The stability of tRNAs and rRNAs are generally much greater than that of mRNAs, and thus...
The stability of tRNAs and rRNAs are generally much greater than that of mRNAs, and thus have a longer life in the cell. How is this possible?
Homework Answers
This is because of the difference in structure of these different types of RNA.
It is a fact that these nucleic acids are less stable compared to DNA. This is due to the -OH group in the sugar (Ribose). Presence of this group makes RNA unstable. It's absence makes DNA more stable comparatively.
Among the types of RNA - tRNA, rRNA and mRNA.
The first two types are more stable due to their complex structure, cross linking, double strand, pairing etc. This makes reaching -OH group difficult for any degrading enzymes or compounds. While the last type is straight chain and its functional group is easily available for reaction and breakdown. This makes it comparatively less stable.
This is a brief discussion on the given topic. Hope this helps you out. Please feel free to give a like and contact us if you have any queries. Thank you and have a great day.
Add Answer to:
The stability of tRNAs and rRNAs are generally much greater than
that of mRNAs, and thus...
why does the rolling bicycle have greater stability than one at rest
why does the rolling bicycle have greater stability than one at rest
Approximately how much greater in mass is a D2O molecule than an H2O molecule? (Assume the...
Approximately how much greater in mass is a D2O molecule than an H2O molecule? (Assume the oxygen atoms have a mass number of 16. Deuterium, D, is an isotope of hydrogen with a mass number of 2, 2H.) in amu
Using the Empirical Rule, approximately how much probability is less than -1 AND greater than +1...
Using the Empirical Rule, approximately how much probability is less than -1 AND greater than +1 standard deviations from the mean of normal distribution with mean mu & standard deviation sigma?
6.) Explain with as much detail possible why when bonding, fluorine will have a greater pull...
6.) Explain with as much detail possible why when bonding, fluorine will have a greater pull on bonding electrons compared to iodine. U 7.) Explain with as much detail possible why sodium has a larger atomic radius than magnesium, 8.) Explain with as much detail possible why phosphorus has a larger atomic radius than nitrogen. 9.) Elements are very chemically reactive in groups 1 and 7. Use the trends to explain this observation. 10.) Below are the first thru third...
Value of home and life span are two variables that have been shown to have positive...
Value of home and life span are two variables that have been shown to have positive correlation but no cause-and-effect relationship. Describe at least one possible reason for the correlation. Select all that apply. A). Greater wealth allows people to afford more valuable homes and to spend more money on health care, and greater health care spending generally enables people to live longer. B). People who have more valuable homes tend to live more stressful lives, and stress generally decreases...
it is generally much more difficult to stop a heavy truck than a skateboard when they...
it is generally much more difficult to stop a heavy truck than a skateboard when they move at the same speed. State a case in which the moving skateboard could require more stopping force.
Gender is much more complicated than the mainstream binary view in which we are generally socialized...
Gender is much more complicated than the mainstream binary view in which we are generally socialized in U.S. culture. We can break “gender” into several concepts, including sex, gender identity, and gender expression. Explain the differences between these concepts. How do you engage in gender expression? If you lived in a different culture, how might your gender expression change?
2. Japanese CEOs generally receive much lower levels of compensation than CEOs in the United States....
2. Japanese CEOs generally receive much lower levels of compensation than CEOs in the United States. Does this imply that U.S. CEOs are overpaid?
When the price of a product rises, the increase in quantity supplied will generally be greater...
When the price of a product rises, the increase in quantity supplied will generally be greater in the long run than the short run because consumers are less resistant to higher prices in the long run than in the short run because they have fewer options in the long: a. run. consumer income will expand in the long run, causing resource prices to rise, which will induce producers to increase output. C. over time, new fims will enter the industry...
I think the "less than" sign is an error and it's supposed to be "greater than"....
I think the "less than" sign is an error and it's supposed to be
"greater than". If not, please explain to me how to interpret
it.
which K increases from left to right: Ba2+ > Sr?+ > Ca2+ > Mg2+ > Mn2+ > Fe2+ > Co2+ > Ni2+ > Cu2+ < Zn2+ of the ability of incoming ligands to cause the The stability of the complexes formed with divalent ions follows the Irving-Williams series, in
6.) Explain with as much detail possible why when bonding, fluorine will have a greater pull on bonding electrons compared to iodine. U 7.) Explain with as much detail possible why sodium has a larger atomic radius than magnesium, 8.) Explain with as much detail possible why phosphorus has a larger atomic radius than nitrogen. 9.) Elements are very chemically reactive in groups 1 and 7. Use the trends to explain this observation. 10.) Below are the first thru third...
When the price of a product rises, the increase in quantity supplied will generally be greater in the long run than the short run because consumers are less resistant to higher prices in the long run than in the short run because they have fewer options in the long: a. run. consumer income will expand in the long run, causing resource prices to rise, which will induce producers to increase output. C. over time, new fims will enter the industry...
I think the "less than" sign is an error and it's supposed to be
"greater than". If not, please explain to me how to interpret
it.
which K increases from left to right: Ba2+ > Sr?+ > Ca2+ > Mg2+ > Mn2+ > Fe2+ > Co2+ > Ni2+ > Cu2+ < Zn2+ of the ability of incoming ligands to cause the The stability of the complexes formed with divalent ions follows the Irving-Williams series, in
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 16 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 47 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago