Calculate the minimum amount (in grams) of O2 needed to produce 243.2 kJ of heat, when it is reacted with Al(s) to form Al2O3(s) at 25°C and 1 atm. Delta Δ Hf Al2O3(s) = − 1676 kJ/mol
The balanced equation can be written as 4Al(s) + 3O2(g) 2Al2O3(s)
The amount of heat produced per 1 mole of Al2O3(s) = 1676 kJ
Therefore, the no. of moles of Al2O3(s) formed to produce 243.2 KJ heat = 243.2/1676 = 0.1451074 mol
For the formation of 2 moles of Al2O3(s), the no. of moles of O2(g) needed = 3
i.e. For the formation of 0.1451 mol Al2O3(s), the no. of moles of O2(g) needed = 0.1451074*3/2 = 0.2176611 mol
Therefore, the minimum amount of O2 needed = 0.2176611 mol * 32 g/mol = 6.965 g
Calculate the minimum amount (in grams) of O2 needed to produce 243.2 kJ of heat, when...
Calculate the amount of heat released in the combustion of 9 grams of Al with 2.5 grams of O2 to form Al2O3(s) at 25°C and 1 atm. ? HfAl2O3(s) = ? 1676 kJ/mol HINT: What does Delta ? HfAl2O3(s) mean? Enter a positive number since released implies a negative number already. Enter to 1 decimal place in kJ.
Calculate the amount of heat released in the combustion of 10.9 grams of Al with 3.5 grams of O2 to form Al2O3(s) at 25°C and 1 atm. ΔHfAl2O3(s) = −1676 kJ/mol HINT: What does ΔHfAl2O3(s) mean? Enter a positive number since released implies a negative number already. Enter to 1 decimal place in kJ.
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
. Use the equation below to calculate how much heat (in kJ) is evolved when 5.0 g of aluminium reacts with a stoichiometric amount of Fe2O3? 2 Al (s) + Fe2O3 (s) —>2 Fe (s) + Al2O3 (s) AH° = -852 kJ Determine the AHPrxn for the following reaction. {AH® (NH3) = -45.9 kJ/mol; AH°(O2) = 0; AH® (NO) = +91.3 kJ/mol; AH° (H2O) = -241.8 kJ/mol; 4 NH3 (g) + 5 O2 (g) — 4 NO (g) + 6...
6. Calculate the energy in the form of heat (in k.J) required to convert 100.0 grams of liquid water at 80.0°C to steam at 122 °C. Assume that no energy in the form of heat is transferred to the environment. (Heat of fusion 333 J/g; heat of vaporization 2256 J/g; specific heat capacities: liquid water 4.184 J/g K, steam 1.92 J/g K) (a) 238 kJ (b) 226 kJ (c) 4.22 kJ (d) 8.37 kJ (e) 17.6 kJ 7. The thermochemical...
c. How much heat is released when iting reacts to 4.59 grams of oxygen? AS da la reacción: 4 Al(s) + 3 O2(g) → 2 Al2O3 (5) AH = 3.35 kJ/mol ¿Cuánto calor se libera cuando reaccionan 4.567g de oxigeno? (8 pts)
Given the following thermochemical equation, calculate the amount of heat (in kJ) that is released when 35.0 g of Na2O2 completely react with excess amount of water . 2 Na2O2 (s) + 2 H2O (l) → 4 NaOH (aq) + O2 (g) Δ H = - 126 kJ
C Using the heats of formation below, calculate the heat of reaction for the following reaction: CH4(g) + H2O(g) → C2H5OH(E) AH® (kJ/mol) C2H4(g) 52.26 H2O(g) -241.8 C2H5OH(E) -235.1 kJ d Using the heats of formation below, calculate the heat of reaction for the following reaction: Fe2O3(s) + 2Al(s) - A1203(s) + 2Fe(s) AH(kJ/mol) Fe2O3(s) -824.2 Al(s) 0 Al2O3(s) -1676 Fe(s) 0 KJ
When methanol, CH3OH, is burned in the presence of oxygen gas, O2, a large amount of heat energy is released. For this reason, it is often used as a fuel in high performance racing cars. The combustion of methanol has the balanced, thermochemical equation CH3OH(g)+32O2(g)⟶CO2(g)+2H2O(l)Δ?=−764 kJ How much methanol, in grams, must be burned to produce 807 kJ of heat? mass in grams:
How much heat is evolved upon the complete oxidation of 9.41 g of aluminum at 25°C and 1 atm pressure? (AH° for Al2O3 is - 1676 kJ/mol.) 4Al(s) + 302(g) --> 2Al2O3(s) O 146 kJ O 1169 kJ O 292 kJ 0 585 kJ O 1.58 x 104 kJ