2. please explain the process of each question
3. please show the oxidation of isobutanol
Homework Answers
Add Answer to:
2. please explain the process of each question
3. please show the oxidation of isobutanol
2....
(1) Show the product of each alcohol oxidation reaction below: OH Croz H30", acetone PCC CH2Cl2...
(1) Show the product of each alcohol oxidation reaction below: OH Croz H30", acetone PCC CH2Cl2 OH Cr₂O, OH H.SO 4, H2O PCC HO CH2Cl2 Nag H2S04, H20 (2) Propose an efficient synthesis for each transformation below mocow OH НО? .name مل.بلو HO / تم.-م" (E) Ph amion e no (F) OMe
Draw a structural formula for the major product of the reaction shown. CH3CH2 S=CHCH2 The CH3CH2...
Draw a structural formula for the major product of the reaction shown. CH3CH2 S=CHCH2 The CH3CH2 Draw a structural formula for the major product of the reaction shown. CH3 CH3CHCH=CH2 Draw a structural formula for the major product of the reaction shown. Cl2 CH3CH2CH2CH=CH2 - H2O Draw structural formulas for all alkenes that could be used to prepare the alcohol shown below by oxymercuration. H3COH , 1. Hg(OAc)2, H2O 2. NaBH4 Draw the structure of the major organic product of...
Supply products or reagents. If more than one organic product forms, you must write both products....
Supply products or reagents. If more than
one organic product forms, you must write both products. If stereo-
or regiochemistry is important, you must show that. Incorrect
regio- or stereochemistry will not receive credit. If no reaction
is possible, write N.R.
Please Help with letters E,F,G, and H
Thank you
peroxidesh heat or ho t Jn 9. CH3CH2CH2CH2CHO CrO3» C. w Hoso a. a CECH 3,3-dimethylbut-1-yne cat. HgSO4 H2SO4, H20 cat. Os04 NMO 1.BH3-SMez M 2. H2O2, NaOH (CH3)3 SICI...
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3...
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
for f - j draw structures pls help with #1 as well f) 4-methyl-2-pentene 9) trans-8-ethyl-3-undecen...
for f - j draw structures pls help with #1 as well
f) 4-methyl-2-pentene 9) trans-8-ethyl-3-undecen h) E-5-bromo-4-chloro-7,7-dimethyl-4-undecene i) Z-1,2-difluoro-cyclohexene i) 4-ethenylcyclohexano Predict the major organic product or products of each of the following reactions. a) (CH3),CHCH-CH: H2SO4 HO b) (CH3),CHCH-CH, 1. Hg(OAc), H20 2. NaBH4 1. BH-THF c) (CH3),CHCH-CH2 2. H,O, NaOH
see Vitc lab 2. The chromium oxidation of compound I below yields a mixture of products...
see Vitc lab 2. The chromium oxidation of compound I below yields a mixture of products (II- V). Identify the order of elution that would occur if you used an alumina stationary phase with diethyl ether to separate the mixture of products (II, III, IV, V) by column chromatography. (Assume there is no starting material in the products.) (a) Write balanced redox reactions for the reaction of K Cr O, with I to give each of the products. Starting material...
Please answer all 3 and explain if you can! Thank you!! *This one isn't option 2...
Please answer all 3 and explain if you can! Thank you!!
*This one isn't option 2 or 4*
Draw the major organic products of the following reaction. Include lone pairs of electrons and stereochemistry 1.CH,MgBr, Et,o 2. H,O What is the major product in the following series of reactions? 1) 03 then DMS 2) LiAIH4 (excess) then H20 3) NaH (1 equiv.) 4) TsCl (1 equiv.) 5) NaOH (dilute) Products OTS a) b) HO HO OTS он OH c) d)...
3. Complete each of the following reactions. Draw the structure of the organic product or products...
3. Complete each of the following reactions. Draw the structure of the organic product or products in the space provided. Show stereochemistry if appropriate. (3 points each) SN2 reaction (a) (CH3)CHCH2Cl + NaCN Sn1 reaction (b) (CH3)CHCH,CI + NaCN (C) M Sn2 reaction ¢l + NaOH - ACH. E1 reaction (d) (CH3)3CCH,OH + HCI major product Ez reaction Cl + NaOH - LCH3 н Ereaction Cl + H20
Insert page Down Backspace End 5. Draw structural formulas for the major organic products of each...
Insert page Down Backspace End 5. Draw structural formulas for the major organic products of each reaction: H.CO Meso,cl, pyridine OH - PCC SOCI,, pyridine HCI HO+ Pinacol rearr. H2O+ Name THEMU POPQUIZ 7A Chapter 13 CHEM 12A EVC -TULTIPL 1. How m 5. Draw structural formulas for the major organic products of each reaction: V 0 TO 2. Which environme H.CO. MeSo,Cl, pyridine PCC 3. What is ce SOCI. pyridine Whicho HCI HO+ Pinacol rearr. H307 OH HIO,
Question 1 (1 point) Classify the following reaction as an oxidation reaction, a reduction reaction, or...
Question 1 (1 point) Classify the following reaction as an oxidation reaction, a reduction reaction, or neither. O oxidation reaction reduction reaction neither an oxidation reaction nor a reduction reaction Question 2 (1 point) ✓ Saved Classify the following reaction as an oxidation reaction, a reduction reaction, or neither. neither an oxidation reaction nor a reduction reaction O oxidation reaction reduction reaction Question 3 (1 point) Identify the major product of the following reaction NaBH4, CH3OH OMe O There is...
(1) Show the product of each alcohol oxidation reaction below: OH Croz H30", acetone PCC CH2Cl2 OH Cr₂O, OH H.SO 4, H2O PCC HO CH2Cl2 Nag H2S04, H20 (2) Propose an efficient synthesis for each transformation below mocow OH НО? .name مل.بلو HO / تم.-م" (E) Ph amion e no (F) OMe
Draw a structural formula for the major product of the reaction shown. CH3CH2 S=CHCH2 The CH3CH2 Draw a structural formula for the major product of the reaction shown. CH3 CH3CHCH=CH2 Draw a structural formula for the major product of the reaction shown. Cl2 CH3CH2CH2CH=CH2 - H2O Draw structural formulas for all alkenes that could be used to prepare the alcohol shown below by oxymercuration. H3COH , 1. Hg(OAc)2, H2O 2. NaBH4 Draw the structure of the major organic product of...
Supply products or reagents. If more than
one organic product forms, you must write both products. If stereo-
or regiochemistry is important, you must show that. Incorrect
regio- or stereochemistry will not receive credit. If no reaction
is possible, write N.R.
Please Help with letters E,F,G, and H
Thank you
peroxidesh heat or ho t Jn 9. CH3CH2CH2CH2CHO CrO3» C. w Hoso a. a CECH 3,3-dimethylbut-1-yne cat. HgSO4 H2SO4, H20 cat. Os04 NMO 1.BH3-SMez M 2. H2O2, NaOH (CH3)3 SICI...
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
for f - j draw structures pls help with #1 as well
f) 4-methyl-2-pentene 9) trans-8-ethyl-3-undecen h) E-5-bromo-4-chloro-7,7-dimethyl-4-undecene i) Z-1,2-difluoro-cyclohexene i) 4-ethenylcyclohexano Predict the major organic product or products of each of the following reactions. a) (CH3),CHCH-CH: H2SO4 HO b) (CH3),CHCH-CH, 1. Hg(OAc), H20 2. NaBH4 1. BH-THF c) (CH3),CHCH-CH2 2. H,O, NaOH
see Vitc lab 2. The chromium oxidation of compound I below yields a mixture of products (II- V). Identify the order of elution that would occur if you used an alumina stationary phase with diethyl ether to separate the mixture of products (II, III, IV, V) by column chromatography. (Assume there is no starting material in the products.) (a) Write balanced redox reactions for the reaction of K Cr O, with I to give each of the products. Starting material...
Please answer all 3 and explain if you can! Thank you!!
*This one isn't option 2 or 4*
Draw the major organic products of the following reaction. Include lone pairs of electrons and stereochemistry 1.CH,MgBr, Et,o 2. H,O What is the major product in the following series of reactions? 1) 03 then DMS 2) LiAIH4 (excess) then H20 3) NaH (1 equiv.) 4) TsCl (1 equiv.) 5) NaOH (dilute) Products OTS a) b) HO HO OTS он OH c) d)...
3. Complete each of the following reactions. Draw the structure of the organic product or products in the space provided. Show stereochemistry if appropriate. (3 points each) SN2 reaction (a) (CH3)CHCH2Cl + NaCN Sn1 reaction (b) (CH3)CHCH,CI + NaCN (C) M Sn2 reaction ¢l + NaOH - ACH. E1 reaction (d) (CH3)3CCH,OH + HCI major product Ez reaction Cl + NaOH - LCH3 н Ereaction Cl + H20
Insert page Down Backspace End 5. Draw structural formulas for the major organic products of each reaction: H.CO Meso,cl, pyridine OH - PCC SOCI,, pyridine HCI HO+ Pinacol rearr. H2O+ Name THEMU POPQUIZ 7A Chapter 13 CHEM 12A EVC -TULTIPL 1. How m 5. Draw structural formulas for the major organic products of each reaction: V 0 TO 2. Which environme H.CO. MeSo,Cl, pyridine PCC 3. What is ce SOCI. pyridine Whicho HCI HO+ Pinacol rearr. H307 OH HIO,
Question 1 (1 point) Classify the following reaction as an oxidation reaction, a reduction reaction, or neither. O oxidation reaction reduction reaction neither an oxidation reaction nor a reduction reaction Question 2 (1 point) ✓ Saved Classify the following reaction as an oxidation reaction, a reduction reaction, or neither. neither an oxidation reaction nor a reduction reaction O oxidation reaction reduction reaction Question 3 (1 point) Identify the major product of the following reaction NaBH4, CH3OH OMe O There is...
Most questions answered within 3 hours.
-
Suppose X is a random variable whose density is f(x) = cx(1 - x)
for 0...
asked 1 minute ago -
Below is an ANOVA
summary table. Based on these data, would you follow this ANOVA up...
asked 2 minutes ago -
A golf ball rolls off a horizontal cliff with an initial speed
of 11.7 m/s. The...
asked 6 minutes ago -
1. An experiment was run where varying amounts of HClO and KClO
solutions were mixed and...
asked 17 minutes ago -
This is symbolized by a circle over a single line in an entity
relationship diagram. It...
asked 20 minutes ago -
National well-being can be measured using the Per-capita GDP
(per-capita) and the Human Development Index (HDI)....
asked 22 minutes ago -
A failure of an engine control unit causes it to fail an average
of 0.1 times...
asked 34 minutes ago -
A siren on an emergency car moving with velocity 90 km/hour
produces the sound with frequency...
asked 35 minutes ago -
Consider the schema below that models a bank’s branches,
customers and their accounts and loans. Provide...
asked 42 minutes ago -
What kinds of policies should be considered when individuals
decisions may likely impact public expense? For...
asked 51 minutes ago -
The financial statements of Apple Inc. show the following
numbers for fiscal year 2017 ($000,000):
Revenue...
asked 56 minutes ago -
Suppose that you are given the following results. Find the
correlation coefficient of the data.
sx...
asked 1 hour ago