Homework Answers
Add Answer to:
You want to make a battery using the following reactions: PbO2 + 4H+ + SO42- +...
Question 20 (5 points) Using the following standard reduction potentials: PbO2 + 4H+ + SO42- +...
Question 20 (5 points) Using the following standard reduction potentials: PbO2 + 4H+ + SO42- + 2e → PbSO4(s) + 2H20 E° = +1.69 V PbO2 + 4H+ + 2e → Pb2+ + 2H20 E° = +1.46 V The standard cell voltage for the reaction PbSO4(s) Pb2+ + SO42- is V. Please enter your answer in decimal form, such as 2.5, and keep the correct number of significant figures.
Question 20 (5 points) Using the following standard reduction potentials: PbO2 + 4H+ + SO42- +...
Question 20 (5 points) Using the following standard reduction potentials: PbO2 + 4H+ + SO42- + 2e → PbSO4(s) + 2H20 E° = +1.69 V PbO2 + 4H+ + 2e Pb2+ + 2H20 E° = +1.46 V is The standard cell voltage for the reaction PbSO4(s) → Pb2+ + SO42- V. Please enter your answer in decimal form, such as 2.5, and keep the correct number of significant figures.
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) +...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
Question 22 (5 points) Given the following half reactions: PbO2 + 4H+ + SO42- + 2e...
Question 22 (5 points) Given the following half reactions: PbO2 + 4H+ + SO42- + 2e → PbSO4(s) + 2H20 E° = 1.69V PbO2 + 4H+ + 2e- → Pb2+ + 2H2O E° = 1 .46V Calculate the Ksp for PbSO4 at 25 degrees C. Please enter your answer in scientific notation, such as 1.2E10 or 1.2E-10 and keep two significant figures.
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
The following data were measured using a nickel electrode as the standard: Cu2+(aq) + 2e- ⟶...
The following data were measured using a nickel electrode as the standard: Cu2+(aq) + 2e- ⟶ Cu(s) Ni2+(aq) + 2e- ⟶ Ni(s) Fe2+(aq) + 2e- ⟶ Fe(s) Al3+(aq) + 3e- ⟶ Al(s) The copper and aluminum electrodes are connected in a battery. A) Which is the anode? Cathode? Why? B) Which is oxidized? Reduced? Why? C) What will the battery voltage be? Eo =0.62V Eo =0.00V Eo =-0.15V Eo =-1.38V D) Write a balanced net ionic equation for the reaction...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
For all of the following experiments, under standard conditions, which species could be spontaneously produced? A...
For all of the following
experiments, under standard conditions, which species could be
spontaneously produced?
A lead wire is placed in a solution containing
Cu2+
yes no Cu
yes no PbO2
yes no No reaction
Crystals of I2 are added to a solution of
NaCl.
yes no I-
yes no No reaction
yes no Cl2
A silver wire is placed in a solution containing
Cu2+
no yes Cu
no yes No reaction
no yes Ag+
Half-Reaction 8° (V) Half-Reaction 8° (V) 2.87 1.99 1.82 1.78 1.70 1.69 1.68 1.60...
A certain half-reaction has a standard reduction potential +0.14 V. An engineer proposes using this half-reactio...
A certain half-reaction has a standard reduction potential +0.14 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the hall reaction used at the cathode of this cell can have? ves, there...
5. What is the concentration of silver(I) ion in a saturated solution of silver(I) carbonate containing...
5. What is the concentration of silver(I) ion in a saturated solution of silver(I) carbonate containing 0.0030 M Na2CO3? For Ag2CO3, Ksp = 8.6 x 10-12. A) 6.0 x 10-4 M B) 2.0 x 10-'M C) 8.0 x 10-'M D) 5.4 x 10-5M E) 8.0 x 10-4M 6. Balance the following oxidation-reduction occurring in acidic solution. MnO4 (aq) + Co2+(aq) →Mn²+ (aq) + Co3+ (aq) A) B) C) D) E) MnO4 (aq) + 8 H+ (aq) + Co2+(aq) Mn²+ (aq)...
Question 20 (5 points) Using the following standard reduction potentials: PbO2 + 4H+ + SO42- + 2e → PbSO4(s) + 2H20 E° = +1.69 V PbO2 + 4H+ + 2e → Pb2+ + 2H20 E° = +1.46 V The standard cell voltage for the reaction PbSO4(s) Pb2+ + SO42- is V. Please enter your answer in decimal form, such as 2.5, and keep the correct number of significant figures.
Question 20 (5 points) Using the following standard reduction potentials: PbO2 + 4H+ + SO42- + 2e → PbSO4(s) + 2H20 E° = +1.69 V PbO2 + 4H+ + 2e Pb2+ + 2H20 E° = +1.46 V is The standard cell voltage for the reaction PbSO4(s) → Pb2+ + SO42- V. Please enter your answer in decimal form, such as 2.5, and keep the correct number of significant figures.
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
Question 22 (5 points) Given the following half reactions: PbO2 + 4H+ + SO42- + 2e → PbSO4(s) + 2H20 E° = 1.69V PbO2 + 4H+ + 2e- → Pb2+ + 2H2O E° = 1 .46V Calculate the Ksp for PbSO4 at 25 degrees C. Please enter your answer in scientific notation, such as 1.2E10 or 1.2E-10 and keep two significant figures.
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
For all of the following
experiments, under standard conditions, which species could be
spontaneously produced?
A lead wire is placed in a solution containing
Cu2+
yes no Cu
yes no PbO2
yes no No reaction
Crystals of I2 are added to a solution of
NaCl.
yes no I-
yes no No reaction
yes no Cl2
A silver wire is placed in a solution containing
Cu2+
no yes Cu
no yes No reaction
no yes Ag+
Half-Reaction 8° (V) Half-Reaction 8° (V) 2.87 1.99 1.82 1.78 1.70 1.69 1.68 1.60...
A certain half-reaction has a standard reduction potential +0.14 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the hall reaction used at the cathode of this cell can have? ves, there...
5. What is the concentration of silver(I) ion in a saturated solution of silver(I) carbonate containing 0.0030 M Na2CO3? For Ag2CO3, Ksp = 8.6 x 10-12. A) 6.0 x 10-4 M B) 2.0 x 10-'M C) 8.0 x 10-'M D) 5.4 x 10-5M E) 8.0 x 10-4M 6. Balance the following oxidation-reduction occurring in acidic solution. MnO4 (aq) + Co2+(aq) →Mn²+ (aq) + Co3+ (aq) A) B) C) D) E) MnO4 (aq) + 8 H+ (aq) + Co2+(aq) Mn²+ (aq)...
Most questions answered within 3 hours.
-
11.53g sample of NaBr contains 22.34% Na by mass Considering
the law of constant composition how...
asked 14 minutes ago -
Exercise 5-22A Complete the accounting cycle using receivable
transactions (LO5–1, 5–2, 5–4, 5–5, 5–7) [The following...
asked 46 minutes ago -
Do you agree with the view that small businesses are more
vulnerable to employee theft because...
asked 1 hour ago -
Four forces act on an object, given by A = 41.3 N east, B = 46.3...
asked 1 hour ago -
Which of the following design considerations leads to more
user-friendly presentation layers for GUIs? [Check all...
asked 2 hours ago -
38%
of adults say cashews are their favorite kind of nut. You
randomly select 12 adults...
asked 4 hours ago -
Notational Inc. is considering installing a new server. The
machine costs $100,000 and is expected to...
asked 4 hours ago -
Given the information coding of DNA strand:
5'-TTT-TAC-GAA-GAG-TGA-3',
Write the corresponding DNA template and mRNA strand...
asked 5 hours ago -
2. Boris recently synthesized an explosive compound he named
Badenoughium. The molecular formula for Bdenoughium is...
asked 8 hours ago -
5. A car decelerate evenly from a velocity of 50mph until rest
in a distance of...
asked 8 hours ago -
IN HTML Programming
1. Write a script that inputs integers (one at a time) and
passes...
asked 9 hours ago -
A dentist uses a mirror to examine a tooth that is 0.75 cm in
front of...
asked 9 hours ago