Homework Answers
19. In non-competitive inhibition , the inhibition binds to the enzyme at a site other than the active site.The inhibitor binds to either free enzyme or the enzyme-substrate complex.so correct option is d.
20. correct option is e.
21. Chemiosmosis couples exergonic chemical reactions to endergonic transport, which create proton motive force.
so the correct option for 21 is both e and c
oxidative phosphorylation synthesis of ATP using energy released during the electron transport chain and chemiosmosis fueled by redox reaction.
22.correct option is d.
23. At the end of glycolysis from one molecule of glucose , 2 NADH , 4 ATP therefore total of 10 ATP-2 ATP = 8 ATP [ 2 ATP is consumed ]
Add Answer to:
19. d. Pantothenic acid b. Riboflavin e. Thiamine C. Niacin How would a noncompetitive inhibitor interfere...
please help solve Given the enzyme and substrate right how would a competitive inhibitor (d) interfere...
please help solve
Given the enzyme and substrate right how would a competitive inhibitor (d) interfere with a reaction involving the enzyme shown? Enzyme Substrate Competitive Non competitive In Select one: 1. It would bind to a O 2. It would bind to b. O 3. It would bind to c. 4. It would bind to d. 5. The answer cannot be determined based on the information provided. All of the following are true regarding African trypanosomiasis EXCEPT: Select one:...
Microbiology In the competitive inhibition of enzyme activity, which statement is correct? Inhibitor directly competes with...
Microbiology In the competitive inhibition of enzyme activity, which statement is correct? Inhibitor directly competes with the substrate. Less substrates must be added in order to reach Vmax. The number of active sites is unlimited. None of the above. In the noncompetitive inhibition of enzyme activity, which statement is correct?Inhibitors will cause a conformational change in the enzyme, more substrate must be added to reach Vmax, Enzymes bound to the inhibitor can still bind substrate, none of the above. ....
answer questions 15) An apoenzyme + cofactor(s) - a) Inhibitor b) active site c) substrate d)...
answer questions
15) An apoenzyme + cofactor(s) - a) Inhibitor b) active site c) substrate d) holoenzyme 16) Aspartate-transcarbamylase is an enveloved in a pathway that may produces molecule called Cytidine triphosphate. Cytidine triphosphate can bind to anot t o this enzyme, rendering the active site nonfunctional. This is an example of a) ATP hydrolysis b) competitive inhibition c) feedback inhibition d) allosteric activation 17) Which of the following is false regarding fermentation? a) fermentation occurs in the absence of...
14. The molecule 2,4-dinitrophenol (DNP) is an uncoupling agent that breaks down the concentration gradient of...
14. The molecule 2,4-dinitrophenol (DNP) is an uncoupling agent that breaks down the concentration gradient of protons formed during oxidative phosphorylation. DNP shuttling protons across the cell membrane, equalizing the concentration of protons on either side of the membrane. Which of the following will be true for a bacterium poisoned with DNP? a. The cell will have an increased level of NADH in the cytoplasm b. Oxygen will not be converted to water by the electron transport chain c. Glycolysis...
14. The molecule 2,4-dinitrophenol (DNP) is an uncoupling agent that breaks down the concentration gradient of...
14. The molecule 2,4-dinitrophenol (DNP) is an uncoupling agent that breaks down the concentration gradient of protons formed during oxidative phosphorylation. DNP shuttling protons across the cell membrane, equalizing the concentration of protons on either side of the membrane. Which of the following will be true for a bacterium poisoned with DNP? a. The cell will have an increased level of NADH in the cytoplasm b. Oxygen will not be converted to water by the electron transport chain c. Glycolysis...
QUESTION 1 Which of the following options lists the stages in cellular respiration in the correct...
QUESTION 1 Which of the following options lists the stages in cellular respiration in the correct order? A. glycolysis, oxidative phosphorylation, pyruvate oxidation, and the citric acid cycle B glycolysis, pyruvate oxidation, the citric acid cycle, and oxidative phosphorylation C. pyruvate oxidation, oxidative phosphorylation, glycolysis, and the citric acid cycle D. the citric acid cycle, oxidative phosphorylation, pyruvate oxidation, and glycolysis QUESTION 2 When a glucose molecule loses a hydrogen atom as the result of an oxidation-reduction reaction, the glucose...
1. A catalyst enhances the reaction rate by: a. Adding energy to the reaction b. Increasing...
1. A catalyst enhances the reaction rate by: a. Adding energy to the reaction b. Increasing the activation energy required for the reaction c. Reducing the activation energy required for the reaction d. Improving binding of the product to the active site 2. Numerical answer: During aerobic respiration how many ATP molecules are produced by the oxidation of a single molecule of pyruvate? 3. The trace elements magnesium and zinc, which are required for bacterial growth, are typically used as:...
no explaination is needed 28) Which of the following is true for all exergonic reactions? A)...
no explaination is needed
28) Which of the following is true for all exergonic reactions? A) The reaction proceeds with a net release of free energy B) The products have more total energy than the reactants. C) A net input of energy from the surroundings is required for the reactions to proceed. D) The reactions are nonspontaneous 29) When ATP releases some energy, it also releases Inorganic phosphate. What purpose does this serve (if any) in the cell? A) It...
1. Compare and contrast oxidative phosphorylation and the citric acid cycle. (20 pts total) 1 i)...
1. Compare and contrast oxidative phosphorylation and the citric acid cycle. (20 pts total) 1 i) Explain how they are similar in location, and how they are different in location. (10 pts) 1 li) Other than being a component of cellular respiration explain how they are similar in function, and how they are different in function. (10 pts) 2. When you lose weight, where does the carbon go that was in your fat? (20 pts) 3. Aerobic cellular respiration requires...
11. (5 pts) Vibrio fischeri are capable of carrying out mixed acid fermentation. This would allow...
11. (5 pts) Vibrio fischeri are capable of carrying out mixed acid fermentation. This would allow for continuation of which of the following? A. Glycolysis B. Oxidative phosphorylation C. Aerobic respiration D. Anaerobic respiration E. All of the above in ihnenmal mediated
please help solve
Given the enzyme and substrate right how would a competitive inhibitor (d) interfere with a reaction involving the enzyme shown? Enzyme Substrate Competitive Non competitive In Select one: 1. It would bind to a O 2. It would bind to b. O 3. It would bind to c. 4. It would bind to d. 5. The answer cannot be determined based on the information provided. All of the following are true regarding African trypanosomiasis EXCEPT: Select one:...
answer questions
15) An apoenzyme + cofactor(s) - a) Inhibitor b) active site c) substrate d) holoenzyme 16) Aspartate-transcarbamylase is an enveloved in a pathway that may produces molecule called Cytidine triphosphate. Cytidine triphosphate can bind to anot t o this enzyme, rendering the active site nonfunctional. This is an example of a) ATP hydrolysis b) competitive inhibition c) feedback inhibition d) allosteric activation 17) Which of the following is false regarding fermentation? a) fermentation occurs in the absence of...
14. The molecule 2,4-dinitrophenol (DNP) is an uncoupling agent that breaks down the concentration gradient of protons formed during oxidative phosphorylation. DNP shuttling protons across the cell membrane, equalizing the concentration of protons on either side of the membrane. Which of the following will be true for a bacterium poisoned with DNP? a. The cell will have an increased level of NADH in the cytoplasm b. Oxygen will not be converted to water by the electron transport chain c. Glycolysis...
14. The molecule 2,4-dinitrophenol (DNP) is an uncoupling agent that breaks down the concentration gradient of protons formed during oxidative phosphorylation. DNP shuttling protons across the cell membrane, equalizing the concentration of protons on either side of the membrane. Which of the following will be true for a bacterium poisoned with DNP? a. The cell will have an increased level of NADH in the cytoplasm b. Oxygen will not be converted to water by the electron transport chain c. Glycolysis...
QUESTION 1 Which of the following options lists the stages in cellular respiration in the correct order? A. glycolysis, oxidative phosphorylation, pyruvate oxidation, and the citric acid cycle B glycolysis, pyruvate oxidation, the citric acid cycle, and oxidative phosphorylation C. pyruvate oxidation, oxidative phosphorylation, glycolysis, and the citric acid cycle D. the citric acid cycle, oxidative phosphorylation, pyruvate oxidation, and glycolysis QUESTION 2 When a glucose molecule loses a hydrogen atom as the result of an oxidation-reduction reaction, the glucose...
1. A catalyst enhances the reaction rate by: a. Adding energy to the reaction b. Increasing the activation energy required for the reaction c. Reducing the activation energy required for the reaction d. Improving binding of the product to the active site 2. Numerical answer: During aerobic respiration how many ATP molecules are produced by the oxidation of a single molecule of pyruvate? 3. The trace elements magnesium and zinc, which are required for bacterial growth, are typically used as:...
no explaination is needed
28) Which of the following is true for all exergonic reactions? A) The reaction proceeds with a net release of free energy B) The products have more total energy than the reactants. C) A net input of energy from the surroundings is required for the reactions to proceed. D) The reactions are nonspontaneous 29) When ATP releases some energy, it also releases Inorganic phosphate. What purpose does this serve (if any) in the cell? A) It...
1. Compare and contrast oxidative phosphorylation and the citric acid cycle. (20 pts total) 1 i) Explain how they are similar in location, and how they are different in location. (10 pts) 1 li) Other than being a component of cellular respiration explain how they are similar in function, and how they are different in function. (10 pts) 2. When you lose weight, where does the carbon go that was in your fat? (20 pts) 3. Aerobic cellular respiration requires...
11. (5 pts) Vibrio fischeri are capable of carrying out mixed acid fermentation. This would allow for continuation of which of the following? A. Glycolysis B. Oxidative phosphorylation C. Aerobic respiration D. Anaerobic respiration E. All of the above in ihnenmal mediated
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 3 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 34 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago