At an elevated temperature of 700 K, 0.682 mols of molecular hydrogen and 0.440 mols of...
At an elevated temperature of 700 K, 0.682 mols of molecular hydrogen and 0.440 mols of molecular bromine are allowed to react in a 1.0 L vessel. Once equilibrium is established, there are 0.566 mols of H2 formed. What are the molar concentrations of Br2 and HBr at equilibrium?
H2 (g) + Br2 (g) 
2HBr (g)
Homework Answers
Add Answer to:
At an elevated temperature of 700 K, 0.682 mols of molecular
hydrogen and 0.440 mols of...
Help please with work Show your work when there are calculations, write units where appropriate, and...
Help please with work
Show your work when there are calculations, write units where appropriate, and use the correct significant figures. Do the work on a separate sheet of paper and once you have done it correctly, transcribe youir work clearly onto this sheet. 1. The value of Ke for the equilibrium: is 794 at 25°C a) At this temperature, what is the value of Ke for the following equilibrium? H2(g) + 12(g)% 2H1(g) HI(g)与½ H2(g) + ½ 12(g) b)...
A mixture of 1.374 g of H2 and 70.31 g of Br2 is heated in a...
A mixture of 1.374 g of H2 and 70.31 g of Br2 is heated in a 2.00 L vessel at 700 K . These substances react as follows: H2(g)+Br2(g)⇌2HBr(g) At equilibrium the vessel is found to contain 0.566 g of H2. 1A) Calculate the equilibrium concentration of H2. 1B) Calculate the equilibrium concentration of Br2. 1C) Calculate the equilibrium concentration of HBr. 1D) Calculate Kc.
If a 2L reaction vessel initially contains 2 mols of Hydrogen and 2 mols of Iodine,...
If a 2L reaction vessel initially contains 2 mols of Hydrogen and 2 mols of Iodine, what will be the molar concentrations at equilibrium of all species? H2 (g) + I2 (g) --> 2HI (g) Kc = 50.5
Just give me the answers MULTIPLE CHOICE. Choose the na t ive that best completes the...
Just give me the answers
MULTIPLE CHOICE. Choose the na t ive that best completes the statement or answer the questi 1) Write the equilibri e the equilibrium constanter ia for the following reaction in the forward direction 2CH )302)2006) 4H2O) 2100) + 4H20 A) KICHg2.0P B) Ke- CH-302 CO2+ [H2014 2 CH431021 COP 2014 Dj Ke-2100 H30 KICHAPOP 2) Ar elevated temperatures, molecular hydrogen and molecular bromine react to partially form hydrogen bromide H2(g) + Brz (g) 211Br (g)...
Just give me the answers MULTIPLE CHOICE. Choose the n a tive that best completes the statement or answer the quest...
Just give me the answers
MULTIPLE CHOICE. Choose the n a tive that best completes the statement or answer the questi 1) Write the equilibri ne the equilibrium constanter ia for the following reaction in the forward direction 2CH )302)-2006) 4H2O) 2100) + 4H20 A) KICH. Op Bộ Ka-2H4 O2 [CO2+ [H2014 CO2 [H2014 2 CH4 - 31021 OK- Dj Ke-2100 H30 ICH 102P 2) Ar elevated temperatures molecular hydrogen and molecular bromine react to partially form hydrogen bromide H2(g)...
Question #: 28 Hydrogen and bromine react to form hydrobromic acid according to the reaction H2(g)...
Question #: 28 Hydrogen and bromine react to form hydrobromic acid according to the reaction H2(g) + Br2(g) + 2 HBr(g) Kc = 2.18 x 106 at 730. °C. What is the equilibrium concentration of HBr if the initial concentrations of hydrogen and bromine are both 0.500 M? A. 1.21 M B. 0.262 M C. 0.408 M D. 0.999 M
The equilibrium constant K. for the reaction H2(g) + Brz(g) = 2HBr(g) is 2.18 x 106...
The equilibrium constant K. for the reaction H2(g) + Brz(g) = 2HBr(g) is 2.18 x 106 at 730°C. Starting with 3.20 moles of HBr in a 12.0-L reaction vessel, calculate the concentrations of H2, Br2, and HBr at equilibrium. (10 points) (Reference: Chang 14.43
Hydrogen is prepared commercially by the reaction of methane and water vapor at elevated temperatures. CH4...
Hydrogen is prepared commercially by the reaction of methane and water vapor at elevated temperatures. CH4 (g) + H2O(g) = 3H2(g) + CO (g) What is the equilibrium constant for the reaction if a mixture at equilibrium contains gases with the following concentrations: CH4, 0.13 M; H20,0.239 M; CO, 0.136 M; H2 1.21 M, at a temperature of 760 °C?
Please help with this problem Gaseous indium dihydride is formed from the elements at elevated temperature:...
Please help with this problem
Gaseous indium dihydride is formed from the elements at elevated temperature: In(g) + H2(g) = InH2(g), K = 1.48 at 973 K Part A The partial pressures measured in a reaction vessel are P = 0.0500atm PH = 0.0310atm POH = 0.0740atm Calculate Qp Express the reaction quotient to three significant figures. VO AE O aj ? Qp- Submit Request Answer Part B Specify the direction of reaction to attain equilibrium The reaction will proceed...
Saved Help Save & E The decomposition of hydrogen peroxide is a first-order process with a...
Saved Help Save & E The decomposition of hydrogen peroxide is a first-order process with a rate constant of 106 x 10- 3 min-1 How long will it take for the concentration of H202 to drop from 0.0200 M to 0.0120 M? 481 min 7.55 min <1 min Saved Hydrogen bromide will dissociate into hydrogen and bromine gases. 2HBr(g) = H2(g) + Br2(9) AH rxn = 68 kJ What effect will a temperature increase of 50°C have on this system...
Help please with work
Show your work when there are calculations, write units where appropriate, and use the correct significant figures. Do the work on a separate sheet of paper and once you have done it correctly, transcribe youir work clearly onto this sheet. 1. The value of Ke for the equilibrium: is 794 at 25°C a) At this temperature, what is the value of Ke for the following equilibrium? H2(g) + 12(g)% 2H1(g) HI(g)与½ H2(g) + ½ 12(g) b)...
Just give me the answers
MULTIPLE CHOICE. Choose the na t ive that best completes the statement or answer the questi 1) Write the equilibri e the equilibrium constanter ia for the following reaction in the forward direction 2CH )302)2006) 4H2O) 2100) + 4H20 A) KICHg2.0P B) Ke- CH-302 CO2+ [H2014 2 CH431021 COP 2014 Dj Ke-2100 H30 KICHAPOP 2) Ar elevated temperatures, molecular hydrogen and molecular bromine react to partially form hydrogen bromide H2(g) + Brz (g) 211Br (g)...
Just give me the answers
MULTIPLE CHOICE. Choose the n a tive that best completes the statement or answer the questi 1) Write the equilibri ne the equilibrium constanter ia for the following reaction in the forward direction 2CH )302)-2006) 4H2O) 2100) + 4H20 A) KICH. Op Bộ Ka-2H4 O2 [CO2+ [H2014 CO2 [H2014 2 CH4 - 31021 OK- Dj Ke-2100 H30 ICH 102P 2) Ar elevated temperatures molecular hydrogen and molecular bromine react to partially form hydrogen bromide H2(g)...
Question #: 28 Hydrogen and bromine react to form hydrobromic acid according to the reaction H2(g) + Br2(g) + 2 HBr(g) Kc = 2.18 x 106 at 730. °C. What is the equilibrium concentration of HBr if the initial concentrations of hydrogen and bromine are both 0.500 M? A. 1.21 M B. 0.262 M C. 0.408 M D. 0.999 M
The equilibrium constant K. for the reaction H2(g) + Brz(g) = 2HBr(g) is 2.18 x 106 at 730°C. Starting with 3.20 moles of HBr in a 12.0-L reaction vessel, calculate the concentrations of H2, Br2, and HBr at equilibrium. (10 points) (Reference: Chang 14.43
Hydrogen is prepared commercially by the reaction of methane and water vapor at elevated temperatures. CH4 (g) + H2O(g) = 3H2(g) + CO (g) What is the equilibrium constant for the reaction if a mixture at equilibrium contains gases with the following concentrations: CH4, 0.13 M; H20,0.239 M; CO, 0.136 M; H2 1.21 M, at a temperature of 760 °C?
Please help with this problem
Gaseous indium dihydride is formed from the elements at elevated temperature: In(g) + H2(g) = InH2(g), K = 1.48 at 973 K Part A The partial pressures measured in a reaction vessel are P = 0.0500atm PH = 0.0310atm POH = 0.0740atm Calculate Qp Express the reaction quotient to three significant figures. VO AE O aj ? Qp- Submit Request Answer Part B Specify the direction of reaction to attain equilibrium The reaction will proceed...
Saved Help Save & E The decomposition of hydrogen peroxide is a first-order process with a rate constant of 106 x 10- 3 min-1 How long will it take for the concentration of H202 to drop from 0.0200 M to 0.0120 M? 481 min 7.55 min <1 min Saved Hydrogen bromide will dissociate into hydrogen and bromine gases. 2HBr(g) = H2(g) + Br2(9) AH rxn = 68 kJ What effect will a temperature increase of 50°C have on this system...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 7 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 56 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago