Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Question

Question

Consider the reaction

B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol

calculate the amount of heat released when 24.8g of diaborane is burned

heat released=

Answer 1

Answer #1

By Ho(g) + O2(g) → B, 03(s) + 3H2019). AH = -2035 kJ/mol Molar mats of Boha = 27.66 g/mo 27.669 diborone yields = 2035h 29.89

Answer 2

Similar Homework Help Questions

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ How much heat is released when a mixture of 8.26 g B2H7 and 8.80 g 02 is burned? heat released = kJ Submit Show Hints
Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol...

Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol Calculate the amount of heat released when 54.4 g of diborane is burned, heat released = kJ
Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(...

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ

for the reaction S(s)+O2(g)=SO2(g) delta H=-296 kJ per mole of SO2 formed calculate the quantity of...

for the reaction S(s)+O2(g)=SO2(g) delta H=-296 kJ per mole of SO2 formed calculate the quantity of heat released when 2.78g of sulfur is burned in oxygen=
(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from th...

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from the elements as: 2B (s) + 3H2 (g) → B2H6 (g) Use the following data: 4B (s) + 3O2 (g) → 2B2O. (S) Δ? = -2546 kJ mol-1 B2H6 (g) + 3O2 (g) → B2O3 (s) + 3H2O (g) Δ? = -2035 kJ mol-1 2H2 (g) + O2 (g) → 2H2O (l) Δ? = -572 kJ mol-1 H2O (l) →...
Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of fo...

Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation: 12N2(g)+O2(g)→NO2(g), ΔH∘A=33.2 kJ 12N2(g)+12O2(g)→NO(g), ΔH∘B=90.2 kJ Express your answer with the appropriate units. Part B Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ Express your answer with the appropriate units.

For the reaction below ΔH = -296 kJ per mole of SO2 formed. S(s) + O2(g)...

For the reaction below ΔH = -296 kJ per mole of SO2 formed. S(s) + O2(g) → SO2(g) (a) Calculate the quantity of heat released when 1.05 g of sulfur is burned in oxygen. (b) Calculate the quantity of heat released when 0.584 mol of sulfur is burned in air. (c) What quantity of energy is required to break up exactly 9 mol of SO2(g) into its constituent elements?
Calculate the enthalpy of the reaction 2NO(g) + O2(g)2NO2(g) Hess's law states that "the heat released or absorbed in a...

Calculate the enthalpy of the reaction 2NO(g) + O2(g)2NO2(g) Hess's law states that "the heat released or absorbed in a chemical process is the same whether the process takes place in one or in several steps." It is important to recall the following rules: given the following reactions and enthalpies of formation: 1. ¢ N2(g) + O2(g)+NO2(g), AH; = 33.2 kJ 2. N2(g) + O2(g) NO(g), AHB = 90.2 kJ 1. When two reactions are added, their enthalpy values are...
E2C.6(a) for the reaction C2H5OH(l) + 3O2(g) 2CO2(g) + 3H2O(g), delta U knot = -1373 kj/mol at 298 k. calculate delta H...

E2C.6(a) for the reaction C2H5OH(l) + 3O2(g) 2CO2(g) + 3H2O(g), delta U knot = -1373 kj/mol at 298 k. calculate delta H knot of reaction.

4 Fe(s) + 3 O2(g) → 2 Fe2O3(s) AH = -1652 kJ (a) How much heat is released when 3.54 mol iron are reacted with exce...

4 Fe(s) + 3 O2(g) → 2 Fe2O3(s) AH = -1652 kJ (a) How much heat is released when 3.54 mol iron are reacted with excess O2? Ok] (b) How much heat is released when 1.48 mol Fe2O3 is produced? CJ) (c) How much heat is released when 2.50 g iron are reacted with excess O2? DJ (d) How much heat is released when 12.6 g Fe and 1.02 g O2 are reacted? CkJ