1. Which is the most electronegative element in 2-bromoethanol (BrCH2CH2OH)?
2.
Homework Answers
Add Answer to:
1. Which is the most electronegative element in 2-bromoethanol
(BrCH2CH2OH)?
2.
Identify a carbon that is...
In each of the following groups, which element is the most electronegative? Which is the least...
In each of the following groups, which element is the most electronegative? Which is the least electronegative? (Give the element symbol as your answer.) most electronegative least electronegative (a) F, Na, Br (b) Mg, Ca, Rb (c) N, Br, S
Identify the letter of choice that best completes the statement or answers the question. PLEASE ANSWER...
Identify the letter of choice that best completes the
statement or answers the question. PLEASE ANSWER ALL! Thank
you!
Part I. Multiple Choice Identify the letter of the choice that best completes the statement or answers the question (2 points each). 1. Which atomic orbitals overlap to form the carbon-carbon o bond and bond of ethylene, HC-CH2? a. o: sp + sp, and sp?+ sp c. 0:sp+ sp, and spi+sp? b. o: sp + sp, and p+p d. o: sp+sp',...
Which of the following compounds is the strongest carbon acid (which has the most acidic H's)...
Which of the following compounds is the strongest carbon acid (which has the most acidic H's) ? CH2-C-CH2-NO CH-C-CH,-CH 11. CH2-CH-CH2-N-CH, IV NC-CH CH2-NO CH3 Select one: C. I D. IV
5. According to periodic trends, which element is the most electronegative? A. Ne B. O C....
5. According to periodic trends, which element is the most electronegative? A. Ne B. O C. F 6. What is the electron group (EG) and molecular geometry (MG) of an ammonia molecule? A. (EG) tetrahedral and (MG) tetrahedral B. (EG) tetrahedral and (MG) trigonal pyramidal C. (EG) tetrahedral and (MG) bent
for question 19 can you explain why you picked the reagents you did? Sterist CH; HC CHH; CCH; - CC CH trans vinylic...
for question 19 can you explain why you picked the reagents you
did?
Sterist CH; HC CHH; CCH; - CC CH trans vinylic anion more stable anion able cis vinylic a less stab electron repulsion cis radical anion less stable Hical anion is more stable than the cis radical anion, because the nonbonded electrons are farther apart i The trans vinylic anion is more stable than the cis vinylic anion, because the relatively bulky alkyl group in the trans isomer...
Which species contains a labeled carbon that is sp^2 hybridized? Please draw lewis structures of each...
Which species contains a labeled carbon that is sp^2 hybridized?
Please draw lewis structures of each species
3) Which species contains a labelled carbon that is sp2 hybridized? Note that non-bonding electrons have not been drawn in! CH2 (a) 1 only (b) 2 only (c) 3 only (d) Both 1 and 2 (e) Species 1, 2 and 3
1. Which is a true statement about amino acids? a. They are amphiprotic b. The a-carbon...
1. Which is a true statement about amino acids? a. They are amphiprotic b. The a-carbon has an ester attached c. They are symmetrical d. They are planar e. The α-carbon has a phosphate group attached 2. Which is an incorrect statement regarding the side chains of amino acids? a. Tryptophan, tyrosine, and phenylalanine contain an aromatic group. b. Isoleucine, and leucine are isomers of each other. c. Lysine and methionine contain an amine group. d. Threonine, serine, and tyrosine...
Using the definition of oxidation states of carbon, which range from –4 to +4, write the...
Using the definition of oxidation
states of carbon, which range from –4 to +4, write the number for
the oxidation state of each carbon in the structures below.
(Professor states that oxidation states of carbon is # of
bonds to more electronegative atoms - # of bonds to less
electronegative atoms)
Oxidation state: A =
B =
C =
D = E =
CH2-OH H-C-CI CHCl3 HEC-CH2-BH, A B C D E
please answer all 40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c)...
please answer all
40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c) 2-butanol b) 2-methyl-1-propanol d)2-methyl-2-propanol e) none of these 41. In a phenol, which group is the substituent on the benzene ring? a) fluoro b) hydroxyl c) sulfhydryl d) carbonyl e ) carboxyl H,C-CH2OH 42. Which is the correct IUPAC name for this compound? HyC-CH-CH2-CH-CH, a) 2-ethyl-4-pentanol c) 4-ethyl-2-pentanol b) 3-methyl-5-hexanol d) 4-methyl-2-hexanol 43. Identify the electron group geometry at each of the carbon atoms...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6-...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
Identify the letter of choice that best completes the
statement or answers the question. PLEASE ANSWER ALL! Thank
you!
Part I. Multiple Choice Identify the letter of the choice that best completes the statement or answers the question (2 points each). 1. Which atomic orbitals overlap to form the carbon-carbon o bond and bond of ethylene, HC-CH2? a. o: sp + sp, and sp?+ sp c. 0:sp+ sp, and spi+sp? b. o: sp + sp, and p+p d. o: sp+sp',...
Which of the following compounds is the strongest carbon acid (which has the most acidic H's) ? CH2-C-CH2-NO CH-C-CH,-CH 11. CH2-CH-CH2-N-CH, IV NC-CH CH2-NO CH3 Select one: C. I D. IV
for question 19 can you explain why you picked the reagents you
did?
Sterist CH; HC CHH; CCH; - CC CH trans vinylic anion more stable anion able cis vinylic a less stab electron repulsion cis radical anion less stable Hical anion is more stable than the cis radical anion, because the nonbonded electrons are farther apart i The trans vinylic anion is more stable than the cis vinylic anion, because the relatively bulky alkyl group in the trans isomer...
Which species contains a labeled carbon that is sp^2 hybridized?
Please draw lewis structures of each species
3) Which species contains a labelled carbon that is sp2 hybridized? Note that non-bonding electrons have not been drawn in! CH2 (a) 1 only (b) 2 only (c) 3 only (d) Both 1 and 2 (e) Species 1, 2 and 3
1. Which is a true statement about amino acids? a. They are amphiprotic b. The a-carbon has an ester attached c. They are symmetrical d. They are planar e. The α-carbon has a phosphate group attached 2. Which is an incorrect statement regarding the side chains of amino acids? a. Tryptophan, tyrosine, and phenylalanine contain an aromatic group. b. Isoleucine, and leucine are isomers of each other. c. Lysine and methionine contain an amine group. d. Threonine, serine, and tyrosine...
Using the definition of oxidation
states of carbon, which range from –4 to +4, write the number for
the oxidation state of each carbon in the structures below.
(Professor states that oxidation states of carbon is # of
bonds to more electronegative atoms - # of bonds to less
electronegative atoms)
Oxidation state: A =
B =
C =
D = E =
CH2-OH H-C-CI CHCl3 HEC-CH2-BH, A B C D E
please answer all
40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c) 2-butanol b) 2-methyl-1-propanol d)2-methyl-2-propanol e) none of these 41. In a phenol, which group is the substituent on the benzene ring? a) fluoro b) hydroxyl c) sulfhydryl d) carbonyl e ) carboxyl H,C-CH2OH 42. Which is the correct IUPAC name for this compound? HyC-CH-CH2-CH-CH, a) 2-ethyl-4-pentanol c) 4-ethyl-2-pentanol b) 3-methyl-5-hexanol d) 4-methyl-2-hexanol 43. Identify the electron group geometry at each of the carbon atoms...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
Most questions answered within 3 hours.
-
Given that a sample of aluminium oxide has a Young's modulus of
393 GPa and a...
asked 1 hour ago -
At a certain temperature, the equilibrium constant, Kc, for this
reaction is 53.3.
H2(g)+I2(g)−⇀↽−2HI(g)Kc=53.3
At this...
asked 2 hours ago -
Question1 ) The STL provides similiar classes called stack and
queue, both of which gave functions...
asked 3 hours ago -
For Questions 1-4, assume you have 5 bits available:
1. For (positive) integers: What is the...
asked 3 hours ago -
convert grams into vloume with the density of water being at
.997514 g/cm^3 at 23.1 Celsuis...
asked 5 hours ago -
Foreman company obtained a $20,000, 6% loan on May 1, 2018.
Principal and interest will be...
asked 5 hours ago -
5. Problem 11.05 (Discounted Payback)
eBook
Project L costs $60,000, its expected cash inflows are $14,000
per...
asked 5 hours ago -
1. Which of the following is true about politics and health
organizations?
A. Health organizations are...
asked 6 hours ago -
A space vehicle is coasting at a constant velocity of 18.1 m/s
in the +y direction...
asked 7 hours ago -
5) Use the following balanced equation to answer questions
(a)-(i).
3 Cu(s) + 8 HNO3(aq) →...
asked 7 hours ago -
A three-year maturity bond with a 12% annual coupon rate is
currently traded at par $1000...
asked 7 hours ago -
1.
What is the minimum volume to use in the Spec 20 cuvette in order
to...
asked 7 hours ago