Describe and diagram the structure of peptidoglycan showing the building block molecules. Describe unique components used...
Homework Answers
The basic cell wall contains a peptidoglycan layer and a polymer consisting of NAG (N-acetyl glucosamine) and NAM (N-acetyl muramic acid) along with amino acid chains. The NAM and NAG units are arranged alternatively to form a carbohydrate backbone, this is known as glycan part, and the rows of these units are linked together by polypeptide bonds, this is known as peptide portion.
Add Answer to:
Describe and diagram the structure of peptidoglycan showing the
building block molecules. Describe unique components used...
Lipids Describe the building-block molecules, structure, and biological importance of fats, phospholipids, and steroids. Why are...
Lipids Describe the building-block molecules, structure, and biological importance of fats, phospholipids, and steroids. Why are lipids classed together? Do lipids have monomers? Distinguish between saturated and unsaturated fats. Distinguish between cis and trans fat molecules. What are some of the health risks associated with trans fats? Describe how phospholipids orient to form membranes. Which part of a phospholipid is hydrophobic? Which part is hydrophilic? What are the three classes of lipids? List two important biological functions of a steroid....
9. a) Draw a block diagram for a High Performance Liquid Chromatograph (HPLC), showing all the...
9. a) Draw a block diagram for a High Performance Liquid Chromatograph (HPLC), showing all the important components. Briefly describe the function of each part. b) List four types of stationary phase/separation methods that are available for HPLC and suggest suitable analytes or analyses for each type of stationary phase. c) List four detection options that exist for HPLC and discuss the good and bad points (if any) of each. d) Choose one aspects of chromatography (eg. resolution or sample...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO- would have a stronger bond. 2po* 2p* 2prº P. 20.P. 2p. 2p 2pr 2pm 2pc 25 25 Which one is stronger? Why? 4. Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and...
TCTIOUN Fan Block A student in a physics lab has a block with a fan attached...
TCTIOUN Fan Block A student in a physics lab has a block with a fan attached to it, as shown in the figure above. The fan has a pivot so that the angle e it makes with the horizontal can be adjusted between 0° and 90°. When the fan is pointed horizontally so that 0 0°, the block accelerates from rest along a track, even though there is friction between the block and the track. For the following questions, assume...
a) Draw a diagram of an x-ray image intensifier used for medical fluoroscopic imaging. Label the 6. main components...
a) Draw a diagram of an x-ray image intensifier used for medical fluoroscopic imaging. Label the 6. main components and explain their functions (10] b) Explain what is meant by the brightness gain of an image intensifier. Name and describe the two processes that contribute to this gain. Give expressions or numerical estimates where appropriate 15) c) Suppose that an x-ray beam is incident on an image intensifier having a diameter of 30 cm. For this x-ray beam, the incident...
12. The saccharide binding pockets in lysozyme were labeled A through F. Enzymes such as lysozyme...
12. The saccharide binding pockets in lysozyme were labeled A through F. Enzymes such as lysozyme are very specific; lysozyme will hydrolyze the polysaccharide at only one linkage: the linkage bound between A and B, or bound between B and C, etc. (see figure below). From the crystal structure, it was found a) NAG-NAG-NAG binds at sites A-C in the crystal structure, and b) that sites A, C and E could not accommodate NAM; NAM's extra lactyl group is too...
please Answer in Details showing all the steps. Thank you Look at the following reaction: Toluene...
please Answer in Details showing all the steps.
Thank you
Look at the following reaction: Toluene OH + CH3OH OCH3 + H2O a) What is the effect of each of the given changes (see next page) on the rate of the reaction? The possible answers are: Increases, decreases, remains the same or no more reaction. 1- Decreasing the concentration of CH,OH 2-Using a Dean-Stark apparatus (used to remove water from the reaction mixture) 3- Adding H,SO, to the reaction mixture...
ENED NERGY VS REACTION COORDINATE DIAGRAM MODEL T ction coordinate graph is used to show how...
ENED NERGY VS REACTION COORDINATE DIAGRAM MODEL T ction coordinate graph is used to show how the potential energy of the reactants become products. A reaction coordinate is a measure of the progress of the reac- An energy vs. reaction changes as they becom along the reaction pathway. Figure 1 Transition State Energy activation energy Reactants AG energy change at constant pressure Products Reaction Coordinate KEY QUESTIONS 1. Is the change in energy from reactants to products in Model 1...
2. Using the directions from your notes or book, draw a Lewis Structure for the following...
2. Using the directions from your notes or book, draw a Lewis Structure for the following compounds on separate sheets of paper. Show calculations of valence electrons. O2, SO2, HONO (N in the middle), SiH. CI.CO (C in center). C H, NH.. NO, PO Describe 2 exceptions to the octet rule. What are resonance structures? 3. What does VSEPR stand for? How can it be used to predict the geometry of a molecule? Give the electron and molecular geometry for...
Chemical Bonding Name Directions: If needed, answer the following on a separate sheet of paper: 1....
Chemical Bonding Name Directions: If needed, answer the following on a separate sheet of paper: 1. Normally, what is the maximum number of valence electrons possible around an atom? the Lewis dot structure/diagram for the following neutral atoms: C.N.O.S.P. CI 2. Using the directions from your notes or book, draw a Lewis Structure for the following compounds on separate sheets of paper. Show calculations of valence electrons. O, SO, HONO (N in the middle). SiH.CI CO (C in center).CH..NH. NO,...
3. (cont).(c) (10 pts) Now consider the MO diagram below, which could be used to describe the bonding. Explain whether NO+ or NO- would have a stronger bond. 2po* 2p* 2prº P. 20.P. 2p. 2p 2pr 2pm 2pc 25 25 Which one is stronger? Why? 4. Stronger bond = (d) (10 pts) What bond order would you predict for neutral NO? BO = Consider the following terms used to describe molecular structure: linear, bent, trigonal planar, trigonal pyramidal, tetrahedral, and...
TCTIOUN Fan Block A student in a physics lab has a block with a fan attached to it, as shown in the figure above. The fan has a pivot so that the angle e it makes with the horizontal can be adjusted between 0° and 90°. When the fan is pointed horizontally so that 0 0°, the block accelerates from rest along a track, even though there is friction between the block and the track. For the following questions, assume...
a) Draw a diagram of an x-ray image intensifier used for medical fluoroscopic imaging. Label the 6. main components and explain their functions (10] b) Explain what is meant by the brightness gain of an image intensifier. Name and describe the two processes that contribute to this gain. Give expressions or numerical estimates where appropriate 15) c) Suppose that an x-ray beam is incident on an image intensifier having a diameter of 30 cm. For this x-ray beam, the incident...
12. The saccharide binding pockets in lysozyme were labeled A through F. Enzymes such as lysozyme are very specific; lysozyme will hydrolyze the polysaccharide at only one linkage: the linkage bound between A and B, or bound between B and C, etc. (see figure below). From the crystal structure, it was found a) NAG-NAG-NAG binds at sites A-C in the crystal structure, and b) that sites A, C and E could not accommodate NAM; NAM's extra lactyl group is too...
please Answer in Details showing all the steps.
Thank you
Look at the following reaction: Toluene OH + CH3OH OCH3 + H2O a) What is the effect of each of the given changes (see next page) on the rate of the reaction? The possible answers are: Increases, decreases, remains the same or no more reaction. 1- Decreasing the concentration of CH,OH 2-Using a Dean-Stark apparatus (used to remove water from the reaction mixture) 3- Adding H,SO, to the reaction mixture...
ENED NERGY VS REACTION COORDINATE DIAGRAM MODEL T ction coordinate graph is used to show how the potential energy of the reactants become products. A reaction coordinate is a measure of the progress of the reac- An energy vs. reaction changes as they becom along the reaction pathway. Figure 1 Transition State Energy activation energy Reactants AG energy change at constant pressure Products Reaction Coordinate KEY QUESTIONS 1. Is the change in energy from reactants to products in Model 1...
2. Using the directions from your notes or book, draw a Lewis Structure for the following compounds on separate sheets of paper. Show calculations of valence electrons. O2, SO2, HONO (N in the middle), SiH. CI.CO (C in center). C H, NH.. NO, PO Describe 2 exceptions to the octet rule. What are resonance structures? 3. What does VSEPR stand for? How can it be used to predict the geometry of a molecule? Give the electron and molecular geometry for...
Chemical Bonding Name Directions: If needed, answer the following on a separate sheet of paper: 1. Normally, what is the maximum number of valence electrons possible around an atom? the Lewis dot structure/diagram for the following neutral atoms: C.N.O.S.P. CI 2. Using the directions from your notes or book, draw a Lewis Structure for the following compounds on separate sheets of paper. Show calculations of valence electrons. O, SO, HONO (N in the middle). SiH.CI CO (C in center).CH..NH. NO,...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago