Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol...

Question

Question

Answer 1

Answer #1

moles of B2H6 = 54.4 g / 26.67 g/mol = 2.024 mol

from the balanced equation

1 mol of B2H6 will give -2035 kj accordingly

2.024 nol will give 2.024 x 2035 kJ = 4120.36 kJ

Answer 2

Similar Homework Help Questions

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Consider the following reaction: Ca(s) + 2 H_2O(l) rightarrow Ca(OH)_2(s) + H_2(g) Calculate the heat of...

Consider the following reaction: Ca(s) + 2 H_2O(l) rightarrow Ca(OH)_2(s) + H_2(g) Calculate the heat of reaction based on the following information: 2H_2(g) + O_2(g) rightarrow 2 H_2O(l) DeltaH = -572 kJ/mol CaO(s) + H_2O(l) rightarrow Ca(OH)_2(s) DeltaH = -64 kJ/mol CaCO_3(s) rightarrow CaO(s) + CO_2(g) DeltaH = +178.1 kJ/mol 2 Ca (s) + O_2(g) rightarrow 2 CaO(s) DeltaH = -1270 kJ/mol 13. Acetylene is used in blow torches, and bums according to the following equation: 2 C_2H_2(g) + 5...
A chemist measures the energy change Delta H during the following reaction: 2H_2I(l) rightarrow 2H_2(g) +...

A chemist measures the energy change Delta H during the following reaction: 2H_2I(l) rightarrow 2H_2(g) + O_2(g) Delta H = 572. kJ Use the information to answer the following questions. This reaction is ... exothermic endothermic Suppose 94.8 g of H_2O react. Will any heat be released or absorbed? Yes, absorbed Yes, released No If you said heat will be released or absorbed in the second part of this question, calculate how much heat will be released or absorbed. Round...

Using the following reactions: N_2(g) + O_2(g) rightarrow 2 NO(g) Delta H = 181 kJ times...

Using the following reactions: N_2(g) + O_2(g) rightarrow 2 NO(g) Delta H = 181 kJ times 2 NO(g) + O_2 rightarrow 2 NO_2(g) Delta H = -113 kJ times 2 N_2O(g) rightarrow 2 N_2(g) + O_2(g) Delta H = -163 kJ times Determine the enthalpy change for the reaction: N_2O(g) + NO_2(g) rightarrow 3 NO(g) Delta H =
Consider the following reaction: 2Ca(s) + O_2(g) rightarrow 2CaO(s) Delta H_rxn = -1269.8 kJ; Delta S_rxn...

Consider the following reaction: 2Ca(s) + O_2(g) rightarrow 2CaO(s) Delta H_rxn = -1269.8 kJ; Delta S_rxn degree = -364.6 J/K Assume that all reactants and products are in their standard states. Part A Calculate the free energy change for the reaction at 28 degree C. Part B Is the reaction spontaneous? spontaneous nonspontaneous
Given reactions 1 and 2 below, calculate delta H degree_Rxn and delta U degree_Rxn for reaction...

Given reactions 1 and 2 below, calculate delta H degree_Rxn and delta U degree_Rxn for reaction 3. Rxn 1 H_2(g) + I_2(s) rightarrow 2 HI(g) delta H degree_Rxn = +52.96 kJ/mol Rxn 2 2H_2(g) + O_2(g) rightarrow 2 H_2 O(g) delta H degree_Rxn = -483.64 kJ/mol Rxn 3 4 HI(g) + O_2(g) rightarrow 2 I_2(s) + 2 H_2O(g) delta H degree_Rxn = ? delta U degree_Rxn = ?

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ How much heat is released when a mixture of 8.26 g B2H7 and 8.80 g 02 is burned? heat released = kJ Submit Show Hints
For the reaction N_2(g) + 3 H_2(g) rightarrow 2 NH_3(g) Delta G degree = -23.6 kJ...

For the reaction N_2(g) + 3 H_2(g) rightarrow 2 NH_3(g) Delta G degree = -23.6 kJ and Delta S degree = -198.7 J/K at 345 K and 1 atm. This reaction is (reactant, product) favored under standard conditions at 345 K. The standard enthalpy change for the reaction of 2.30 moles of N_2(g) at this temperature would be kJ. For the reaction 2 H_2O_2(l) rightarrow 2 H_2O(l) + O_2(g) Delta G degree = -236.9 kJ and Delta H degree =...
Consider the reaction: FeO (s) + Fe (s) + O_2 (g) rightarrow Fe_2O_3 (s) Given the...

Consider the reaction: FeO (s) + Fe (s) + O_2 (g) rightarrow Fe_2O_3 (s) Given the following table of thermodynamic data, Substance Delta H_f degree S degree FeO (S) -271.9 kJ/mol 60.75 J/mol - K Fe (s) 0 27.15 O_2 (g) 0 205.0 Fe_2O_3 (S) -822.16 89.96 determine the temperature (in degree C) above which the reaction is nonspontaneous.

Consider the reaction represented by the unbalanced equation NH_3 + O_2 rightarrow NO + H_2O. For...

Consider the reaction represented by the unbalanced equation NH_3 + O_2 rightarrow NO + H_2O. For every 6.94 mol of NH_3 that reacts, mol of O_2 is required. 8.68 6.94 27.76 5.55 none of these