Note that there is no phosphate
glycerol can't be since there are only two OH groups
so
the best answer ios:
Fatty acid + alcohol with high MW
Consider the following classes of molecules. Glycerol Fatty acid Alcohol with higher molecular weight Phosphate (in...
A sphingomyelin includes all the following components except amino alcohol glycerol sphingosine. O phosphate group fatty acid QUESTION 4 Very low density lipoproteins are used to transport cholesterol to the liver. True False
12. Which of the following best describes the components of phospholipids? A) Glycerol, one fatty acid, two phosphate groups and an aminoalcohol B) Glycerol, two fatty acids, one phosphate group, and an aminoalcohol C) Sphingosine, two fatty acid, one phosphate group and an aminoalcohol D) Glycerol, three fatty acids, and a phosphate group 13. When ribose adopts the most stable cyclic structure hemiacetal, which of the following is happening? A. it becomes a furonose C. an acetal is formed B....
QUESTION 5 A sphingomyelin includes all the following components except O amino alcohol glycerol O sphingosine O phosphate group fatty acid QUESTION 6 The COX-1 enzyme produces prostaglandins in response to inflammation caused by tissue damage. O True False
In which of the following pairs of fatty acids does the first listed acid have a higher melting point than the second listed acid? a. 16:2 acid and 16:0 acid b. 21:0 acid and 17:0 acid c. 17:3 acid and 17:0 acid d. 17:3 acid and 20:0 acid Which of the following fatty acids is both monounsaturated and an omega-6 fatty acid? a. CH3–(CH2)18–COOH b. CH3–(CH2)7–CH=CH–(CH2)7–COOH c. CH3–(CH2)4–CH=CH–(CH2)2–(CH2)6–COOH d. CH3–CH2–(CH=CH–CH2)4–(CH2)2–COOH Which of the following types of compounds are expected products...
QUESTION 1Which way do the fatty acid tails of a phospholipid face in a cell membrane?a.toward the inside of the cellb.toward the outside of the cellc.both directionsd.They lay parallel to the direction of the membrane.QUESTION 2A readily available source of energy that cells use to drive reactions is stored in the ___________ bond.a.phosphodiesterb.phosphoanhydridec.hydrogend.peptideQUESTION 3Which of the following occurs by bringing nonpolar surfaces together to exclude water?a.hydrogen bondsb.hydrophobic forcesc.Van der Waals attractionsd.electrostatic attractionsQUESTION 4How many bonds are made by a carbon...
All of the following molecules are either substrates, cofactors or intermediates in the synthesis of triglyceride EXCEPT which one? Question 80 options: A. Glycerol 3-phosphate B. Fatty acyl-CoA C. Phosphatidic acid D. CDP-diglyceride
When testing the effect of molecular weight on diffusion, the hydrochloric acid and ammonia molecules were placed at different ends of a sealed tube. The ammonium chloride that formed when the molecules diffused towards each other and met was closer to the ammonia end of the tube. TRUE OR FALSE? Diffusion continues to occur until there is an equal concentration of particles on both sides of a semi-permeable membrane. TRUE OR FALSE? Diffusion is the spontaneous net movement of particles...
Which of the following statements about lipids is FALSE? a) Fatty acids are amphipathic molecules that can form micelles in aqueous solution. b) Triglycerides store less energy than a similar mass of glycogen. c) Prostaglandin and thromboxane are important signaling molecules that are fatty acid derivatives. d) Steroid hormones are sufficiently non-polar to diffuse through cell membranes without the help of a transporter. e) Phospholipids are amphipathic molecules that can form vesicles in aqueous solution.
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
3. Identify the following features of this phospholipid: a. Is the phospholipid formed from glycerol or sphingosine? b. What is the fatty acid? c. What type of bond connects the fatty acid? d. What is the amino alcohol?5. What is the function of the lipid bilayer in a cell membrane?6. How do molecules of cholesterol affect the structure of cell membranes?7. How do the unsaturated fatty acids in the phospholipids affect the structure of cell membranes? 9. What is the difference between...