show how you would prepare the following compounds from 4-methyl-3-penten-2-one.
show how you would prepare the following compounds from 4-methyl-3-penten-2-one. (CH3 02C CHCOCH3 (a) CH CH3C...
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
Show how to prepare to prepare the following using the substance CH, and any other a) CH CH CH CH CH from an alkene b) CH CH.CH,—0CHCH,CH from an alcohol w from 2-methyl-2-pentanol from 2-methy-2-pentano d) from 1-butene CH3 -CH-0-CH2CH3 СН2СН3
4) Based on the structure of 3-penten-2-on and 4-penten-2-on determine which of the two compounds will absorb UV light at shorter wavelength. Explain your reasoning. 5) Draw McLafferty rearrangement of 4-methyl hexanal. Determine ion fragments.
26) Name the following compound. CH3 H2C=CH-CH2CHCH: A) 1,1-dimethyl-3-butane B) 4-methyl-1-pentene C) hexene D) 2-methyl-4-pentene E) 2-methylpentene 27) Name the following compound. CI A) 2,3,5-trichlorobenzene B) trichlorostyrene C) 1,3,4-trichlorobenzene D) 1,3,4-trichlorohexene E) 1,2,4-trichlorobenzene 28) Identify the formula for an alkene. A) CnH2n+4 B) CnH2n+2 C) CnH2n D) CnH2n-4 E) CnH2n-2 29) Name the following compound. A) 1,4-bromocyclohexene B) 1,4-dibromobenzene C) 3,6-dibromobenzene D) 2,5-dibromobenzene E) 2,5-dibromocyclohexene 30) Name the following compound. CECH CH,CH,CHCH A) 2-ethynebutane B) 3-methyl-1-pentyne C) 3-methyl-4-pentyne D) 3-ethyl-1-butyne...
g) Which structure is Z-2-bromo-3-methyl-2-pentene? CH3 H3C CH2CH3 H C=C CH-CH,CH, CH3 CH3 Вісн. C=C CH3 Br н Br | BÁ CHẠCH, C=C CH, CHỊCH, 10) Which compounds contain stereocenters? D) 1-chloropentane II) 2-chloropentane III) 3-chloropentane IV) 1,2-dichloropentane 11) Aspartame is an artificial, non-saccharide sweetener. It is made from two amino acids phenylalanine (methyl ester) and aspartic acid. Both aminoacids have one stercocenter. Both stereocenters have S-stereoconfiguration. Which of the two structures is aspartame? H2N-C-C-N-C-0-0 CH2 CH2 c=0 HO HO...
1. Which Wittig reagent would be used to synthesize 2 CH-CH=P(CAH) CH=P(CHẠh. P(CH3)3 CH,CH,CH-P(CH3)3 IV 2. What is the correct IUPAC name for the following compound? 6 eye 3. What is the correct structure for 7-methyl-4-octanone? 3 4. The products, D and E, of the following reaction sequence, S "CN HCI HCN CH.NO H20 heat would be: CH2CH2CN CH,CH,MgBe HO E ? ether Show how you would synthesize the following compound, beginning with 1-butene, Bromobenzene and any necessary additional reagents....
Q3. Distinguish using IR spectroscopic assignments between 4-methyl-2-pentanone and 4-methyl-3- penten-2-one. (5 marks)
could someone help with this plz Identify the correct structure of trans-2-methyl-3-hexene Select one CH3CH2 CH 3 CH3 CH2CH3 CH CH2 CH2CH3 CH3 CH CH CH2CH3 ?-? CH CH CH C=C CH2CH3
Which of the following compounds represents (S)-2-bromobutane? Which of the following compounds represents (S)-2-bromobutane? Br CH3 CH3 CHз H Br Br Н CH2CH3 CH2CH3 CH-CHз 3) 2) 1) 1) 2) 3) C Which of the following compounds represents (S)-2-bromobutane? Br CH3 CH3 CHз H Br Br Н CH2CH3 CH2CH3 CH-CHз 3) 2) 1) 1) 2) 3) C
Question 33 33) What is the IUPAC name for the following compound? CH3 CH-CH2-CH=C-CH3 A) 3-methyl-4-pentene B) 2-methyl-3-pentene C) hexene D) 2-methyl-2-pentene E) 4-methyl-3-pentene A B с 3 11 7월 5 30 Ах P TA MacBook Pro