Homework Answers
The given reaction is a type of double displacement reaction.
So correct option is D.
Add Answer to:
The following reaction is an example of a КСІ + NaNO3 + KNO3 Naci (a) combination...
Your Name Extra credit of example is 1. The following reaction: Mg+FeO- Mgo+Fe. a) combination. b)...
Your Name Extra credit of example is 1. The following reaction: Mg+FeO- Mgo+Fe. a) combination. b) decomposition. c) single-displacement. d) double-displacement. an example of 2. The following reaction: NaOH + HC1+ NaC1+ HO. a) combination. b) decomposition. c) single-displacement. d) double-displacement. 3. The following reaction: NaCOs + CaCh 2Nacl+ a) combination. b) decomposition. c) single-displacement. d) double-displacement. 4. The following reaction: F2 + 2KBr-> 2KF + Bra, is an example o a) combination. b) decomposition. c) single-displacement. d) double-displacement. 5....
The following reaction 2H2 + O2 -> 2H2 O is an example of a. combination b....
The following reaction 2H2 + O2 -> 2H2 O is an example of a. combination b. decomposion c. single-displacement d. double displacement The reaction 2C + 3H 2 -> C2 H6 + 84.0 kJ is a. endothermic b. exothermic c. isothermic d. protothermic
The following chemical reaction is an example of which type? 4Fe + 302 --> 2Fe203 double...
The following chemical reaction is an example of which type? 4Fe + 302 --> 2Fe203 double displacement single displacement combination decomposition
The following reaction is an example of a ________ reaction. 2C2H6(g) + 7O2(g) → 4CO2(g) +...
The following reaction is an example of a ________ reaction. 2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(g) A) displacement B) single replacement C) combustion D) decomposition E) double replacement
15) 15) What type of reaction is the generic equation AB+CD-AD+CB? A) synthesis/combination B) decomposition C) sin...
15) 15) What type of reaction is the generic equation AB+CD-AD+CB? A) synthesis/combination B) decomposition C) single displacement D) double-displacement E) none of the above 16) 16) Identify the double displacement reactions among the following: 1. KCl(aq) + AgNO3(aq) - AgCl(s) + KNO3(aq) 2. Na2SO4(aq) + BaCl2(aq) →BaSO4(s) + 2NaCl(aq) 3. H2SO4((aq) + 2NaOH(aq) Na2SO4((aq) + 2H2O(1) A) 1 and 3 only B) 2 and 3 only C) 1 and 2 only D) All of 1, 2, and 3 E)...
The reaction BaCl2 + (NH4)2CO3 --> BaCO3 + 2 NH4Cl is an example of Group...
The reaction BaCl2 + (NH4)2CO3 --> BaCO3 + 2 NH4Cl is an example of Group of answer choices double displacement decomposition combination single displacement
Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction:...
Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction: Part A 4Fe(s)+3O2(g)→2Fe2O3(s) combination, decomposition, single replacement, double replacement, or combustion Part B 2Al(s)+3CuCl2(aq)→2AlCl3(aq)+3Cu(s) combination decomposition single replacement double replacement combustion Part C ZnCO3(s)⟶ΔCO2(g)+ZnO(s) combination decomposition single replacement double replacement combustion Part D CuCl2(aq)+2KOH(aq)→Cu(OH)2(s)+2KCl(aq) combination decomposition single replacement double replacement combustion Part E C3H8(g)+5O2(g)⟶Δ3CO2(g)+4H2O(g) combination decomposition single replacement double replacement combustion
2. Classify each of the following reactions as precipitation, gas forming, redox, acid/base, combination, decomposition, double...
2. Classify each of the following reactions as precipitation, gas forming, redox, acid/base, combination, decomposition, double displacement or single displacement. Each reaction will have at least two classifications. a. Zn(s) + CuSO4(aq) → ZnSO4(aq) + Cu(s) b. H2SO3(aq) → SO2(g) + H2O(1) C. N2(g) + H2(g) → NH3(g) d. AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) ii. e. HCl(aq) + Ba(OH)2(aq) + H2O(l) + BaCl2(aq)
What is the correct classification of the following reaction. HCI + NaNO2-NaCl + HNO2 Decomposition Combination...
What is the correct classification of the following reaction. HCI + NaNO2-NaCl + HNO2 Decomposition Combination Displacement (Single replacement) Exchange (double replacement)
DATE: b) Decomposition reaction is the opposite of combination reaction (True/ False) Formation of a precipitate,...
DATE: b) Decomposition reaction is the opposite of combination reaction (True/ False) Formation of a precipitate, formation of a gas and formation of a weak electrolyte are all part of a Double displacement reaction. (True/ False) d) Fe (s) + 2HCl(aq) - FeCl + H2(g), is a Decomposition reaction. (True False) 32. Complete and balance the followings chemical reactions: a) Mg(s) + 02 - b) Cacos - c) CuSO. + Zn - d) AgNO, + NaCl- 33. Classify each of...
Your Name Extra credit of example is 1. The following reaction: Mg+FeO- Mgo+Fe. a) combination. b) decomposition. c) single-displacement. d) double-displacement. an example of 2. The following reaction: NaOH + HC1+ NaC1+ HO. a) combination. b) decomposition. c) single-displacement. d) double-displacement. 3. The following reaction: NaCOs + CaCh 2Nacl+ a) combination. b) decomposition. c) single-displacement. d) double-displacement. 4. The following reaction: F2 + 2KBr-> 2KF + Bra, is an example o a) combination. b) decomposition. c) single-displacement. d) double-displacement. 5....
The following chemical reaction is an example of which type? 4Fe + 302 --> 2Fe203 double displacement single displacement combination decomposition
15) 15) What type of reaction is the generic equation AB+CD-AD+CB? A) synthesis/combination B) decomposition C) single displacement D) double-displacement E) none of the above 16) 16) Identify the double displacement reactions among the following: 1. KCl(aq) + AgNO3(aq) - AgCl(s) + KNO3(aq) 2. Na2SO4(aq) + BaCl2(aq) →BaSO4(s) + 2NaCl(aq) 3. H2SO4((aq) + 2NaOH(aq) Na2SO4((aq) + 2H2O(1) A) 1 and 3 only B) 2 and 3 only C) 1 and 2 only D) All of 1, 2, and 3 E)...
2. Classify each of the following reactions as precipitation, gas forming, redox, acid/base, combination, decomposition, double displacement or single displacement. Each reaction will have at least two classifications. a. Zn(s) + CuSO4(aq) → ZnSO4(aq) + Cu(s) b. H2SO3(aq) → SO2(g) + H2O(1) C. N2(g) + H2(g) → NH3(g) d. AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) ii. e. HCl(aq) + Ba(OH)2(aq) + H2O(l) + BaCl2(aq)
What is the correct classification of the following reaction. HCI + NaNO2-NaCl + HNO2 Decomposition Combination Displacement (Single replacement) Exchange (double replacement)
DATE: b) Decomposition reaction is the opposite of combination reaction (True/ False) Formation of a precipitate, formation of a gas and formation of a weak electrolyte are all part of a Double displacement reaction. (True/ False) d) Fe (s) + 2HCl(aq) - FeCl + H2(g), is a Decomposition reaction. (True False) 32. Complete and balance the followings chemical reactions: a) Mg(s) + 02 - b) Cacos - c) CuSO. + Zn - d) AgNO, + NaCl- 33. Classify each of...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 24 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 55 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago