Homework Answers
Increasing Temperature will shift the reaction in a direction which absorbs heat as per Le chatelier Principle
here increasing temperature shift equilibrium towards the reactant which is backward process.
So, backward process absorbs heat.
That is backward process is endothermic
Forward reaction must be exothermic
Answer: The reaction is exothermic
Add Answer to:
Question 17 CONTENT FEEDBACK If an increase in the temperature shifts a reaction toward the reactants,...
16. Effect of Temperature Changes Summary Temperature Change (increase or decrease) Reaction Type (Exothermic or endothermic)...
16. Effect of Temperature Changes Summary Temperature Change (increase or decrease) Reaction Type (Exothermic or endothermic) Effect on Reaction (favors products or reactants) Effect on K (increase or decrease) Increase Exothermic Increase Endothermic Decrease Exothermic Decrease Endothermic
Question 28 (5 points) For a particular reaction, increasing the temperature of the reaction at constant...
Question 28 (5 points) For a particular reaction, increasing the temperature of the reaction at constant pressure and volume increased the formation of the product. Which of the following is true for the reaction? The reaction is exothermic. Increasing the temperature always increases the product formation, so you can't tell if it is endothermic or exothermic. The reaction is endothermic. Temperature changes do not affect the equilibrium.
A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them...
A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) 1 atm pressure piston .cylinder From previous experiments, this chemical reaction is known to absorb 328. kJ of energy water bath gases The...
A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them...
A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) The temperature of the water bath is monitored, and it is determined from this data that 192 kJ of heat flows out of...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) piston cylinder From previous experiments, this chemical reaction is known to release 386. kJ of energy. water bath gases The...
FEEDBACK Content attribution QUESTION 10.1 POINT Is the following statement true or false? 00 ch The...
FEEDBACK Content attribution QUESTION 10.1 POINT Is the following statement true or false? 00 ch The series about = 0 is an example of a Maclaurin series. n! no Select the correct answer below: O TRUE o FALSE FEEDBACK Content attribution QUESTION 11 . 1 POINT Find the Tadornalinomial for fi R6
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) piston cyli From previous experiments, this chemical reaction is known to absorb 379. kJ of energy. gases The position of...
Two reactants, A and B are mixed together and the resulting mixture's temperature decreases as the...
Two reactants, A and B are mixed together and the resulting mixture's temperature decreases as the reaction proceeds to produce the products C and D. Is this reaction exothermic or endothermic? Explain Suppose the balanced chemical reaction for the reaction in question (1) is 2A + 38++ C + 2D. If the beat energy absorbed or released by this reaction is [75 k], what is the magnitude heat energy absorbed or released per mole of reactant B? Does the mass...
Question 14 of 20 > Use the Le Châtelier's principle interactive to answer these questions. For...
Question 14 of 20 > Use the Le Châtelier's principle interactive to answer these questions. For the reaction where An = -1, what happens after in increase in volume? O O O Q O Q <K so the reaction shifts toward products. = K so the reaction does not shift. > K so the reaction shifts toward reactants. For the reaction where An = 0, what happens after in increase in volume? O o O <K so the reaction shifts...
Font Open the Le Chatler's Principle Activity found in your textbook, Interactive General Chemistry. (Section 15.6,...
Font Open the Le Chatler's Principle Activity found in your textbook, Interactive General Chemistry. (Section 15.6, Figure 15.9), run the simulation and complete the following questions. 1. Start with the default settings where K = 1.00. a. Write the expression based on the chemical equation in the upper right corner. b. Under the initial conditions of (A) = 2.00 M, and (B) = 4.00 M, is the reaction at equilibrium? How can you tell? c. Compare how Q is affected...
16. Effect of Temperature Changes Summary Temperature Change (increase or decrease) Reaction Type (Exothermic or endothermic) Effect on Reaction (favors products or reactants) Effect on K (increase or decrease) Increase Exothermic Increase Endothermic Decrease Exothermic Decrease Endothermic
Question 28 (5 points) For a particular reaction, increasing the temperature of the reaction at constant pressure and volume increased the formation of the product. Which of the following is true for the reaction? The reaction is exothermic. Increasing the temperature always increases the product formation, so you can't tell if it is endothermic or exothermic. The reaction is endothermic. Temperature changes do not affect the equilibrium.
A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) 1 atm pressure piston .cylinder From previous experiments, this chemical reaction is known to absorb 328. kJ of energy water bath gases The...
A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) The temperature of the water bath is monitored, and it is determined from this data that 192 kJ of heat flows out of...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) piston cylinder From previous experiments, this chemical reaction is known to release 386. kJ of energy. water bath gases The...
FEEDBACK Content attribution QUESTION 10.1 POINT Is the following statement true or false? 00 ch The series about = 0 is an example of a Maclaurin series. n! no Select the correct answer below: O TRUE o FALSE FEEDBACK Content attribution QUESTION 11 . 1 POINT Find the Tadornalinomial for fi R6
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) piston cyli From previous experiments, this chemical reaction is known to absorb 379. kJ of energy. gases The position of...
Two reactants, A and B are mixed together and the resulting mixture's temperature decreases as the reaction proceeds to produce the products C and D. Is this reaction exothermic or endothermic? Explain Suppose the balanced chemical reaction for the reaction in question (1) is 2A + 38++ C + 2D. If the beat energy absorbed or released by this reaction is [75 k], what is the magnitude heat energy absorbed or released per mole of reactant B? Does the mass...
Question 14 of 20 > Use the Le Châtelier's principle interactive to answer these questions. For the reaction where An = -1, what happens after in increase in volume? O O O Q O Q <K so the reaction shifts toward products. = K so the reaction does not shift. > K so the reaction shifts toward reactants. For the reaction where An = 0, what happens after in increase in volume? O o O <K so the reaction shifts...
Font Open the Le Chatler's Principle Activity found in your textbook, Interactive General Chemistry. (Section 15.6, Figure 15.9), run the simulation and complete the following questions. 1. Start with the default settings where K = 1.00. a. Write the expression based on the chemical equation in the upper right corner. b. Under the initial conditions of (A) = 2.00 M, and (B) = 4.00 M, is the reaction at equilibrium? How can you tell? c. Compare how Q is affected...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 2 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 20 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 20 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 34 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago