what molecule acts as an electron donor during photosynthesis in chloroplast? what alternative is used by...
what molecule acts as an electron donor during photosynthesis in chloroplast? what alternative is used by some photosynthetic bacteria
Homework Answers
Answer:
Water molecule acts as an electron donor during photosynthesis in chloroplast. During the light-dependent reactions of oxygenic photosynthesis, some light energy captured by chlorophyll molecule is used to split H2O (photolysis), generating molecular oxygen (O2) and electrons. These electrons are fed in the electron transport chain for the production of ATP.
Alternatively, there are several groups of photosynthetic bacteria that undergo anoxygenic photosynthesis. In this process, a similar photosynthetic pigment (bacteriochlorophyll) absorbs light and ATP molecules are generated without the production of oxygen. Here, reducing agents such as hydrogen sulfide, instead of water act as electron donor and sulphur is released as a byproduct.
.
If you like my answer, please do not forget to thumbs up. I
would be happy to discuss your concerns in the comment section
below. Thank you!
Add Answer to:
what molecule acts as an electron donor during photosynthesis in
chloroplast? what alternative is used by...
Photosynthesis is a biological & chemical process which involves the reduction of carbon dioxide (CO2), using...
Photosynthesis is a biological & chemical process which involves the reduction of carbon dioxide (CO2), using the energy of sunlight harvested by pigments (chlorophyll for example). This is another example of the biological need for a source of carbon, energy and electrons. Photosynthetic bacteria use electron donors that vary between the three major groups. Place the following components of the photosynthetic process into the appropriate photosynthetic group. Each of them needs a carbon source, an energy source, and an electron...
In green plant photosynthesis, water is the initial electron donor, NADP+ - is the final electron...
In green plant photosynthesis, water is the initial electron donor, NADP+ - is the final electron acceptor, and a proton gradient drives the electron flow from the donor to the acceptor. АТР light energy va proton gradient manganese
Questions Regarding Lab (Photosynthesis) A Name the specific organic molecule that is produced directly by photosynthesis:...
Questions Regarding Lab (Photosynthesis) A Name the specific organic molecule that is produced directly by photosynthesis: G3P B. Name the molecule that is removed from the environment during photosynthesis: CO2 C. During which process does the splitting water to release hydrogens and electrons occur? occur D. During which process does the fixing of carbon dioxide into carbohydrates occur? E. Name the structure by which carbon dioxide enters the leaf: F. Name the type of chemical reaction that results in the...
What happens to the O2 produced by photosynthesis in chloroplasts? Choose one: O It is oxidized...
What happens to the O2 produced by photosynthesis in chloroplasts? Choose one: O It is oxidized by the citric acid cycle in the mitochondrial matrix. o It donates electrons to the mitochondrial electron-transport chain. O It is converted to the CO2 used in carbon fixation in the chloroplast stroma. o It serves as the final electron acceptor in the photosynthetic electron-transport chain. O It is consumed by oxidative phosphorylation in mitochondria. In eukaryotic cells, where does the conversion of CO2...
1. What molecule of gas will a plant utilize during photosynthesis? 2. What molecule of gas...
1. What molecule of gas will a plant utilize during photosynthesis? 2. What molecule of gas will a plant produce during photosynthesis? 3. What coenzyme molecule will a plant utilize during the light reaction of photosynthesis? 4. How many carbon molecules must be fixed to make two molecules of glyceraldehyde 3-phosphate during the Calvin cycle of photosynthesis?
You are studying the creation of carbohydrate during photosynthesis, what is the best part of the...
You are studying the creation of carbohydrate during photosynthesis, what is the best part of the chloroplast to study? Select one: a. chloroplast stroma b. outer chloroplast membrane Flag question c. inner chloroplast membrane d. thylakoid membrane e. thylakoid space
Electrons that enter the light reactions of photosynthesis can be traced through all the photosynthesis processes...
Electrons that enter the light reactions of photosynthesis can be traced through all the photosynthesis processes ending up in a molecule that can be later used in respiration. These same electrons can then be tracked through the processes of respiration. Put the options listed below in order starting with the original electron donor (at the beginning of photosynthesis) and ending with the ultimate electron acceptor at the end of respiration. A. Complex 1 in inner mitochondrial membrane, B. Glucose, C....
How many membranes does the chloroplast have? 30. How many membranes doos the mitochondria have? 31....
How many membranes does the chloroplast have? 30. How many membranes doos the mitochondria have? 31. A stack of thylakoids are known as d, 4 e, 3 a. Thylakoid dises b, c. thy lakoid lumen 32. The products produced in the light independent reaction are used to drive the light dependent reac a. True b, False 33. The ATP and NADPH produces in the light reaction are used to drive the synthesis of sugars from CO2 a. True b. False...
chloroplast: 1) describe 2 examples of how form is linked to function. 2) what Is the...
chloroplast: 1) describe 2 examples of how form is linked to function. 2) what Is the name of the electron donor and final electron acceptor for light dependent reactions (overall photosystem 1 and 2) 3) similarities and differences in ATP production between mitochondria and chloroplast
19. How many membranes does the chloroplast have 50. How many membranes does the mitochondria have?...
19. How many membranes does the chloroplast have 50. How many membranes does the mitochondria have? 0.4 C3 31 A stack of this lakoids are known as: granum Thylakoid dises Grama ethylakid lumen 32. The products produced in the light independent reaction are used to drive the light dependent reaction . Stroma Trie h. False 33. The Aland NADPI pride in the light reaction are used to drive the synthesis of gars from CO2 True 34. Photosystem II in photosynthesis,...
Photosynthesis is a biological & chemical process which involves the reduction of carbon dioxide (CO2), using the energy of sunlight harvested by pigments (chlorophyll for example). This is another example of the biological need for a source of carbon, energy and electrons. Photosynthetic bacteria use electron donors that vary between the three major groups. Place the following components of the photosynthetic process into the appropriate photosynthetic group. Each of them needs a carbon source, an energy source, and an electron...
In green plant photosynthesis, water is the initial electron donor, NADP+ - is the final electron acceptor, and a proton gradient drives the electron flow from the donor to the acceptor. АТР light energy va proton gradient manganese
Questions Regarding Lab (Photosynthesis) A Name the specific organic molecule that is produced directly by photosynthesis: G3P B. Name the molecule that is removed from the environment during photosynthesis: CO2 C. During which process does the splitting water to release hydrogens and electrons occur? occur D. During which process does the fixing of carbon dioxide into carbohydrates occur? E. Name the structure by which carbon dioxide enters the leaf: F. Name the type of chemical reaction that results in the...
What happens to the O2 produced by photosynthesis in chloroplasts? Choose one: O It is oxidized by the citric acid cycle in the mitochondrial matrix. o It donates electrons to the mitochondrial electron-transport chain. O It is converted to the CO2 used in carbon fixation in the chloroplast stroma. o It serves as the final electron acceptor in the photosynthetic electron-transport chain. O It is consumed by oxidative phosphorylation in mitochondria. In eukaryotic cells, where does the conversion of CO2...
You are studying the creation of carbohydrate during photosynthesis, what is the best part of the chloroplast to study? Select one: a. chloroplast stroma b. outer chloroplast membrane Flag question c. inner chloroplast membrane d. thylakoid membrane e. thylakoid space
How many membranes does the chloroplast have? 30. How many membranes doos the mitochondria have? 31. A stack of thylakoids are known as d, 4 e, 3 a. Thylakoid dises b, c. thy lakoid lumen 32. The products produced in the light independent reaction are used to drive the light dependent reac a. True b, False 33. The ATP and NADPH produces in the light reaction are used to drive the synthesis of sugars from CO2 a. True b. False...
19. How many membranes does the chloroplast have 50. How many membranes does the mitochondria have? 0.4 C3 31 A stack of this lakoids are known as: granum Thylakoid dises Grama ethylakid lumen 32. The products produced in the light independent reaction are used to drive the light dependent reaction . Stroma Trie h. False 33. The Aland NADPI pride in the light reaction are used to drive the synthesis of gars from CO2 True 34. Photosystem II in photosynthesis,...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 51 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago