Homework Answers
Add Answer to:
Which one of the following sets of elements can be grouped into a single classification? Sodium,...
Material science class Suppose 1 at % of the following elements is added to aluminum (forming...
Material science class
Suppose 1 at % of the following elements is added to aluminum (forming a separate alloy with each element) without exceeding the solubility limit. Which one of the following would be expected to give the higher strength alloy. Mn: Ga: Be; or Li? The Atomic and lonic Radii of Selected Elements Valence Element Aluminum Antimony Arsenic Barium Beryllium Bismuth Boron Bromine Cadmium Calcium Carbon Cerium Cesium Chlorine Chromium Cobalt Copper Fluorine Gallum Germanium Atomic Radius (A) 1.432...
can you please explain the answers 14. How many protons are there in an atom of...
can you please explain the answers
14. How many protons are there in an atom of uranium whose mass number is 235? A) 92 B) 143 C) 235 D) 238 E) 327 15. The chemical name for CIO, is chlorite ion. Therefore, the name of HCIO, is A) hydrochloric acid B) chloroform C) hydrogen dioxychloride D) chlorous acid E) chloric acid 16. Which of the following elements is chemically similar to potassium? A) calcium B) arsenic C) phosphorus D) cerium...
14. How many protons are there in an atom of uranium whose mass number is 235?...
14. How many protons are there in an atom of uranium whose mass number is 235? A) 92 B) 143 C) 235 D) 238 E) 327 Therefore, the name of HCIO, is 15. The chemical name for CIO, is chlorite ion. A) hydrochloric acid B) chloroform C) hydrogen dioxychloride D) chlorous acid E) chloric acid 16. Which of the following elements is chemically similar to potassium? A) calcium B) arsenic C) phosphorus D) cerium E) cesium 17. Which one of...
1. Which ONE of the following lists gives the correct symbols for the elements phosphorus, potassium,...
1. Which ONE of the following lists gives the correct symbols for the elements phosphorus, potassium, silver, chlorine, and sulfur in that order? A) K, Ag, Po, Cl, S B) P, Po, Ag, CI, S C) Ph, K, Ag, S, Cl D) E) P, K, Ag, Cl, S Ph, Po, Ag, CI,S 2. Which of the following is NOT a correct name-symbol combination? A) beryllium, Be B) boron, B C) cobalt, Co D) magnesium, Mn E) copper, Cu 3. If...
3.2 Periodic trends 1. (0620-5 2012-Paper 1/2-Q21) Which properties of the element titanium, Ti, can be...
3.2 Periodic trends 1. (0620-5 2012-Paper 1/2-Q21) Which properties of the element titanium, Ti, can be predicted from its position in the Periodic Table? forms coloured compounds conducts electricity when solid can be used has low density as a catalyst X A X X Xx 2. (0620-W 2012-Paper 1/1-Q20) The diagram shows an outline of the Periodic Table. U V W X Y Which of the elements U, V, W, X and Y would react together in the ratio of...
need help with the rest of the table EXPERIMENT 10 DETERMINATION OF THE ELECTROCHEMICAL SERIES PURPOSE...
need help with the rest of the table
EXPERIMENT 10 DETERMINATION OF THE ELECTROCHEMICAL SERIES PURPOSE To determine the standard cell potential values of several electrochemical coll INTRODUCTION The basis for an electrochemical cell is an oxidation reduction Corredor be divided into two half reactions reaction. This reaction can Oxidation half reaction Gloss of electrons) takes place at the anode, which is the positive electrode that the anions migrate to Chence the name anode) Reduction half reaction (gain of electrons)...
CHEM 1411. Review Exercises for Chapter 3, 7, 8. F19 1. Give the number of lone...
CHEM 1411. Review Exercises for Chapter 3, 7, 8. F19 1. Give the number of lone pairs around the central atom and the geometry of the ion CIO2 A) 0 lone pairs, linear 1 lone pair, bent B) C) 2 lone pairs, bent D) 3 lone pairs, bent E) 3 lone pairs, linear 2. Predict the geometry and polarity of the CS2 molecule. A) linear, polar B) linear, nonpolar C) tetrahedral, nonpolar D) bent, nonpolar E) bent, polar 3. Which...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of w...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
10. Write a one-page summary of the attached paper? INTRODUCTION Many problems can develop in activated...
10. Write a one-page summary of the attached paper? INTRODUCTION Many problems can develop in activated sludge operation that adversely affect effluent quality with origins in the engineering, hydraulic and microbiological components of the process. The real "heart" of the activated sludge system is the development and maintenance of a mixed microbial culture (activated sludge) that treats wastewater and which can be managed. One definition of a wastewater treatment plant operator is a "bug farmer", one who controls the aeration...
Using enthalpies of formation (Appendix C), calculate ΔH ° for the following reaction at 25°C. Also...
Using enthalpies of formation
(Appendix C), calculate ΔH ° for the following reaction at 25°C.
Also calculate ΔS ° for this reaction from standard entropies at
25°C. Use these values to calculate ΔG ° for the reaction at this
temperature. COCl2(g) + H2O(l ) h CO2(g) + 2HCl(g).
Appendix C Thermodynamic Quantities for Substances and Ions at 25°C Substance or lon AH; (kW/mol) 0 AG: (kJ/mol) 0 S° (J/mol-K) 20.87 ΔΗ, (kJ/mol) -946.3 - 33422 AG; {kj/mol) --859,3 -2793 (J/mol-K)...
Material science class
Suppose 1 at % of the following elements is added to aluminum (forming a separate alloy with each element) without exceeding the solubility limit. Which one of the following would be expected to give the higher strength alloy. Mn: Ga: Be; or Li? The Atomic and lonic Radii of Selected Elements Valence Element Aluminum Antimony Arsenic Barium Beryllium Bismuth Boron Bromine Cadmium Calcium Carbon Cerium Cesium Chlorine Chromium Cobalt Copper Fluorine Gallum Germanium Atomic Radius (A) 1.432...
can you please explain the answers
14. How many protons are there in an atom of uranium whose mass number is 235? A) 92 B) 143 C) 235 D) 238 E) 327 15. The chemical name for CIO, is chlorite ion. Therefore, the name of HCIO, is A) hydrochloric acid B) chloroform C) hydrogen dioxychloride D) chlorous acid E) chloric acid 16. Which of the following elements is chemically similar to potassium? A) calcium B) arsenic C) phosphorus D) cerium...
14. How many protons are there in an atom of uranium whose mass number is 235? A) 92 B) 143 C) 235 D) 238 E) 327 Therefore, the name of HCIO, is 15. The chemical name for CIO, is chlorite ion. A) hydrochloric acid B) chloroform C) hydrogen dioxychloride D) chlorous acid E) chloric acid 16. Which of the following elements is chemically similar to potassium? A) calcium B) arsenic C) phosphorus D) cerium E) cesium 17. Which one of...
1. Which ONE of the following lists gives the correct symbols for the elements phosphorus, potassium, silver, chlorine, and sulfur in that order? A) K, Ag, Po, Cl, S B) P, Po, Ag, CI, S C) Ph, K, Ag, S, Cl D) E) P, K, Ag, Cl, S Ph, Po, Ag, CI,S 2. Which of the following is NOT a correct name-symbol combination? A) beryllium, Be B) boron, B C) cobalt, Co D) magnesium, Mn E) copper, Cu 3. If...
3.2 Periodic trends 1. (0620-5 2012-Paper 1/2-Q21) Which properties of the element titanium, Ti, can be predicted from its position in the Periodic Table? forms coloured compounds conducts electricity when solid can be used has low density as a catalyst X A X X Xx 2. (0620-W 2012-Paper 1/1-Q20) The diagram shows an outline of the Periodic Table. U V W X Y Which of the elements U, V, W, X and Y would react together in the ratio of...
need help with the rest of the table
EXPERIMENT 10 DETERMINATION OF THE ELECTROCHEMICAL SERIES PURPOSE To determine the standard cell potential values of several electrochemical coll INTRODUCTION The basis for an electrochemical cell is an oxidation reduction Corredor be divided into two half reactions reaction. This reaction can Oxidation half reaction Gloss of electrons) takes place at the anode, which is the positive electrode that the anions migrate to Chence the name anode) Reduction half reaction (gain of electrons)...
CHEM 1411. Review Exercises for Chapter 3, 7, 8. F19 1. Give the number of lone pairs around the central atom and the geometry of the ion CIO2 A) 0 lone pairs, linear 1 lone pair, bent B) C) 2 lone pairs, bent D) 3 lone pairs, bent E) 3 lone pairs, linear 2. Predict the geometry and polarity of the CS2 molecule. A) linear, polar B) linear, nonpolar C) tetrahedral, nonpolar D) bent, nonpolar E) bent, polar 3. Which...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
Using enthalpies of formation
(Appendix C), calculate ΔH ° for the following reaction at 25°C.
Also calculate ΔS ° for this reaction from standard entropies at
25°C. Use these values to calculate ΔG ° for the reaction at this
temperature. COCl2(g) + H2O(l ) h CO2(g) + 2HCl(g).
Appendix C Thermodynamic Quantities for Substances and Ions at 25°C Substance or lon AH; (kW/mol) 0 AG: (kJ/mol) 0 S° (J/mol-K) 20.87 ΔΗ, (kJ/mol) -946.3 - 33422 AG; {kj/mol) --859,3 -2793 (J/mol-K)...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 55 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago