Action potentials from different axons differ in amplitude. What does the amplitude predict about the axon's...
Action potentials from different axons differ in amplitude. What does the amplitude predict about the axon's diameter and why?
Homework Answers
Amplitude predicts the axon's diameter.This is related to the interior resistance offered to the flow of current with change in axon diameter. Axons with less diameter produce action potentials with low amplitude and vice versa.This is because axons with small diameter result in more resistance to the flow of current while axons will large diameter results in less resistance to the flow of current.Therefore, in axons with less diameter the flow of Na+ is restricted and it takes more time to accumulate more positive charges and reach threshold at the next segment to evoke an action potential.The opposite happens in axons with larger diameter where resistance being small, Na+ move faster from one axon segment to the other ,reach a threshold quickly and action potential is generated fast.We can conclude that a greater amplitude indicates larger axon's diameter while a lesser amplitude indicates lesser axon diameter.
Add Answer to:
Action potentials from different axons differ in amplitude. What
does the amplitude predict about the axon's...
how does the action potential stimulating heart muscle cells differ from other action potentials, and why?...
how does the action potential stimulating heart muscle cells differ from other action potentials, and why? How does this affect the refractory period of heart muscle cells?
Describe the differences in the action potentials from the different stimuli(air, touch, sound)? How did the...
Describe the differences in the action potentials from the different stimuli(air, touch, sound)? How did the response you measured in the ventral nerve cord change with different sound levels?Did different types of stimuli activate different sensory spines on the cockroach cerci? Suggest other factors that could influence the amplitude of the action potentials. this is a neuroscience lab question. i dont understand how to explain. but everytime, air( wind), sound (clap), and touch(wooden probe) was given to the cockroach's cerci,...
27. Explain the different ways that tastes activate action potentials. 28. What makes smell different from other senses?...
27. Explain the different ways that tastes activate action potentials. 28. What makes smell different from other senses?
Question 2 1 pts Graded potentials are different than action potentials since graded potentials: can beelther...
Question 2 1 pts Graded potentials are different than action potentials since graded potentials: can beelther depolarizing or hyperpolarizing while action potentials always hyperpolarizing O can be generated at the exposed areas of an axon while action potentials are only generated at the some of the Duron have the same strength no matter the intensity of the stimulus while action potentials vary in their strength (magnitude) with the intensity of the stimulus. Ocause the breakdown of neurotransmitters from a neuron...
The reason why action potentials are described as "all or none" is: a. because neurotransmitter is...
The reason why action potentials are described as "all or none" is: a. because neurotransmitter is released from all axon terminals or none of them. b. an action potential arriving at an axon terminal either causes all the neurotransmitters to be released or none to be released. c. either all ion channels in the axon membrane open or none open. d. if an action potential is generated in a neuron, the amplitude does not depend on the stimulus strength. e....
A Draw graphs showing the effect on action potentials in a cell following effective doses of...
A Draw graphs showing the effect on action potentials in a cell following effective doses of each of the listed neurotoxins. Assume that the cell is normally brought to threshold by an electrical stimulus applied to it, so that any abnormality is due to the toxin. Precise values for voltage and duration are not important, just a general trend in how the action potential may be different from normal 1. puffer fish poison (blocks voltage-gated sodium channel activation) (25 Points)...
A. Draw graphs showing the effect on action potentials in a cell following effective doses of...
A. Draw graphs showing the effect on action potentials in a cell following effective doses of each of the listed neurotoxins Assume that the cell is normally brought to threshold by an electrical stimulus applied to it, so that any abnormality is due to the toxin. Precise values for voltage and duration are not important, just a general trend in how the action potential may be different from normal 1. puffer fish poison (blocks voltage-gated sodium channel activation) (25 Points)...
Period. DLDE How d graded current is different from an action potential. Make sure you think...
Period. DLDE How d graded current is different from an action potential. Make sure you think about: evenirea D Percom • Where in a neuron these take place and the direction they travel. • How does the strength of the signals change as it travels • Explain any differences in the velocity (how fast) of travel 56. Describe the 3 classifications of axons based on size and velocity of propagation. 57. The release of a neurotransmitter is dependent on what...
10. How does endotoxin differ in its mode of action from an A-B-type toxin?
10. How does endotoxin differ in its mode of action from an A-B-type toxin?
When determining the relative reduction potentials of several electrode systems, why does it not matter what...
When determining the relative reduction potentials of several electrode systems, why does it not matter what is chosen as a reference electrode? What action(s) is/are required to compare electrode potentials measured relative to different references? A galvanic cell is created according to the following cell notation: Al(s) | Al3+(1.0M) || Cu2+(1.0M) | Cu(s) Reduction Half Reaction E ̊ (volts) Al3+(aq) + 3e- -> Al(s) -1.66 Cu2+(aq) + 2e- -> Cu(s) 0.34 What is the overall cell potential? What would be...
Question 2 1 pts Graded potentials are different than action potentials since graded potentials: can beelther depolarizing or hyperpolarizing while action potentials always hyperpolarizing O can be generated at the exposed areas of an axon while action potentials are only generated at the some of the Duron have the same strength no matter the intensity of the stimulus while action potentials vary in their strength (magnitude) with the intensity of the stimulus. Ocause the breakdown of neurotransmitters from a neuron...
A Draw graphs showing the effect on action potentials in a cell following effective doses of each of the listed neurotoxins. Assume that the cell is normally brought to threshold by an electrical stimulus applied to it, so that any abnormality is due to the toxin. Precise values for voltage and duration are not important, just a general trend in how the action potential may be different from normal 1. puffer fish poison (blocks voltage-gated sodium channel activation) (25 Points)...
A. Draw graphs showing the effect on action potentials in a cell following effective doses of each of the listed neurotoxins Assume that the cell is normally brought to threshold by an electrical stimulus applied to it, so that any abnormality is due to the toxin. Precise values for voltage and duration are not important, just a general trend in how the action potential may be different from normal 1. puffer fish poison (blocks voltage-gated sodium channel activation) (25 Points)...
Period. DLDE How d graded current is different from an action potential. Make sure you think about: evenirea D Percom • Where in a neuron these take place and the direction they travel. • How does the strength of the signals change as it travels • Explain any differences in the velocity (how fast) of travel 56. Describe the 3 classifications of axons based on size and velocity of propagation. 57. The release of a neurotransmitter is dependent on what...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 29 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago