Homework Answers
Add Answer to:
1. Amphetamine is the active ingredient in the ADHD medication called Adderall. The chemical formula for...
I just want to see the steps on how to work out the problem, thanks. 18....
I
just want to see the steps on how to work out the problem,
thanks.
18. Octane (CHıx) undergoes combustion according to the following thermochemical equation. 2C3H13() + 2502(g) → 16CO2(g) + 18H2011 AHnx = -1.0940 * 10ºkJ/mol What is the standard enthalpy of formation of liquid octane? AH* (CO2(g)) = -393.5 kJ/mol and AH® (H20(0) = -285.8 kJ/mol A.-250 kJ/mol B. -10,940. kl/mol C.-2188 kJ/mol D. -495 kJ/mol E. 495 kJ/mol
The balanced chemical equation for the oxygen combustion of acetone, C3H.O(l), the active ingredient in nail...
The balanced chemical equation for the oxygen combustion of acetone, C3H.O(l), the active ingredient in nail polish remover, is C3H6O(1) + 4 O2(g) -> 3 CO2(g) + 3 H2O(g) AHrxn = -5074 kJ If I completely burn 0.5000 moles of acetone, how much heat do I generate? Assume your answer is in units of kJ. Give your answer to 4 significant figures. Remember: AHrxn is exothermic!
Using Hess's Law to Calculate a Standard Enthalpy of Formation On the Solution Calorimetry Lab Report...
Using Hess's Law to Calculate a Standard Enthalpy of Formation On the Solution Calorimetry Lab Report Form, vou will be asked to calculate a standard enthalpy of formation for magnesium oxide based on your experimental results. Below is an example of how to do this type of calculation. Calculate the standard enthalpy of formation of gaseous diborane (B2H6) using the following thermochemical equations: 4 B(s) + 3 O2(g)-> 2 B2O3(s) 2 H2(g) + O2(g) > 2 H20(0) B2H6(8) +3 O2(g)...
Write the thermochemical equation that would be used to represent the standard heat of formation of sodium bicarbon...
Write the thermochemical equation that would be used to represent the standard heat of formation of sodium bicarbonate, NaHCO3(s). Na(s) + H2(g) + C(s) + H20(1) NaHCO3(s) AH° = -947.7 kJ/mol Na2O(s) + H2O(g) + CO2(g) + O2(g) + NaHCO3(s) AH = -947.7 kJ/mol O Na(s) + 0.5H2(g) + C(s) + 1.502(g) + NaHCO3(s) AH = -947.7 kJ/mol Na2CO3(s) + H20(1) - NaHCO3(s) AH = -947.7 kJ/mol
13 Question (3 points) The enthalpy change for a chemical reaction is the sum of the...
13 Question (3 points) The enthalpy change for a chemical reaction is the sum of the energy consumed in breaking bonds and the energy released during bond formation. One way to determine the overall energy change for a chemical reaction is to apply Hess's law to add together a group of reactions which can be arranged such that the chemical equations, when combined, give the overall equation we are trying to characterize Part 1 (1 point) Il See Periodic Table...
3. (25 pts) Buckminsterfullerene is a molecule with the formula C. (60 atoms of carbon held...
3. (25 pts) Buckminsterfullerene is a molecule with the formula C. (60 atoms of carbon held together by covalent bonds). It was manufactured in 1985 at Rice University. Given the following data: CO2(g) + C(s, graphite) + O2(8) AH,° = +393.5 kJ 60 CO2 (g) → Co (s) + 60 02(8) AH2° = +25937 kJ Write the balanced standard enthalpy equation for the formation of solid Coo law to determine the standard enthalpy (or heat) formation of solid Co. Buckminsterfullere
7) Find AH° for the reaction C3Hg(8) + 5 O2(8) - 3 CO2(8) + 4 H2O(l)....
7) Find AH° for the reaction C3Hg(8) + 5 O2(8) - 3 CO2(8) + 4 H2O(l). AH° = -2046 kJ for the reaction: C3H8(8) + 5 O2(8) - 3 CO2(g) + 4H2O(8) The heat of vaporization of water is 44.0 kJ/mol. The standard enthalpy of formation of water and water vapor are -285.9kj/mol and -241.8 kj/mol, respectively. Note that H20 is a liquid in the first reaction and a gas in the second. 0-1870 kJ 0-2222 kJ O-2002 kJ 0-2090...
3. The standard enthalpy of formation of ethylbenzene (C3H10 (1)] is -12.5 kJ mol!. Calculate its...
3. The standard enthalpy of formation of ethylbenzene (C3H10 (1)] is -12.5 kJ mol!. Calculate its standard enthalpy of combustion. (AH®(CO2 (g)) = -393.51kJ mol', AH®, (H20 (1))= -285.83 kJ mol'). (Note: to solve this question you should write the balanced equation of ethylbenzene combustion reaction)
can you do the 7 and 9 ? can you also show and explain me step...
can you do the 7 and 9 ? can you also show and explain
me step by step?
D. 49.6 kJ E. 57.3 kJ 7. Butane (C4H10) undergoes combustion in excess oxygen to generate gaseous carbon dioxide and water. Given AH° [C4H10(g)] = -124.7 kJ/mol, AH° [CO2(g)] = -393.5 kJ/mol, AH [H2O(g)] = -241.8 kJ/mol, how much energy is released (kJ) when 8.30 g of butane is burned? Combustion of butane: 2 CH2(g) + 13 O2(g) → 8 CO2(g) +...
The enthalpy change for a chemical reaction is the sum of the energy consumed in breaking...
The enthalpy change for a chemical reaction is the sum of the energy consumed in breaking bonds and the energy released during bond formation. One way to determine the overall energy change for a chemical reaction is to apply Hess's law to add together a group of reactions which can be arranged such that the chemical equations, when combined, give the overall equation we are trying to characterize 3rd attempt See Hint Ad See Periodic Table Part 1 (1 point)...
I
just want to see the steps on how to work out the problem,
thanks.
18. Octane (CHıx) undergoes combustion according to the following thermochemical equation. 2C3H13() + 2502(g) → 16CO2(g) + 18H2011 AHnx = -1.0940 * 10ºkJ/mol What is the standard enthalpy of formation of liquid octane? AH* (CO2(g)) = -393.5 kJ/mol and AH® (H20(0) = -285.8 kJ/mol A.-250 kJ/mol B. -10,940. kl/mol C.-2188 kJ/mol D. -495 kJ/mol E. 495 kJ/mol
The balanced chemical equation for the oxygen combustion of acetone, C3H.O(l), the active ingredient in nail polish remover, is C3H6O(1) + 4 O2(g) -> 3 CO2(g) + 3 H2O(g) AHrxn = -5074 kJ If I completely burn 0.5000 moles of acetone, how much heat do I generate? Assume your answer is in units of kJ. Give your answer to 4 significant figures. Remember: AHrxn is exothermic!
Using Hess's Law to Calculate a Standard Enthalpy of Formation On the Solution Calorimetry Lab Report Form, vou will be asked to calculate a standard enthalpy of formation for magnesium oxide based on your experimental results. Below is an example of how to do this type of calculation. Calculate the standard enthalpy of formation of gaseous diborane (B2H6) using the following thermochemical equations: 4 B(s) + 3 O2(g)-> 2 B2O3(s) 2 H2(g) + O2(g) > 2 H20(0) B2H6(8) +3 O2(g)...
Write the thermochemical equation that would be used to represent the standard heat of formation of sodium bicarbonate, NaHCO3(s). Na(s) + H2(g) + C(s) + H20(1) NaHCO3(s) AH° = -947.7 kJ/mol Na2O(s) + H2O(g) + CO2(g) + O2(g) + NaHCO3(s) AH = -947.7 kJ/mol O Na(s) + 0.5H2(g) + C(s) + 1.502(g) + NaHCO3(s) AH = -947.7 kJ/mol Na2CO3(s) + H20(1) - NaHCO3(s) AH = -947.7 kJ/mol
13 Question (3 points) The enthalpy change for a chemical reaction is the sum of the energy consumed in breaking bonds and the energy released during bond formation. One way to determine the overall energy change for a chemical reaction is to apply Hess's law to add together a group of reactions which can be arranged such that the chemical equations, when combined, give the overall equation we are trying to characterize Part 1 (1 point) Il See Periodic Table...
3. (25 pts) Buckminsterfullerene is a molecule with the formula C. (60 atoms of carbon held together by covalent bonds). It was manufactured in 1985 at Rice University. Given the following data: CO2(g) + C(s, graphite) + O2(8) AH,° = +393.5 kJ 60 CO2 (g) → Co (s) + 60 02(8) AH2° = +25937 kJ Write the balanced standard enthalpy equation for the formation of solid Coo law to determine the standard enthalpy (or heat) formation of solid Co. Buckminsterfullere
7) Find AH° for the reaction C3Hg(8) + 5 O2(8) - 3 CO2(8) + 4 H2O(l). AH° = -2046 kJ for the reaction: C3H8(8) + 5 O2(8) - 3 CO2(g) + 4H2O(8) The heat of vaporization of water is 44.0 kJ/mol. The standard enthalpy of formation of water and water vapor are -285.9kj/mol and -241.8 kj/mol, respectively. Note that H20 is a liquid in the first reaction and a gas in the second. 0-1870 kJ 0-2222 kJ O-2002 kJ 0-2090...
3. The standard enthalpy of formation of ethylbenzene (C3H10 (1)] is -12.5 kJ mol!. Calculate its standard enthalpy of combustion. (AH®(CO2 (g)) = -393.51kJ mol', AH®, (H20 (1))= -285.83 kJ mol'). (Note: to solve this question you should write the balanced equation of ethylbenzene combustion reaction)
can you do the 7 and 9 ? can you also show and explain
me step by step?
D. 49.6 kJ E. 57.3 kJ 7. Butane (C4H10) undergoes combustion in excess oxygen to generate gaseous carbon dioxide and water. Given AH° [C4H10(g)] = -124.7 kJ/mol, AH° [CO2(g)] = -393.5 kJ/mol, AH [H2O(g)] = -241.8 kJ/mol, how much energy is released (kJ) when 8.30 g of butane is burned? Combustion of butane: 2 CH2(g) + 13 O2(g) → 8 CO2(g) +...
The enthalpy change for a chemical reaction is the sum of the energy consumed in breaking bonds and the energy released during bond formation. One way to determine the overall energy change for a chemical reaction is to apply Hess's law to add together a group of reactions which can be arranged such that the chemical equations, when combined, give the overall equation we are trying to characterize 3rd attempt See Hint Ad See Periodic Table Part 1 (1 point)...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 12 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago