The equation 2 CH3OH + __O2 ? 2 CO2 + 4 H2O is balanced by making...

Question

Question

The equation 2 CH₃OH + __O₂ ? 2 CO₂ + 4 H₂O is balanced by making the coefficient of oxygen (O₂) a ______?

Answer 1

Answer #1

PLEASE REACT THUMBS UP...TRULY NEED SUPPORT...

Answer 2

Similar Homework Help Questions

The combustion of propane (C3H8) produces CO2 and H2O according to the following balanced equation: C3H8...

The combustion of propane (C3H8) produces CO2 and H2O according to the following balanced equation: C3H8 (g) + 5 O2 (g) → 3 CO2 (g) + 4 H2O (g) If the hydrocarbon is present in excess, what mass of oxygen (O2) in grams is necessary to form 12.9 g of CO2? Round your answer to the nearest 0.1.
Octane (C8H18) reacts with oxygen (O2) to form carbon dioxide (CO2) and water (H2O).

Octane (C8H18) reacts with oxygen (O2) to form carbon dioxide (CO2) and water (H2O). When the equation in balanced, the coefficient of octane is: C8H18+ O2 --> CO2 + H2O a.8 b. 16 c.25 d. 2
Octane (C3H18) reacts with oxygen (O2) to form carbon dioxide (CO2) and water (H2O). When the...

Octane (C3H18) reacts with oxygen (O2) to form carbon dioxide (CO2) and water (H2O). When the equation below is balanced, the coefficient of octane is: C8H18 + O2-CO2 + H20

In this balanced chemical equation, 2 C18H30O2 + 49O2 à 36 CO2 + 30 H2O, answer...

In this balanced chemical equation, 2 C18H30O2 + 49O2 à 36 CO2 + 30 H2O, answer the following questions below: a. How many atoms of O are found on both sides of the equation? -- b. How many atoms of H are found on both sides of the equation? -- c. What is the mole ratio between O2 and CO2? -- d. What is the mole ratio between C18H30O2 and H2O? -- e. What type of reaction is this?
Using the balanced equation, calculate how many grams of CO2 are produced from the combustion of...

Using the balanced equation, calculate how many grams of CO2 are produced from the combustion of 30.06 g of C2H6 with 128.00 g of oxygen gas. 2 C2H6 (g) + 7 O2 (g) -> 4 CO2 (g) + 6 H2O (g) a) 176.04 g b) 88.02 g c) 44.01 g d) 100.6 g
The balanced chemical equation below shows the combustion of methanol: CH3OH(l) + 3O2(g) → 2 H2O(g)...

The balanced chemical equation below shows the combustion of methanol: CH3OH(l) + 3O2(g) → 2 H2O(g) + CO2(g) a) Predict the sign of ΔS for this reaction and briefly explain your reasoning b) Predict the sign of ΔH for this reaction and briefly explain your reasoning c) Is the sign of ΔG temperature dependent in this reaction? Briefly explain your reasoning

Given the equation: C2H6 (g) + O2 (g) → CO2 (g) + H2O (g) (not balanced)...

Given the equation: C2H6 (g) + O2 (g) → CO2 (g) + H2O (g) (not balanced) Determine the number of liters of O2 consumed at STP when 60.0 grams of C2H6 is burned.
Write a Balanced equation for the chemcial reaction Acetylene gas (C2H2) burns in a welding torch with oxygen to form carbon dioxide gas and water vapor

Write a balanced equation for the chemical reaction Acetylene gas (C2H2) burns in a welding torch with oxygen to form carbon dioxide gas and water vapor.C2H2(g) + O2(g) ==> CO2(g) + H2O(g) It isn't balanced. I will leave that for you.How do I balance it?trial and error. C2H2 + O2 ==> CO2 + H2O. I see 2 C on the left and only 1 on the right so I place a coefficient of 2 for CO2 on the right. And...
Are the following two balanced? -2 NaHCO3 ? Na2 CO3 + H2O + 2 CO2 -CH4...

Are the following two balanced? -2 NaHCO3 ? Na2 CO3 + H2O + 2 CO2 -CH4 + 2 O2 = CO2 + 2 H2O

Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) +...

Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) a. [CH3OH]2[O2]3/[CO2]2[H2O]4 b. [CH3OH]2[O2]3/[CO2]2 c. [CO2]2/[CH3OH]2[O2]3 d. [CO2]2[H2O]4/[CH3OH]2[O2]3 e. (2[CH3OH])(3[O2])/(2[CO2])(4[H2O])