CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol Calculate the amount of heat released when 54.4 g of diborane is burned, heat released = kJ
Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ
5. (20 pts) Consider the following reaction OF2(g) + H2O(g) ---> 2 HF(g) + O2(g) AH.(kJ/mole)=-318 kJ/mole (a) Using this information along with data in the appendix of your textbook, calculate AH (OF,(g)) in kJ/mole at 25°C. (b) If 15.0 g of OF2(g) and 10.0 g of H2Og) react, how much heat, expressed in kJ is released? Hint: First calculate the limiting reagent.
How much heat is released if 715 g Cao(s) is added to 152 g of H2O()? CAO(s) + H2O() - Ca(OH)2(s) AH an - -64.8 kJ/moll 0 768 kJ 0 8.26 0 0 508 ku 0 547) 0 555)
5. (20 pts) Consider the following reaction OF2(g) + H2O(g) ---> 2 HF(g) + O2(g) AH.(kJ/mole) -318 kJ/mole (a) Using this information along with data in the appendix of your textbook, calculate AH;(OF,(8)) in kJ/mole at 25°C. (b) If 15.0 g of OF2(g) and 10.0 g of H2Og) react, how much heat, expressed in kJ is released? Hint: First calculate the limiting reagent. 6.(20 pts) Consider two Styrofoam coffee cups. If cup #1 contains 102.0 mL of water at 81.8°C...
At 25°C, the following heats of reaction are known: AH (kJ/mol 167.4 2CIF + 02 →Cl20 + F20 2ClF3 + 202 →Cl20+3F20 341.4 2F2 + 02 → 2F20 At the same temperature, calculate ΔH for the reaction: ClF + F2 → CIF3 -43.4 A. -217.5 kJ/mol B.-130.2 kJ/mol C. +217.5 kJ/mol ○ D.-108.7 kJ/mol E. none of these QUESTION 4 Consider the reaction: When a 12.9-g sample of ethyl alcohol(molar mass 46.07 g/mol) is burned, how much energy is released...
How much heat is released if 7.15 g Cao(s) is added to 152 g of H2O(l)?! Cao(s) + H2O) - Ca(OH)2(s) AHxn = -64.8 kJ/mol Select one: a. 7.68 kJ O b.8.26 kJ O c. 508 kJ d. 547 kJ O e. 555 kJ
Consider the following reaction: C(s, diamond) + O2(g) - CO2(g) substance AHF (kJ/mol) C(s, diamond) 2.0 CO2(g) -393.5 H20(1) -286.0 02(9) 0.0 How much heat is evolved when 1.201x101 g of C(s, diamond) is burned in excess oxygen. Answer to 4 sig figs. Assume standard conditions. Note that, by convention, a decrease in enthalpy of the system will result in a positive quantity of heat being evolved. Submit Answer Incorrect. Tries 7/99 Previous Tries How much heat is evolved when...
#3 Consider the reaction below for questions 1-3. C(s) + H2O(g) → CO(g) + Hz(9) AH = -274 kJ/mol 1. Draw and label a reaction coordinate diagram for the reaction. 2. How many grams of carbon are required to produce 15000.0kJ of energy? 3. What is AH when 9633L of CO is produced at STP?