What is the IUPAC name for the following alkane? CH3 CH3-CH-CH2-CH2-CH2-CH3 What is the IUPAC name for the following alkane? CH2 CH CH2-CH3 CH2 Including the cis or trans designation, what is the IUPAC name of the following substance? It is not necessary to put cis or trans in italics. CH3 CH3CH2 CH2CHa Including the cis or trans designation, what is the IUPAC name of the following substance? It is not necessary to put cis or trans in italics. CH3...
What is the ( IUPAC ) name for (CH3)3CCH2CHCICH2CHO?
What is the IUPAC name for the following molecule: CH2CH2C=CH2 CH3 What is the IUPAC name for the following molecule: CH CH CHE CH2CH2CHCCH,CHCH нс Сн,сн What is the IUPAC name for the following molecule: CH2CH2CHCH2CH2CH2CH3 CH.CH What is the IUPAC name for the following molecule: Which of the following statements is true about this molecule: a. It has a cis configuration b.it has a trans configuration c. It is an alkyne d. it is saturated
IUPAC name for the following? Give the IUPAC name for the following: sm alordat CH3-- CH3- OH b. ОН CH3-- CH2 -- CH -- CH3 HO
what is the IUPAC name for this compound? H3C CH3
? What is the IUPAC name for the compound? Н,С— СН,—CH—CH, ОН CH3 IUPAC name:
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
What is the IUPAC name for the following compound CH3-CH-CH3 with an OH attached to the second carbon?
Name the following molecule accoring to the IUPAC rules: CH3 H3C- CH-CH2-CH-CH2-CH2-CH3 CH2-CH2-CH3 IUPAC Name:
What is the IUPAC name of the following substance? CH3 CH3CH2CH2C=C(CH3 CH3 2-ethyl-3-heptene