Why would photosynthetic rates of beech grown under shelterwood be higher than those of oak grown...
Why would photosynthetic rates of beech grown under shelterwood be higher than those of oak grown under patch harvest?
Homework Answers
Shelterwood harvest canopy cover is much higher than the oak
tree's canpoy.
Shelterwood trees have leaf area with high ratio of approximately
78% higher than the
the oak trees. This leads to a higher photosynthetic rates of beech
grown under shelterwood
than oak under patch harvest.
Add Answer to:
Why would photosynthetic rates of beech grown under
shelterwood be higher than those of oak grown...
Discuss reasons why crude mortality rates for cancer and heart disease would be higher in Florida...
Discuss reasons why crude mortality rates for cancer and heart disease would be higher in Florida than in other states. What types of rates would provide more accurate information and why?
why do investors believe interest rates in the future will be higher than current interest rates?...
why do investors believe interest rates in the future will be higher than current interest rates? in context to Pure expectations theory
Why a medical office bill at rates much higher than what a test costs?
Why a medical office bill at rates much higher than what a test costs?
5. Why do unemplpyment rates in European countries tend to be higher than in the U.S.?...
5. Why do unemplpyment rates in European countries tend to be higher than in the U.S.? 6. Does (a) automation/new technologies or (b) immigration increase the unemployment rate? Why or why not?
Why willl nominal GDP growth rates typically be higher than real GDP growth rates? a. because...
Why willl nominal GDP growth rates typically be higher than real GDP growth rates? a. because prices generally decreases b. because GDP generally decreases c. Because prices generally increase d. because GDP generally increases
India tends to have much higher inflation than Australia and also much higher interest rates than...
India tends to have much higher inflation than Australia and also much higher interest rates than Australia. Inflation and interest rates are much more volatile in India than in industrialised countries. The value of the Indian rupee is typically more volatile than the currencies of industrialised countries from an Australian perspective; it has typically depreciated from one year to the next, but the degree of depreciation has varied substantially. The bid/ask spread tends to be wider for the rupee than...
Explain why the samples with larger amounts of solute precipitated at significantly higher temperatures than those...
Explain why the samples with larger amounts of solute precipitated at significantly higher temperatures than those with less solute. Discuss your answer in terms of the physical interaction between the solute and solvent.
Based on an indication that mean daily car rental rates may be higher for Toronto than...
Based on an indication that mean daily car rental rates may be higher for Toronto than for Montreal, a survey of eight car rental companies in Toronto is taken, and the sample mean car rental rate is $50, with a standard deviation of $4. Further, suppose a survey of nine car rental companies in Montreal results in a sample mean of $42 and a standard deviation of $4. Use a = 0.05 to test to determine whether the average daily...
. If current market interest rates are higher than bond’s coupon rate, will the bond’s price...
. If current market interest rates are higher than bond’s coupon rate, will the bond’s price be higher or lower than the bond’s principal? Please explain why.
Explain why sound seems higher pitched when heard under water than in air? Show transcribed image...
Explain why sound seems higher pitched when heard under water than in air?
5. Why do unemplpyment rates in European countries tend to be higher than in the U.S.? 6. Does (a) automation/new technologies or (b) immigration increase the unemployment rate? Why or why not?
Based on an indication that mean daily car rental rates may be higher for Toronto than for Montreal, a survey of eight car rental companies in Toronto is taken, and the sample mean car rental rate is $50, with a standard deviation of $4. Further, suppose a survey of nine car rental companies in Montreal results in a sample mean of $42 and a standard deviation of $4. Use a = 0.05 to test to determine whether the average daily...
Explain why sound seems higher pitched when heard under water than in air?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 25 seconds ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 31 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago