8. Below is a schematic of the glycolytic pathway. HOW would you identify WHICH reaction(s) was...
8. Below is a schematic of the glycolytic pathway. HOW would you identify WHICH reaction(s) was or was not RATE Limiting? WHAT DATA do you NEED to KNOW ?????
Homework Answers
Usually rate limiting steps are irreversible and far from equilibrium and we can identify from the diagram that the reaction catalyzed by Phosphofructokinase, Hexokinase and Pyruvate kinase are irreversible, hence they are mostly rate limiting in glycolysis.
But phosphofructokinase is cosidered the important rate limiting step in the whole process.
Add Answer to:
8. Below is a schematic of the glycolytic pathway. HOW would you
identify WHICH reaction(s) was...
2. Know what you know about the glycolytic pathway and the allosteric regulatory function of PFK...
2. Know what you know about the glycolytic pathway and the allosteric regulatory function of PFK would each molecule listed below speed up or slow down glycolysis. Explain your thought for each one. • High levels of AMP • High levels of ATP • High levels of Pi
3. Answer the following questions based on the reaction coordinate diagram below: Reaction pathway a. How...
3. Answer the following questions based on the reaction coordinate diagram below: Reaction pathway a. How many transition states are present? Label on the diagram. b. How many intermediates are present? Label on the diagram. c. Is the reaction endergonic or exergonic? d. What is the rate-limiting step for this reaction? 5. The decomposition of SO2CI2 into SO2 and Cl2 is first order in [SO2CI2) a. What is the rate if [SO2Cl2)- 0.2M C, the rate constant is 2.2 x...
3. Answer the following questions based on the reaction coordinate diagram below: Reaction pathway a. How...
3. Answer the following questions based on the reaction coordinate diagram below: Reaction pathway a. How many transition states are present? Label on the diagram. b. How many intermediates are present? Label on the diagram. c. Is the reaction endergonic or exergonic? d. What is the rate-limiting step for this reaction?
Identify which pathway you would expect to be activated in a patient that had a seasonal...
Identify which pathway you would expect to be activated in a patient that had a seasonal flu shot in October 2019. Streptococcus pneumoniae Influenza virus Escherichia coli
3. Given what you now know, what product(s) would you expect to isolate from this reaction?...
3. Given what you now know, what product(s) would you expect to isolate from this reaction? • Ngô – Br (NaOt-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. Identify the major product for each. Y ahoo Br NaOCH heat
Explain how you would use infrared (IR) spectroscopy to determine if this reaction occurred (Identify a...
Explain how you would use infrared (IR) spectroscopy to determine if this reaction occurred (Identify a key IR stretch or bend that would appear or disappear that would let you know a reaction occurred. )
Which statement or set of conditions listed below is not consistent with an Syl reaction pathway?...
Which statement or set of conditions listed below is not consistent with an Syl reaction pathway? O a. Neutral nucleophile work just fine. b. The leaving group is typically the conjugate base of a strong acid. O c. The rate is not dependent upon the concentration of the nucleophile. d. The temperature is relatively "cooler" to reduce competing elimination products. e. The solvent is polar and aprotic. Of. The substrate has a leaving group that is typically on a 30,...
14. Balance each reaction below, and write a cell schematic representing the reaction as it would occur in a galvan...
14. Balance each reaction below, and write a cell schematic representing the reaction as it would occur in a galvanic cell. (a) Al(s) +Zrº+ (aq) - Al+(aq) + Zr(s) (6) Ag+ (aq) + NO(g) Ag(s) + NO3- (aq) (acidic solution) (c) Si0,2- (aq) + Mg(s) — Si(s) + Mg(OH),(s) (basic solution) (d) CIO3- (aq) + MnO2 (s) — Cl(aq) + MnO4- (aq) (basic solution)
3. Given what you now know, what product(s) would you expect to isolate from this reaction?...
3. Given what you now know, what product(s) would you expect to isolate from this reaction? Y +Na + Nao + - Br (NaOf-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. major product for each. heat Br NaOCH3 heat
Which attacking species shown below would be the best choice to enforce an E2 pathway over...
Which attacking species shown below would be the best choice to enforce an E2 pathway over an Sp2 pathway for the reaction below? Attacking Species? Br H CH,MpBr HC-0 NH (a) H (b) e OH H₂C_&_• SH Els (d) (1)
2. Know what you know about the glycolytic pathway and the allosteric regulatory function of PFK would each molecule listed below speed up or slow down glycolysis. Explain your thought for each one. • High levels of AMP • High levels of ATP • High levels of Pi
3. Answer the following questions based on the reaction coordinate diagram below: Reaction pathway a. How many transition states are present? Label on the diagram. b. How many intermediates are present? Label on the diagram. c. Is the reaction endergonic or exergonic? d. What is the rate-limiting step for this reaction? 5. The decomposition of SO2CI2 into SO2 and Cl2 is first order in [SO2CI2) a. What is the rate if [SO2Cl2)- 0.2M C, the rate constant is 2.2 x...
3. Answer the following questions based on the reaction coordinate diagram below: Reaction pathway a. How many transition states are present? Label on the diagram. b. How many intermediates are present? Label on the diagram. c. Is the reaction endergonic or exergonic? d. What is the rate-limiting step for this reaction?
3. Given what you now know, what product(s) would you expect to isolate from this reaction? • Ngô – Br (NaOt-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. Identify the major product for each. Y ahoo Br NaOCH heat
Explain how you would use infrared (IR) spectroscopy to determine if this reaction occurred (Identify a key IR stretch or bend that would appear or disappear that would let you know a reaction occurred. )
Which statement or set of conditions listed below is not consistent with an Syl reaction pathway? O a. Neutral nucleophile work just fine. b. The leaving group is typically the conjugate base of a strong acid. O c. The rate is not dependent upon the concentration of the nucleophile. d. The temperature is relatively "cooler" to reduce competing elimination products. e. The solvent is polar and aprotic. Of. The substrate has a leaving group that is typically on a 30,...
14. Balance each reaction below, and write a cell schematic representing the reaction as it would occur in a galvanic cell. (a) Al(s) +Zrº+ (aq) - Al+(aq) + Zr(s) (6) Ag+ (aq) + NO(g) Ag(s) + NO3- (aq) (acidic solution) (c) Si0,2- (aq) + Mg(s) — Si(s) + Mg(OH),(s) (basic solution) (d) CIO3- (aq) + MnO2 (s) — Cl(aq) + MnO4- (aq) (basic solution)
3. Given what you now know, what product(s) would you expect to isolate from this reaction? Y +Na + Nao + - Br (NaOf-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. major product for each. heat Br NaOCH3 heat
Which attacking species shown below would be the best choice to enforce an E2 pathway over an Sp2 pathway for the reaction below? Attacking Species? Br H CH,MpBr HC-0 NH (a) H (b) e OH H₂C_&_• SH Els (d) (1)
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 46 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago