Homework Answers
Q.9
Matter can not be created or destroyed . It is akways conserved.
so correct statement is ' No matter is always conserved '.
Q.10.
AB 
A + B.
as mass is conserved,
total mass of reactants = total mass of products
given, mass of AB = 25 g. mass of A = 10 g
Then , mass of AB = mass of A + mass of B
or, 25 g = 10 g + mass of B
or, mass of B = (25 - 10) g = 15 g .
Add Answer to:
Q9. Can matter be created or destroyed? Yes, it can be created. Yes, it can be...
Q4. Suppose a reaction were to happen in an open container in a lab. During the...
Q4. Suppose a reaction were to happen in an open container in a lab. During the reaction, the scientist observes the chemicals bubble, and produce a gas. During the analysis the scientist notices that the reactants weighed 20 g when he started, and the product weighed 18 g. Explain what happened. 1. His chemical reaction defied the law of conservation of mass 2. The product destroyed mass during the reaction 3. The reactants created matter during the reaction 4. The...
3. Given that a cup of coffee costs 90 cents and you have 100 grams each...
3. Given that a cup of coffee costs 90 cents and you have 100 grams each of nickels, quarters and dimes, if a nickel weighs 5.00 g, a quarter weighs 5.55 g and a dime weighs 2.22 g a) (8 pts) What is the maximum number of cups of coffee can you buy with your change? b) (2 pts) How much money will you have left over? 4. (10 pts) The law of mass conservation is another fundamental law in...
The Law of Conservation of Energy insists that energy can neither be created nor destroyed. Is...
The Law of Conservation of Energy insists that energy can neither be created nor destroyed. Is there any hope for us to create energy on earth with available resources? What is Dark Energy? How does it fall into the category of energy creation? Not meaning transformation.
CHE115 Tear this page out of your laboratory manual Name: our laboratory manual and submit it...
CHE115 Tear this page out of your laboratory manual Name: our laboratory manual and submit it to your TA with your answers Zinc reacts with lodine in the fixed mass ratio of 1 gram of zinc to ne, how many grams of iodine are required to completely react with B. Post-Lab Assessment Questions: (32 pts) 1. (4 pts) Given that zinc reacts with i 3.88 grams of iodine, how many grams of 4.2 grams of zinc? You must show your...
The first law of thermodynamics states that energy can neither be created nor destroyed. How then...
The first law of thermodynamics states that energy can neither be created nor destroyed. How then is it possible for ∆E to be anything other than zero? In other words, what do we mean when we call a physical scenario “non-conservative” if energy must, by nature, be conserved?
As early as 400 B.C., Greek philosophers proposed that matter was made up of particles. During...
As early as 400 B.C., Greek philosophers proposed that matter was made up of particles. During the 1800s, John Dalton linked the idea of atoms with the chemical identity of an element. His atomic theory of matter involved the following postulates. 1. Each element is composed of extremely small particles called atoms. 2. All atoms of a given element are identical to one another in mass and other properties, but the atoms of one element are different from the atoms...
Use the law of conservation of mass to answer the questions. Consider a hypothetical reaction in...
Use the law of conservation of mass to answer the questions. Consider a hypothetical reaction in which A and B are reactants and C and D are products. If 13 g of A completely reacts with 21 g of B to produce 18 g of C, how many grams of D will be produced? A 3.6 g sample of sodium hydrogen carbonate is added to a solution of acetic acid weighing 10.1 g. The two substances react, releasing carbon dioxide...
Part A State the law of conservation of energy The law of conservation of energy states...
Part A State the law of conservation of energy The law of conservation of energy states that energy can neither be created or destroyed. Energy can be transferred from one object to another, and it can assume different forms. The law of conservation of energy states that energy can not be created but it can be destroyed. Energy can be transferred from one object to another can be destroyed in a chemical reaction, and it can assumo different forms The...
When a chemical reaction occurs, atoms rearrange to form now compounds, but no new atoms are...
When a chemical reaction occurs, atoms rearrange to form now compounds, but no new atoms are created nor are any destroyed This concept is called conservation of mass. Mass conservation can be seen in a balanced chemical equation where the numbers of each kind of atom are the same on both sides of the reaction arrow. The figure (Figure 1) shows the reaction of element A (lavender spheres) with element B (tan spheres). Write the balanced chemical equation for this...
Tele No The first law of thermodynamics states that energy cannot be created or destroyed. If...
Tele No The first law of thermodynamics states that energy cannot be created or destroyed. If this is the case, why is it said that "energy does not cycle"? 1. 2. In the body, glucose can be broken down via cellular respiration to provide energy, or it can be built into chains of glycogen (or starch for plants) and stored. What determines which reaction glucose undergoes? 3. In the following metabolic pathway, we normally get the final product "G." A-F...
Q4. Suppose a reaction were to happen in an open container in a lab. During the reaction, the scientist observes the chemicals bubble, and produce a gas. During the analysis the scientist notices that the reactants weighed 20 g when he started, and the product weighed 18 g. Explain what happened. 1. His chemical reaction defied the law of conservation of mass 2. The product destroyed mass during the reaction 3. The reactants created matter during the reaction 4. The...
3. Given that a cup of coffee costs 90 cents and you have 100 grams each of nickels, quarters and dimes, if a nickel weighs 5.00 g, a quarter weighs 5.55 g and a dime weighs 2.22 g a) (8 pts) What is the maximum number of cups of coffee can you buy with your change? b) (2 pts) How much money will you have left over? 4. (10 pts) The law of mass conservation is another fundamental law in...
CHE115 Tear this page out of your laboratory manual Name: our laboratory manual and submit it to your TA with your answers Zinc reacts with lodine in the fixed mass ratio of 1 gram of zinc to ne, how many grams of iodine are required to completely react with B. Post-Lab Assessment Questions: (32 pts) 1. (4 pts) Given that zinc reacts with i 3.88 grams of iodine, how many grams of 4.2 grams of zinc? You must show your...
As early as 400 B.C., Greek philosophers proposed that matter was made up of particles. During the 1800s, John Dalton linked the idea of atoms with the chemical identity of an element. His atomic theory of matter involved the following postulates. 1. Each element is composed of extremely small particles called atoms. 2. All atoms of a given element are identical to one another in mass and other properties, but the atoms of one element are different from the atoms...
Use the law of conservation of mass to answer the questions. Consider a hypothetical reaction in which A and B are reactants and C and D are products. If 13 g of A completely reacts with 21 g of B to produce 18 g of C, how many grams of D will be produced? A 3.6 g sample of sodium hydrogen carbonate is added to a solution of acetic acid weighing 10.1 g. The two substances react, releasing carbon dioxide...
Part A State the law of conservation of energy The law of conservation of energy states that energy can neither be created or destroyed. Energy can be transferred from one object to another, and it can assume different forms. The law of conservation of energy states that energy can not be created but it can be destroyed. Energy can be transferred from one object to another can be destroyed in a chemical reaction, and it can assumo different forms The...
When a chemical reaction occurs, atoms rearrange to form now compounds, but no new atoms are created nor are any destroyed This concept is called conservation of mass. Mass conservation can be seen in a balanced chemical equation where the numbers of each kind of atom are the same on both sides of the reaction arrow. The figure (Figure 1) shows the reaction of element A (lavender spheres) with element B (tan spheres). Write the balanced chemical equation for this...
Tele No The first law of thermodynamics states that energy cannot be created or destroyed. If this is the case, why is it said that "energy does not cycle"? 1. 2. In the body, glucose can be broken down via cellular respiration to provide energy, or it can be built into chains of glycogen (or starch for plants) and stored. What determines which reaction glucose undergoes? 3. In the following metabolic pathway, we normally get the final product "G." A-F...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago