Please help me solve this problem.
Homework Answers
Add Answer to:
Please help me solve this problem.
8.) Given the following table of thermodynamic data, Substance AHf...
Consider the reaction: 2NO(g) + C12(8) + 2NOCI(g) Given the following table of thermodynamic data, AHF...
Consider the reaction: 2NO(g) + C12(8) + 2NOCI(g) Given the following table of thermodynamic data, AHF (kJ/mol) Substance NO (8) Cl2 (8) NOCI (8) 90.3 0 sº (l/mol.K) 210.7 223.0 261.6 51.7 Calculate Ahºrxn and Asºrxn and determine the temperature at which the reaction switches from being spontaneous to being non- spontaneous.
Show that hydrogen peroxide (H2O2) is a liquid at 25°C by using the data below. ΔHf°...
Show that hydrogen peroxide (H2O2) is a liquid at 25°C by using the data below. ΔHf° (kJ mol-1) data: H2O2(l) = –187.8; H2O2(g) = –136.3 So (J mol-1 K-1) data: H2O2(l) = 110; H2O2(g) = 233
How is A the answer? 21.The temperature at which the following process reaches equilibrium at 1.0...
How is A the answer?
21.The temperature at which the following process reaches equilibrium at 1.0 atm is the normal boiling point of hydrogen peroxide. H2O2(1) H2O2(g) Use the following thermodynamic information at 298 K to determine this temperature. Substance AH°F (kJ mol-)) AG°f (kJ mol Sº (J K-mol) H2O2(1) -187.7 -120.4 109.6 H2O2(g) -136.3 -105.6 232.7 B. 691 K C. 469 K D. 144 K A. 418 K E. 393 K
Consider the reaction: 2NO(g) + Cl2(g) → 2NOCI(g) Given the following table of thermodynamic data, Substance...
Consider the reaction: 2NO(g) + Cl2(g) → 2NOCI(g) Given the following table of thermodynamic data, Substance NO (g) Cl2(g) NOCI (g) AH (kJ/mol) 90.3 0 sº (/mol.K) 210.7 223.0 51.7 261.6 Calculate Ahºrxn and AS rxn and determine the temperature at which the reaction switches from being spontaneous to being non-spontaneous.
Consider the reaction: 2NO(g) + Cl2(g) 2NOCl(g) Given the following table of thermodynamic data, Substance...
Consider the reaction: 2NO(g) + Cl2(g) 2NOCl(g) Given the following table of thermodynamic data, Substance ∆Hfo (kJ/mol) So (J/molK) NO (g) 90.3 210.7 Cl2 (g) 0 223.0 NOCl (g) 51.7 261.6 Calculate ∆Horxn and ∆Sorxn and determine the temperature at which the reaction switches from being spontaneous to being non-spontaneous. Please show all work. Provide equations used. Please use correct significant figures and correct units in answers.
Given the following table of thermodynamic data, substance S° C2H2 (g) 200.8 J/mol −K C2H4 (g)...
Given the following table of thermodynamic data, substance S° C2H2 (g) 200.8 J/mol −K C2H4 (g) 219.4 C2H6 (g) 229.5 H2 (g) 130.58 determine the D S° (in J/mol −K) for the reaction: C2H2 (g) + H2 (g) ® C2H4 (g) −111.98 −101.88 −232.46 +111.98 +101.88
Consider the reaction, NH3 (8) H HC ENH1G(s) Given the following table of thermodynamic data at...
Consider the reaction, NH3 (8) H HC ENH1G(s) Given the following table of thermodynamic data at 298 K: Substana | AH¢{kj/mol | Sº C/K-mol) NH3 (5) 16:19 192.5 HCl (8) 92150 186,69 NHCl (s) 13144 94.6 The value of K for the reaction at 25°C is
help with this please Ca(OH)2(aq) + 2 HCl(aq) +CaCl2(8) + 2 H2O(1) Using the standard thermodynamic...
help with this please
Ca(OH)2(aq) + 2 HCl(aq) +CaCl2(8) + 2 H2O(1) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K ANSWER: N2(g) + O2(g) +2NO(g) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K ANSWER: 2CO(g) + O2(g) +2002(9) - der e en manos de 20, ali ne more than one so mi dicogna undan Using standard thermodynamic data...
Consider the reaction 2 CO2(g) +5 H2(e) C H2(e) + 4H2O(g) Using the standard thermodynamic data...
Consider the reaction 2 CO2(g) +5 H2(e) C H2(e) + 4H2O(g) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K ANSWER: Submit Answer Retry Entire Group more group attempts remaining AH,(kJ/mol) AG® (kJ/mol) Sº (J/mol K) -238.7 -116.0 126.8 219.0 -363.0 249.0 135.1 -166.3 -110.0 -351.0 125.0 209.2 68.2 - 129.0 202.0 226.7 200.9 52.3 - 166.0 -53.0 -277.7 219.6 250.0 242.0 160.7 -13.0 -235.1 282.7 Carbon CH3OH (1) H2CO...
Given the following table of thermodynamic data: Substance S° /J mol−1K−1 X(g) 150.1 Y(g) 194 Z(g)...
Given the following table of thermodynamic data: Substance S° /J mol−1K−1 X(g) 150.1 Y(g) 194 Z(g) 128 Calculate the ΔS° (in J mol −1K −1) for the reaction: X(g) + 3 Y(g) → 2 Z(g)
Consider the reaction: 2NO(g) + C12(8) + 2NOCI(g) Given the following table of thermodynamic data, AHF (kJ/mol) Substance NO (8) Cl2 (8) NOCI (8) 90.3 0 sº (l/mol.K) 210.7 223.0 261.6 51.7 Calculate Ahºrxn and Asºrxn and determine the temperature at which the reaction switches from being spontaneous to being non- spontaneous.
How is A the answer?
21.The temperature at which the following process reaches equilibrium at 1.0 atm is the normal boiling point of hydrogen peroxide. H2O2(1) H2O2(g) Use the following thermodynamic information at 298 K to determine this temperature. Substance AH°F (kJ mol-)) AG°f (kJ mol Sº (J K-mol) H2O2(1) -187.7 -120.4 109.6 H2O2(g) -136.3 -105.6 232.7 B. 691 K C. 469 K D. 144 K A. 418 K E. 393 K
Consider the reaction: 2NO(g) + Cl2(g) → 2NOCI(g) Given the following table of thermodynamic data, Substance NO (g) Cl2(g) NOCI (g) AH (kJ/mol) 90.3 0 sº (/mol.K) 210.7 223.0 51.7 261.6 Calculate Ahºrxn and AS rxn and determine the temperature at which the reaction switches from being spontaneous to being non-spontaneous.
Consider the reaction, NH3 (8) H HC ENH1G(s) Given the following table of thermodynamic data at 298 K: Substana | AH¢{kj/mol | Sº C/K-mol) NH3 (5) 16:19 192.5 HCl (8) 92150 186,69 NHCl (s) 13144 94.6 The value of K for the reaction at 25°C is
help with this please
Ca(OH)2(aq) + 2 HCl(aq) +CaCl2(8) + 2 H2O(1) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K ANSWER: N2(g) + O2(g) +2NO(g) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K ANSWER: 2CO(g) + O2(g) +2002(9) - der e en manos de 20, ali ne more than one so mi dicogna undan Using standard thermodynamic data...
Consider the reaction 2 CO2(g) +5 H2(e) C H2(e) + 4H2O(g) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K ANSWER: Submit Answer Retry Entire Group more group attempts remaining AH,(kJ/mol) AG® (kJ/mol) Sº (J/mol K) -238.7 -116.0 126.8 219.0 -363.0 249.0 135.1 -166.3 -110.0 -351.0 125.0 209.2 68.2 - 129.0 202.0 226.7 200.9 52.3 - 166.0 -53.0 -277.7 219.6 250.0 242.0 160.7 -13.0 -235.1 282.7 Carbon CH3OH (1) H2CO...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago