For the reaction below ΔH = -296 kJ per mole of SO2 formed. S(s) + O2(g)...
For the reaction below ΔH = -296 kJ per mole of SO2 formed. S(s) + O2(g) → SO2(g) (a) Calculate the quantity of heat released when 1.05 g of sulfur is burned in oxygen. (b) Calculate the quantity of heat released when 0.584 mol of sulfur is burned in air. (c) What quantity of energy is required to break up exactly 9 mol of SO2(g) into its constituent elements?
Homework Answers
Add Answer to:
For the reaction below ΔH = -296 kJ per mole of SO2 formed. S(s)
+ O2(g)...
for the reaction S(s)+O2(g)=SO2(g) delta H=-296 kJ per mole of SO2 formed calculate the quantity of...
for the reaction S(s)+O2(g)=SO2(g) delta H=-296 kJ per mole of SO2 formed calculate the quantity of heat released when 2.78g of sulfur is burned in oxygen=
Given: C(s) + O2(g) ---> CO2(g) ΔH = −393.5 kJ/mol S(s) + O2(g) ---> SO2(g) ΔH...
Given: C(s) + O2(g) ---> CO2(g) ΔH = −393.5 kJ/mol S(s) + O2(g) ---> SO2(g) ΔH = −296.8 kJ/mol C(s) + 2S(s) ---> CS2(ℓ) ΔH = +87.9 kJ/mol A) Calculate the standard enthalpy change for the following reaction CS2(ℓ) + 3O2(g) ---> CO2(g) + 2SO2(g) ΔH° rxn = -1075 kJ/mol B) Using the equation and standard enthalpy change for the reaction (from part A), calculate the amount of heat produced or consumed when 3.2 mol of CS2 reacts with excess...
Sulfur dioxide, SO2(g), can react with oxygen to produce sulfur trioxide, SO2(g), by the reaction 2 502(g) + O2(g) → 25...
Sulfur dioxide, SO2(g), can react with oxygen to produce sulfur trioxide, SO2(g), by the reaction 2 502(g) + O2(g) → 250 (8) The standard enthalpies of formation for SO2(g) and SO2(g) are AH; (SO2(8)) = –296.8 kJ/mol AH (SO2(2)) = –395.7 kJ/mol Calculate the amount of energy in the form of heat that is produced when a volume of 4.46 L of So,(g) is converted to 4.46 L of So, (g) according to this process at a constant pressure and...
Use the ΔH°f and ΔH°rxn information provided to calculate ΔH°f for SO3(g): 2 SO2(g) + O2(g)...
Use the ΔH°f and ΔH°rxn information provided to calculate ΔH°f for SO3(g): 2 SO2(g) + O2(g) → 2 SO3(g) ΔH°rxn = -198 kJ ΔH°f (kJ/mol) SO2(g) -297
Consider the following reaction: 2H2(g) + O2(g) → 2H2O(1) ΔH = -572 kJ
1. Consider the following reaction: 2H2(g) + O2(g) → 2H2O(1) ΔH = -572 kJ a. How much heat is evolved for the production of 1.00 mole of H2O(1)? b. How much heat is evolved when 4.03g hydrogen are reacted with excess oxygen? c. How much heat is evolved when 186g oxygen are reacted with excess hydrogen?2. The specific heat capacity of silver is 0.24J/°C g. a. Calculate the energy required to raise the temperature of 150.0g Ag from 273K to 298K. b. Calculate the energy required...
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
34. At volcanic sites, sulfur is formed via the following reaction. 2 H2S(g) +SO2(g) = 3S(s)...
34. At volcanic sites, sulfur is formed via the following reaction. 2 H2S(g) +SO2(g) = 3S(s) +2 H20(g) a. Calculate the equilibrium constant, K, for this reaction at 25°C. 4 Gº (kJ/mol H2S (8) SO2) H20 (8) -33.0 -300.4 -228.6 s, b. Predict whether sulfur formation becomes more or less favorable as temperature increases. Explain. C Sulfur dioxide is a pollutant released by power plants. Would this reaction be suitable for removing SO2 from power plant waste?
Sulfur dioxide, SO2(g), can react with oxygen to produce sulfur trioxide, SO3(g), by the reaction 2...
Sulfur dioxide, SO2(g), can react with oxygen to produce sulfur trioxide, SO3(g), by the reaction 2 50, (g) + O2(g) 250, (g) The standard enthalpies of formation for SO2(g) and SO2(g) are AH (SO2(g)] = –296.8 kJ/mol AH (SO2(g)] = -395.7 kJ/mol Calculate the amount of energy in the form of heat that is produced when a volume of 1.09 L of So, (g) is converted to 1.09 L of So, (g) according to this process at a constant pressure...
Coal burns in oxygen exothermically as shown below: C(s) + O2(g) → CO2 (g) AH =...
Coal burns in oxygen exothermically as shown below: C(s) + O2(g) → CO2 (g) AH = -393.5 kJ What amount of heat will be released when 100.0 g of it is burned? Molar mass of C = 12.01/mol -3935 kJ -0.3930 kJ -3276 kJ -4726 kJ
Given the following data: C(s) + O2(g) → CO2(g) ΔH = -393.5 kJ CS2(l) + 3O2(g) → CO2(g) + 2SO2(g) ΔH = -1076.5 kJ C(s) +...
Given the following data: C(s) + O2(g) → CO2(g) ΔH = -393.5 kJ CS2(l) + 3O2(g) → CO2(g) + 2SO2(g) ΔH = -1076.5 kJ C(s) + 2S(s) → CS2(l) ΔH = +89.4 kJ Find the ΔH of the following reaction: SO2(g) → S(s) + O2(g)
Sulfur dioxide, SO2(g), can react with oxygen to produce sulfur trioxide, SO2(g), by the reaction 2 502(g) + O2(g) → 250 (8) The standard enthalpies of formation for SO2(g) and SO2(g) are AH; (SO2(8)) = –296.8 kJ/mol AH (SO2(2)) = –395.7 kJ/mol Calculate the amount of energy in the form of heat that is produced when a volume of 4.46 L of So,(g) is converted to 4.46 L of So, (g) according to this process at a constant pressure and...
34. At volcanic sites, sulfur is formed via the following reaction. 2 H2S(g) +SO2(g) = 3S(s) +2 H20(g) a. Calculate the equilibrium constant, K, for this reaction at 25°C. 4 Gº (kJ/mol H2S (8) SO2) H20 (8) -33.0 -300.4 -228.6 s, b. Predict whether sulfur formation becomes more or less favorable as temperature increases. Explain. C Sulfur dioxide is a pollutant released by power plants. Would this reaction be suitable for removing SO2 from power plant waste?
Sulfur dioxide, SO2(g), can react with oxygen to produce sulfur trioxide, SO3(g), by the reaction 2 50, (g) + O2(g) 250, (g) The standard enthalpies of formation for SO2(g) and SO2(g) are AH (SO2(g)] = –296.8 kJ/mol AH (SO2(g)] = -395.7 kJ/mol Calculate the amount of energy in the form of heat that is produced when a volume of 1.09 L of So, (g) is converted to 1.09 L of So, (g) according to this process at a constant pressure...
Coal burns in oxygen exothermically as shown below: C(s) + O2(g) → CO2 (g) AH = -393.5 kJ What amount of heat will be released when 100.0 g of it is burned? Molar mass of C = 12.01/mol -3935 kJ -0.3930 kJ -3276 kJ -4726 kJ
Most questions answered within 3 hours.
-
In females, the labia swells and the vagin-a lubricates during
which phase of the sexual response...
asked 28 minutes ago -
2. An item costs a retailer $200. If a 30 percent markup is
desired, what should...
asked 30 minutes ago -
Your client, Anita, is hurt in a car accident and comes to you
for some advice....
asked 41 minutes ago -
how many mL of 0.1050 M NaOH is needed to reach a pH of 3.74
when...
asked 37 minutes ago -
QUESTION
Memory retrieval that is easier when the person is in the same
psychological condition during...
asked 40 minutes ago -
The mean annual inflation rate in the UNited States over the
past 98 years in 3.37%...
asked 47 minutes ago -
Design a class Holiday that represents a
holiday during the year. This class has three
private...
asked 1 hour ago -
Problem 1 (Logistic Regression and KNN). In this problem, we
predict Direction using the data Weekly.csv....
asked 1 hour ago -
What is the difference between VNTRs (Variable Number Tandem
Repeats) and STRs (Short Tandem Repeats) used...
asked 1 hour ago -
Fill in
Isotope: 15 O
1. Element name:
2. Atomic number:
3. Mass number:
4. Number...
asked 1 hour ago -
These days with the cost of a college education it is important
to be able to...
asked 1 hour ago -
c++
Implement Radix Sort Most sorting algorithms, like bubble,
insertion, selection and shell follow similar implementations....
asked 1 hour ago