Homework Answers
1)b)The presence of specific antigens in samples:direct ELISA test detects antigen using specific immobilized antibody.
2)d)none of the available answers.
3)c)HIV:for the detection of HIV.enzyme linked immuno sarbent assay test is preferred.
4)a)an antigen:microtiter plate,allowing the patient antibody to bind the antigen and an enzyme conjugated secondary antibody to detect the primary antibody.
Add Answer to:
Part C What does the direct ELISA test for? O The absence of polyclonal antibodies in...
1. What does an ELISA test for? 2. What variables can affect the outcome? (Name 4)...
1. What does an ELISA test for? 2. What variables can affect the outcome? (Name 4) 3. What are the three important limitations of an ELISA? Explain each. 4. In the virtual lab, the ELISA plate has been pretreated to bind SLE antigen to each well. WHY? How do you expect the assay setup to differ in our case where the antigen of interest is present in a heterogenous sample in small quantities? 5. Why are there both a positive...
please help solve In a direct ELISA test, the method is determining if by attempting to...
please help solve
In a direct ELISA test, the method is determining if by attempting to bind a labeled antibody to it. is/are present in the patient's sample Select one: O a. antibodies against a pathogen found in a patient's blood. ob,an antigen from a particular pathogen. O ca known sequence of DNA from a pathogen. d. a bacteriophage that can infect a particular bacterial strain Protozoan motility structures include: Select one: O a. cilia, flagella, and pseudopods. O b....
Question 12 parts a,b,c Q12. Using the information provided below on ELISA, answer the following questions...
Question 12 parts a,b,c
Q12. Using the information provided below on ELISA, answer the following questions system to recognize an infectious and in Background While antibodies are used by the immune system to recognize scientists also use antibodies for a myriad of laboratory and the body, scientists also use antibodies for a agent in assays. If a scientist aims to identify a specific protein or mal y and clinical heterogeneous mixture such as a cell lysate or blood e such...
Instructions for Part 2: Answer the following questions: 1. How does the immune system protect us...
Instructions for Part 2: Answer the following questions: 1. How does the immune system protect us from disease? 2. How do doctors use the immune response to protect you from disease? 3. How are the antibodies in your body made? 4. How are antibodies that are used in ELISA made? 5. What does ELISA stand for? 6. What enzymes were used in the Labster simulation? Why? 7. Why are enzymes used in this immunoassay? 8. Why do you need to...
Background INFO There are four types of blood: A, B, AB, and O (Figure 4). Each...
Background INFO
There are four types of blood: A, B, AB, and O (Figure 4). Each
is characterized by the glycoproteins (proteins with a sugar
attached) and lipoproteins (proteins with a lipid attached)
embedded in the surface of red blood cells (RBCs). In addition to
type, blood can be rhesus (Rh) factor positive or negative.
These proteins are inherited and may differ from individual to
individual. If, during a transfusion, an individual receives
blood with the incorrect RBC proteins (for...
1 2 3 4 5 6 7 8 9 Part A Which of the following is/are...
1
2
3
4
5
6
7
8
9
Part A Which of the following is/are means whereby a catalyst can lower the activation energy of a reaction? quantum tunneling decreasing the number of reactive molecules permanently binding substrates inefficient collisions altering the temperature within the cell to one appropriate for reactions to proceed Subrnit Request Answer Part A An enzyme Obinds substrates in a manner that facilitates the formation of product decreases the rate of a reaction. is always...
please provide answer with steps Part B ConstantsPeriodic Table Determine the work the gas does A...
please provide answer with steps
Part B ConstantsPeriodic Table Determine the work the gas does A 1.00 mole sample of N2 gas at o C is heated to 170 C at constant pressure (1.00 atm). W= Submit Request Answer Part C Determine the heat added to it. 0図? Submit Request Answer
A reaction in which A, B, and C react to form products is zero order in...
A reaction in which A, B, and C react to form products is zero order in A, one-half order in B, and second order in C. Part A Write a rate law for the reaction. O Rate = k [A] [B] [C]1/2 O Rate = k [B] [C]1/2 Rate = k [B]1/2 [C] Rate = k [A] [B]1/2 [C] Submit Request Answer Part B What is the overall order of the reaction? Express your answer numerically. EVO AEQ O 2...
What part of the respiratory system does cigarette smoke most adversely affect? What part of the...
What part of the respiratory system does cigarette smoke most
adversely affect?
What part of the respiratory system does cigarette smoke most adversely affect? O alveoli bronchi trachea diaphragm Submit Request Answer
Part C Complete previous part(s) Part D What distance does electromagnetic radiation travel in 0.48 ps? Express...
Part C Complete previous part(s) Part D What distance does electromagnetic radiation travel in 0.48 ps? Express your answer using two significant figures. VO APO 2 ? du Submit Request Answer <Chapter 6 Problem 6.20 with feedback Light travels at a speed of 2.998x10 m/s in a vacuum You may want to reference (Page) Section 6.1 while completing this problem. Part A What is the frequency of radiation whose wavelength is 0.82 nm ? Express the frequency in inverse seconds...
please help solve
In a direct ELISA test, the method is determining if by attempting to bind a labeled antibody to it. is/are present in the patient's sample Select one: O a. antibodies against a pathogen found in a patient's blood. ob,an antigen from a particular pathogen. O ca known sequence of DNA from a pathogen. d. a bacteriophage that can infect a particular bacterial strain Protozoan motility structures include: Select one: O a. cilia, flagella, and pseudopods. O b....
Question 12 parts a,b,c
Q12. Using the information provided below on ELISA, answer the following questions system to recognize an infectious and in Background While antibodies are used by the immune system to recognize scientists also use antibodies for a myriad of laboratory and the body, scientists also use antibodies for a agent in assays. If a scientist aims to identify a specific protein or mal y and clinical heterogeneous mixture such as a cell lysate or blood e such...
Instructions for Part 2: Answer the following questions: 1. How does the immune system protect us from disease? 2. How do doctors use the immune response to protect you from disease? 3. How are the antibodies in your body made? 4. How are antibodies that are used in ELISA made? 5. What does ELISA stand for? 6. What enzymes were used in the Labster simulation? Why? 7. Why are enzymes used in this immunoassay? 8. Why do you need to...
Background INFO
There are four types of blood: A, B, AB, and O (Figure 4). Each
is characterized by the glycoproteins (proteins with a sugar
attached) and lipoproteins (proteins with a lipid attached)
embedded in the surface of red blood cells (RBCs). In addition to
type, blood can be rhesus (Rh) factor positive or negative.
These proteins are inherited and may differ from individual to
individual. If, during a transfusion, an individual receives
blood with the incorrect RBC proteins (for...
1
2
3
4
5
6
7
8
9
Part A Which of the following is/are means whereby a catalyst can lower the activation energy of a reaction? quantum tunneling decreasing the number of reactive molecules permanently binding substrates inefficient collisions altering the temperature within the cell to one appropriate for reactions to proceed Subrnit Request Answer Part A An enzyme Obinds substrates in a manner that facilitates the formation of product decreases the rate of a reaction. is always...
please provide answer with steps
Part B ConstantsPeriodic Table Determine the work the gas does A 1.00 mole sample of N2 gas at o C is heated to 170 C at constant pressure (1.00 atm). W= Submit Request Answer Part C Determine the heat added to it. 0図? Submit Request Answer
A reaction in which A, B, and C react to form products is zero order in A, one-half order in B, and second order in C. Part A Write a rate law for the reaction. O Rate = k [A] [B] [C]1/2 O Rate = k [B] [C]1/2 Rate = k [B]1/2 [C] Rate = k [A] [B]1/2 [C] Submit Request Answer Part B What is the overall order of the reaction? Express your answer numerically. EVO AEQ O 2...
What part of the respiratory system does cigarette smoke most
adversely affect?
What part of the respiratory system does cigarette smoke most adversely affect? O alveoli bronchi trachea diaphragm Submit Request Answer
Part C Complete previous part(s) Part D What distance does electromagnetic radiation travel in 0.48 ps? Express your answer using two significant figures. VO APO 2 ? du Submit Request Answer <Chapter 6 Problem 6.20 with feedback Light travels at a speed of 2.998x10 m/s in a vacuum You may want to reference (Page) Section 6.1 while completing this problem. Part A What is the frequency of radiation whose wavelength is 0.82 nm ? Express the frequency in inverse seconds...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 7 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago