Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
2. Refer to these reduction reactions with their standard potentials, for parts (a) through (e) E°...
Refer to the galvanic cell below: A.) which chemical species is oxidized as current flows if...
Refer to the galvanic cell below:
A.) which chemical species is oxidized as current flows if all
rectants/products were present at standard conditions?
B.) Which chemical species is reduced as current flows if all
rectants/products were present at standard at standard
conditions?
C.) What direction do the electrons flow?
D.) Where are the anode and cathode for this cell?
motor 0.1 M MnO4 0.2 M Mn2+ 0.01 M H 0.4 M Cr3+ 0.3 M Cr202 0.01 MH Salt Bridge The...
dDetermine E∘E∘, ΔG∘ΔG∘, and KK for the overall reaction from the balanced half-reactions and their standard...
dDetermine E∘E∘, ΔG∘ΔG∘, and KK for the overall reaction from
the balanced half-reactions and their standard reduction
potentials.4Fe3++2H2O −⇀↽− 4Fe2++O2+4H+
Assignment Score: Resources Give Up? Hint 1580/1900 Check Answer Attempt 3 K Question 15 of 19 not spontaneous spontaneous Determine E. AG°, and K for the overall reaction from the balanced half-reactions and their standard reduction potentials. 4 Fet2H2O 4Fe2 +02 +4H Fe e Fe2 E 0.771 V O22 H2e H,O EC 1.229 V E = V К- Is the...
Question 2 (1 point) Given the following half reactions with their corresponding standard reduction potentials, which...
Question 2 (1 point) Given the following half reactions with their corresponding standard reduction potentials, which of the following is/are true for the overall reaction happening under standard conditions? NO3 + 2H+ + 2e → NO2 + H20 E'O=0.421 V + O2 + 2H+ + 2e H20 E'=0.816 V (CHECK THE ONE(S) THAT IS/ARE CORRECT) 1) AE'' = 0.395 V for the spontaneous reaction. 2) % O2 + NO2 + NO3 is a spontaneous reaction. 3) O2 is the reducing...
the standard reduction potential is attached below Use the table of standard reduction potentials for the...
the standard reduction potential is attached below
Use the table of standard reduction potentials for the following exercises. 4. Predict the products of the following redox reactions, then identify which could spontaneously occur. a) H(aq) + Au (s) → b) H (aq) + Na (8) ► c) Au+ (aq) + Na (5) ► 5. Find a reagent that can oxidize Br" to Br2 but cannot oxidize CI'' to Cl? More than one reagent is possible, but you only need to...
1. Which of the following conditions defines a non-spontaneous oxidation-reduction reaction? E° + ΔG° - &
1. Which of the following conditions defines a non-spontaneous oxidation-reduction reaction? E° + ΔG° - Keq <1 E° - ΔG° - Keq <1 E° + ΔG°+ Keq >1 E° + ΔG°- Keq >1 E° - ΔG° + Keq <1 2. What information can be obtained from the Figure below? The equivalence point occurs at pH = 7.0 but the pKa is not known from the graph. Both the pOH and the...
Question 4 Using the table of standard reduction potentials shown below, calculate the standard cell potential for...
Question 4 Using the table of standard reduction potentials shown below, calculate the standard cell potential for a battery based on the following reactions. • MnO4 +8H+ + 5e + Mn+2 +4 H20 . 5 Ag + 5 Ag+1 +5e Reduction Half-Reaction F2 +2e + 2F MnO4 + 8 H+ + 5e + Mn+2 + 4H2O Cl2 + 2e + 20 O2 + 4H+ + 4e + 2 H2O Ag++ e + Ag Fet3 Fe + Fet2 O2 + 2...
The following two half-reactions are found in a table of standard reduction potentials: Half-Reaction E cytochrome...
The following two half-reactions are found in a table of standard reduction potentials: Half-Reaction E cytochrome c1(Fe3+) +e- → cytochrome c1 (Fe2+) 0.22 V lipoic acid + 2 H+ + 2 e- → dihydrolipoic acid -0.29 V + What is value of Eº for the reaction that will occur involving these two half-reactions that will be spontaneous under standard conditions? 0 0.73 V 0 0.07 V O 0.51 V -0.07 V
13. Find the standard reduction potentials for the following half-reactions: So+4H" + 2e-> HSO H2O and...
13. Find the standard reduction potentials for the following half-reactions: So+4H" + 2e-> HSO H2O and Ag" + e- > Ag a) Write the balanced overall reaction for a successful cell made from these two couples. b) Write the line notation for the cell. c) What is Eo for the cell? d) What is the equilibrium constant for the cell reaction at 250C? e) Calculate the ratio of activities of produces and reactants, Q, that will produce a cell voltage...
please help with all of the question. The following skeletal oxidation-reduction reaction occurs under acidic conditions....
please help with all of the question.
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced REDUCTION half reaction. NO3 + Mn2 MnO4 +HNO2 Reactants Products Retry Entire Group 9 more group attempts remaining Submit Answer Mastered The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. Sio2 + Ag Ag2O+Si- Products Reactants (1) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction half-reaction half-reaction identification AP...
Іго, Electrochemistry Wolleet 1. Assign oxidation numbers to each element in the following compounds: a. VOCI...
Іго, Electrochemistry Wolleet 1. Assign oxidation numbers to each element in the following compounds: a. VOCI b. Cuso c. CHOH). d. Mno, e. SO, 2. Given the following half reactions and their standard reduction potentials, i. Cl (g) + 2e- - 2 CI (aq) E' =+ 1.36 V ii. Niº (aq) + 2e - Ni (s) E' = -0.25 V iii. Ag (aq) + e- Ag () E' = +0.80 V Identify the chemical species most likely to be oxidized....
Refer to the galvanic cell below:
A.) which chemical species is oxidized as current flows if all
rectants/products were present at standard conditions?
B.) Which chemical species is reduced as current flows if all
rectants/products were present at standard at standard
conditions?
C.) What direction do the electrons flow?
D.) Where are the anode and cathode for this cell?
motor 0.1 M MnO4 0.2 M Mn2+ 0.01 M H 0.4 M Cr3+ 0.3 M Cr202 0.01 MH Salt Bridge The...
dDetermine E∘E∘, ΔG∘ΔG∘, and KK for the overall reaction from
the balanced half-reactions and their standard reduction
potentials.4Fe3++2H2O −⇀↽− 4Fe2++O2+4H+
Assignment Score: Resources Give Up? Hint 1580/1900 Check Answer Attempt 3 K Question 15 of 19 not spontaneous spontaneous Determine E. AG°, and K for the overall reaction from the balanced half-reactions and their standard reduction potentials. 4 Fet2H2O 4Fe2 +02 +4H Fe e Fe2 E 0.771 V O22 H2e H,O EC 1.229 V E = V К- Is the...
Question 2 (1 point) Given the following half reactions with their corresponding standard reduction potentials, which of the following is/are true for the overall reaction happening under standard conditions? NO3 + 2H+ + 2e → NO2 + H20 E'O=0.421 V + O2 + 2H+ + 2e H20 E'=0.816 V (CHECK THE ONE(S) THAT IS/ARE CORRECT) 1) AE'' = 0.395 V for the spontaneous reaction. 2) % O2 + NO2 + NO3 is a spontaneous reaction. 3) O2 is the reducing...
the standard reduction potential is attached below
Use the table of standard reduction potentials for the following exercises. 4. Predict the products of the following redox reactions, then identify which could spontaneously occur. a) H(aq) + Au (s) → b) H (aq) + Na (8) ► c) Au+ (aq) + Na (5) ► 5. Find a reagent that can oxidize Br" to Br2 but cannot oxidize CI'' to Cl? More than one reagent is possible, but you only need to...
Question 4 Using the table of standard reduction potentials shown below, calculate the standard cell potential for a battery based on the following reactions. • MnO4 +8H+ + 5e + Mn+2 +4 H20 . 5 Ag + 5 Ag+1 +5e Reduction Half-Reaction F2 +2e + 2F MnO4 + 8 H+ + 5e + Mn+2 + 4H2O Cl2 + 2e + 20 O2 + 4H+ + 4e + 2 H2O Ag++ e + Ag Fet3 Fe + Fet2 O2 + 2...
The following two half-reactions are found in a table of standard reduction potentials: Half-Reaction E cytochrome c1(Fe3+) +e- → cytochrome c1 (Fe2+) 0.22 V lipoic acid + 2 H+ + 2 e- → dihydrolipoic acid -0.29 V + What is value of Eº for the reaction that will occur involving these two half-reactions that will be spontaneous under standard conditions? 0 0.73 V 0 0.07 V O 0.51 V -0.07 V
13. Find the standard reduction potentials for the following half-reactions: So+4H" + 2e-> HSO H2O and Ag" + e- > Ag a) Write the balanced overall reaction for a successful cell made from these two couples. b) Write the line notation for the cell. c) What is Eo for the cell? d) What is the equilibrium constant for the cell reaction at 250C? e) Calculate the ratio of activities of produces and reactants, Q, that will produce a cell voltage...
please help with all of the question.
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced REDUCTION half reaction. NO3 + Mn2 MnO4 +HNO2 Reactants Products Retry Entire Group 9 more group attempts remaining Submit Answer Mastered The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. Sio2 + Ag Ag2O+Si- Products Reactants (1) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction half-reaction half-reaction identification AP...
Іго, Electrochemistry Wolleet 1. Assign oxidation numbers to each element in the following compounds: a. VOCI b. Cuso c. CHOH). d. Mno, e. SO, 2. Given the following half reactions and their standard reduction potentials, i. Cl (g) + 2e- - 2 CI (aq) E' =+ 1.36 V ii. Niº (aq) + 2e - Ni (s) E' = -0.25 V iii. Ag (aq) + e- Ag () E' = +0.80 V Identify the chemical species most likely to be oxidized....
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 54 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago