Homework Answers
Add Answer to:
8, 9 and 10 please!
8. Rank the fol1 of basielty VI211 d. IV>111> 11 >1...
Predict the product for the following reaction and provide a stepwise curved arrow mechanism for the...
Predict the product for the following reaction and provide a stepwise curved arrow mechanism for the formation of the product. нсон H, OH H2SO
Organic chemistry 1 questions Please answer #6, 7, and 9 Provide the structures a the two...
Organic chemistry 1 questions
Please answer #6, 7, and 9
Provide the structures a the two major organic products generated upon completion of the following reaction scheme. 7 . Predict the product and provide a curved arrow mechanism for the formation of the product. 9.(5pts) For the following reaction draw the two major organic products produced.
9. Give the curved arrow mechanism for each reaction. H2SO4 b. H,o OH c. H20 H2SO...
9. Give the curved arrow mechanism for each reaction. H2SO4 b. H,o OH c. H20 H2SO d. OH H2o 10. For the following reaction, H,so, H,O он a. Give the curved arrow mechanism for the reaction, showing formation of both products b. Identify the major product and explain why it is favored. c. Draw the energy diagram for the formation of the major product. 11. Give the major organic product for the following reactions. If a racemic mixture is expected,...
H₂cold d=CH₂ Z o= CECH C Oy 24. Rank the carbocations the number corresponding we carbocations...
H₂cold d=CH₂ Z o= CECH C Oy 24. Rank the carbocations the number corresponding we carbocations below in order of increasing stability (least stable 1: Most Stable 3). Place number corresponding to the carbocation's relative stability in the blank below the structure. Consider the following reaction: CH3 CH3 + HC1 2. 25. Write the complete stepwise mechanism for this reaction. Show all intermediate structur show all electron flow using the curved arrow convention.
please answer the following questions. thank you 10. Predict the product for the following reaction. 1....
please answer the following questions. thank you
10. Predict the product for the following reaction. 1. LiAIH 2. H2O 11. Provide the reagents necessary to carry out the following conversion. OH OH OH 9. Provide the reagents necessary to carry out the following conversion. 3. What is the IUPAC name for the following compound? HO OH
please give correct answer to these 5 questions with explanations, thankyou Alkenes are nucleophiles that can...
please give correct answer to these 5 questions with
explanations, thankyou
Alkenes are nucleophiles that can undergo electrophilic addition. Which of the following best describes the nucleophilic nature of alkenes? Select one a. The TT bond is localised above and below the C-C o bond, and the TT electrons are relatively far away from the nuclei and are loosely bound b. The bond is localised above and below the C-CT bond, and the electrons are relatively far away from the...
11. a) Provide the two substituenproductsforthe followingSNI reaction: (6…) OH b) Show the mechanism for the...
11. a) Provide the two substituenproductsforthe followingSNI reaction: (6…) OH b) Show the mechanism for the formation of the 1.2 and 1.4-addition products sho reaction below: (10 points) H-Br c) Using curved arrows, show the product of the following Diels-Alder r mechanism for its formation:(9 points)
Which of the following compounds are aromatic? 25. NH2 N: Which of the following structures, if flat, would be classified as antiaromatic? 26. HN 11 and Ⅳ (C) IV and V (D) only Ⅳ (B) only 11 (A)...
Which of the following compounds are aromatic? 25. NH2 N: Which of the following structures, if flat, would be classified as antiaromatic? 26. HN 11 and Ⅳ (C) IV and V (D) only Ⅳ (B) only 11 (A) l and 111 Which nitrogen atoms are basic? 27. (A) 1 and 3(B) 2 and 4 H. (D)2,4,and5 (C) 1,3, and5 Nitrogen's lone pair electrons occupy what type of orbital in pyridine? 28. (A)s (B)p () sp(D)sp (E) sp
Which of the...
1 9. Arrange the following in ng compounds in increasing (weakest to strongest) order of basicity. NH2 NH2 NO2 E. None of the above What is the product of the following sequence? 10. H3C CH3 OH о...
1 9. Arrange the following in ng compounds in increasing (weakest to strongest) order of basicity. NH2 NH2 NO2 E. None of the above What is the product of the following sequence? 10. H3C CH3 OH он Na V. A I What is the major product for the following Reaction? 11. Pd(OAc)h PPhy Et N NO2 NO2 NO2 C.Ⅲ A. I D. IV V. 12. Predict the product for the following reaction. Br 1. NaNs 2. LiAIH4 3. H20
1...
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the foll...
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
Predict the product for the following reaction and provide a stepwise curved arrow mechanism for the formation of the product. нсон H, OH H2SO
Organic chemistry 1 questions
Please answer #6, 7, and 9
Provide the structures a the two major organic products generated upon completion of the following reaction scheme. 7 . Predict the product and provide a curved arrow mechanism for the formation of the product. 9.(5pts) For the following reaction draw the two major organic products produced.
9. Give the curved arrow mechanism for each reaction. H2SO4 b. H,o OH c. H20 H2SO d. OH H2o 10. For the following reaction, H,so, H,O он a. Give the curved arrow mechanism for the reaction, showing formation of both products b. Identify the major product and explain why it is favored. c. Draw the energy diagram for the formation of the major product. 11. Give the major organic product for the following reactions. If a racemic mixture is expected,...
H₂cold d=CH₂ Z o= CECH C Oy 24. Rank the carbocations the number corresponding we carbocations below in order of increasing stability (least stable 1: Most Stable 3). Place number corresponding to the carbocation's relative stability in the blank below the structure. Consider the following reaction: CH3 CH3 + HC1 2. 25. Write the complete stepwise mechanism for this reaction. Show all intermediate structur show all electron flow using the curved arrow convention.
please answer the following questions. thank you
10. Predict the product for the following reaction. 1. LiAIH 2. H2O 11. Provide the reagents necessary to carry out the following conversion. OH OH OH 9. Provide the reagents necessary to carry out the following conversion. 3. What is the IUPAC name for the following compound? HO OH
please give correct answer to these 5 questions with
explanations, thankyou
Alkenes are nucleophiles that can undergo electrophilic addition. Which of the following best describes the nucleophilic nature of alkenes? Select one a. The TT bond is localised above and below the C-C o bond, and the TT electrons are relatively far away from the nuclei and are loosely bound b. The bond is localised above and below the C-CT bond, and the electrons are relatively far away from the...
11. a) Provide the two substituenproductsforthe followingSNI reaction: (6…) OH b) Show the mechanism for the formation of the 1.2 and 1.4-addition products sho reaction below: (10 points) H-Br c) Using curved arrows, show the product of the following Diels-Alder r mechanism for its formation:(9 points)
Which of the following compounds are aromatic? 25. NH2 N: Which of the following structures, if flat, would be classified as antiaromatic? 26. HN 11 and Ⅳ (C) IV and V (D) only Ⅳ (B) only 11 (A) l and 111 Which nitrogen atoms are basic? 27. (A) 1 and 3(B) 2 and 4 H. (D)2,4,and5 (C) 1,3, and5 Nitrogen's lone pair electrons occupy what type of orbital in pyridine? 28. (A)s (B)p () sp(D)sp (E) sp
Which of the...
1 9. Arrange the following in ng compounds in increasing (weakest to strongest) order of basicity. NH2 NH2 NO2 E. None of the above What is the product of the following sequence? 10. H3C CH3 OH он Na V. A I What is the major product for the following Reaction? 11. Pd(OAc)h PPhy Et N NO2 NO2 NO2 C.Ⅲ A. I D. IV V. 12. Predict the product for the following reaction. Br 1. NaNs 2. LiAIH4 3. H20
1...
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
Most questions answered within 3 hours.
-
Jamie is doing a survey at her school about whether the students
feel the cafeteria food...
asked 5 minutes ago -
What are the roles of 3' and 5' untranslated regions in
mRNAs?
asked 6 minutes ago -
A domestic television receives antenna delivers a sky noise
power of -105 dBm to a matched...
asked 4 minutes ago -
What do you think are the chemical reactions involved in the
breathalyzer tests administered to potentially...
asked 20 minutes ago -
A random sample of 120 observations produces a mean of
38.2 from a population with a...
asked 27 minutes ago -
The average area of land burned by forest fires every year in
Canada is 2.5 million...
asked 29 minutes ago -
36. The basic difference between government bureaus and market
firms is that bureaus:
a. can...
asked 29 minutes ago -
java
- A recursive method findR() to search for a number in list
(ArrayList)
- A...
asked 47 minutes ago -
Which of the following is an example of a screen against adverse
selection? [Mark All That...
asked 46 minutes ago -
A worker drives a 0.560 kg spike into a rail tie with a 2.76 kg
sledgehammer....
asked 52 minutes ago -
Assume the following information concerning two stocks that make
up an index. What is the price-weighted...
asked 54 minutes ago -
Suppose a firm has a retention ratio of 58 percent and net
income of $9.2 million....
asked 57 minutes ago