the balanced half-reation equation for the reduction of the dichromate ion, Cr2)7 (2-) in acid solution. 2. (2c) From mixing NaHSO3 and adding Br2. When Br2 is reduced the product is Br-. Write the half-reaction for the reduction of Br2. Say what is oxidized to for what and what is reduced to form what. 3. (2b) From mixing NaHSO3 to H2O2. The product formed by the reduction of...
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:

write balanced molecular equation Reaction of solution w/: . Na2CO3 + HCl Na2CO3 + HCl NaCl + HCO₃ 2 Na2CO3 + H₂SO4...

write balanced molecular equation Reaction of solution w/: . Na2CO3 + HCl Na2CO3 + HCl NaCl + HCO₃ 2 Na2CO3 + H₂SO4 & Zn + HCl 2. Mg + HCl 6. n + H₂ 504 4 ng + H₂ 504
In addition to mass balance, oxidation-reduction reactions must be balanced such that the number of electrons...

In addition to mass balance, oxidation-reduction reactions must be balanced such that the number of electrons lost in the oxidation equals the number of electrons gained in the reduction. This balancing can be done by two methods: the half-reaction method or the oxidation number method. The half-reaction method balances the electrons lost in the oxidation half-reaction with the electrons gained in the reduction half-reaction. In either method H2O(l), OH−(aq), and H+(aq) may be added to complete the mass balance. Which...
what is balanced chemical equation including states of matter of Nal + Na2CO3?

what is balanced chemical equation including states of matter of Nal + Na2CO3?

1a) Calculate the oxidation number for one atom of Mn in the KMnO4 using the reaction:...

1a) Calculate the oxidation number for one atom of Mn in the KMnO4 using the reaction: KMnO4 + Fe2+ 1b) Considering the change in oxidation number of Mn in the product, how many electrons are gained or lost by Mn in KMnO4 when the reaction is balanced?
A) What would be the correctly balanced oxidation-reduction reaction equation for this reaction? B) what would...

A) What would be the correctly balanced oxidation-reduction reaction equation for this reaction? B) what would be the reduction half reaction for the permanganate ion. Be sure to include the oxidation numbers for manganese and number of electrons transferred 0 ompound and in return the manganese ion is reduced and changes its state from +7 to +4. The product is a derivative of benzoic acid. We will use potassium permanganate to oxidize 2-chlorotoluene (o-chlorota 2-chlorobenzoic acid (o-chlorobenzoic acid). Permanganate solutions...
problem 5.61 Write a balanced equation for when CuCl2(aq) and Na2CO3(aq) are mixed. a. chemical equation...

problem 5.61 Write a balanced equation for when CuCl2(aq) and Na2CO3(aq) are mixed. a. chemical equation b. net ionic equations

1a) Calculate the oxidation number for one atom of Mn in the KMnO4 using the reaction: KMnO4 + Fe2+ 1b) Considering the...

1a) Calculate the oxidation number for one atom of Mn in the KMnO4 using the reaction: KMnO4 + Fe2+ 1b) Considering the change in oxidation number of Mn in the product, how many electrons are gained or lost by Mn in KMnO4 when the reaction is balanced?