Homework Answers
Add Answer to:
Given the experimental rate data shown here and the knowledge that this reaction is first order...
23. Given the following experimental data, find the rate law and the rate constant for the...
23. Given the following experimental data, find the rate law and the rate constant for the reaction: NO (8) + NO2 (g) + O2(g) → N2O(g) Run (NO), M (NO2), M (O2)., M. Initial Rate, Ms? 0.10 M 0.10 M 0.10 M 2.1 x 102 0.20 M 0.10 M 0.10 M 4.2 x 102 - NM + 0.20 M 0.30 M 0.20 M 1.26 x 102 0.10 M 0.10 M 0.20 M 2.1 x 102
A certain reactant disappears by a first order reaction that has a rate constant K= 3.5x10^-3...
A
certain reactant disappears by a first order reaction that has a
rate constant K= 3.5x10^-3 s-1. If the initial concentration of the
reactant is 0.500 M , how long will it take for the concentration
to drop to
0.200 M ?
4. A certain reactant disappears by a first-order reaction that has a rate constant k=3.5 x 10 s. If the initial concentration of the reactant is 0.500 M, how long will it take for the concentration to drop...
Experimental rate data for the reaction 2H2(g) + Cl2(g) → 2HCl(g) are given in the chart...
Experimental rate data for the reaction 2H2(g) + Cl2(g) → 2HCl(g) are given in the chart below. Experiment [H2] [Cl2] Rate in M×s-1 1 0.0020 0.0075 3.8 x 10-3 2 0.0020 0.0025 1.3 x 10-3 3 0.0050 0.0025 1.3 x 10-3 4 0.0050 0.0010 0.5 x 10-3 a). What are the orders of the reaction for H2 and Cl2 individually? SHOW WORK. b).Then write the rate law for this overall reaction:
Incorrect Question 9 0/2 pts A first order reaction with a k=0.216 (with units expressed in...
Incorrect Question 9 0/2 pts A first order reaction with a k=0.216 (with units expressed in hours). How long in hours, to have 87.5% of the original concentration remaining. Answer to 2 decimal places. 0.62 Partial Question 6 1.5/3 pts The following reaction was run four times: NO(g) + Cl2le) - NOCIE) What is the order of reaction with respect to: NO- 1/2 C12= 1 Solve for the reaction constant (proportionality constant): k= 1.14 X10 -5 (Answer to 2 decimal...
please help. question 62 s is first order in the reac ich reaction is fastest if...
please help. question 62
s is first order in the reac ich reaction is fastest if the reactants are the same? All be reactant abled. -Br₂(g) → and [Br.] ed [NO] The fol reaction ] is increased 14.59. Each of the following reactions is for and second order overall. Which res initial concentrations of the reactants reactions are at 298 K. 2. C10 (8) + O2(g) → CIO(g) + O. = 3.0 X 10-cm/(molecules) b. CIO.(g) + NO(g) → NO2(g)...
You have a reaction: A + B --> C The reaction is first order with respect...
You have a reaction: A + B --> C The reaction is first order with respect to A and 2nd order with respect to B. If 0.8904 mol of A is mixed with 0.3749 mol of B to make a 1.000 L solution and the rate of the reaction is 0.873 M/s, what is the rate constant (k)?
1. The second-order rate constant for self-reaction of hydroxyl radicals 2 OH → H2O + O...
1. The second-order rate constant for self-reaction of hydroxyl radicals 2 OH → H2O + O has the value 1.0786E9 M-1·s-1 at 360.0 K. Compute the half-life of OH radicals at this temperature if the initial concentration is 6.74E-6 M. 3. Calculate the initial rate of a first-order reaction if the concentration of reactant is 0.37 M and the half-life is 4.48 s. Enter the correct numerical value to 2.0% precision. Express scientific notation like 4.29E-15 M·s-1 4. Cyano...
1a. The reaction of NO and O2 produces NO2. 2 NO(g) + O2(g) → 2 NO2(g)...
1a. The reaction of NO and O2 produces NO2. 2 NO(g) + O2(g) → 2 NO2(g) The reaction is second order with respect to NO(g) and first order with respect to O2(g). At a given temperature, the rate constant, k, equals 4.6 x 102 M–2 s–1. When the initial concentrations of NO and O2 are 0.02 M and 0.015 M, respectively, the rate of the reaction is ___ M/s. 1b. The rate constant of a first-order decomposition reaction is 0.014...
1.The reaction of hydrogen and nitric oxide, shown below, is first order with respect to hydrogen...
1.The reaction of hydrogen and nitric oxide, shown below, is first order with respect to hydrogen and second order with respect to nitric oxide. Write the rate law for this reaction. (Rate expressions take the general form: rate = k . [A]a . [B]b.) 2 H2(g) + 2 NO(g) → N2(g) + 2 H2O(l) The rate law for a general reaction involving reactant A is given by the equation rate = k[A]2, 2. Where rate is the rate of the...
26. Hydrogen peroxide decomposes into water and oxygen in a first-order process. H2O2(aq) → H2O(l) +...
26. Hydrogen peroxide decomposes into water and oxygen in a first-order process. H2O2(aq) → H2O(l) + 1/2 O2(g) 26. Hydrogen peroxide decomposes into water and oxygen in a first-order process. H2O2(aq) → H2O(2) + 1/2O2(g) At 20.0 °C, the half-life for the reaction is 3.05 x 104 seconds. If the initial concentration of hydrogen peroxide is 0.52 M, what is the concentration after 8.00 days?
23. Given the following experimental data, find the rate law and the rate constant for the reaction: NO (8) + NO2 (g) + O2(g) → N2O(g) Run (NO), M (NO2), M (O2)., M. Initial Rate, Ms? 0.10 M 0.10 M 0.10 M 2.1 x 102 0.20 M 0.10 M 0.10 M 4.2 x 102 - NM + 0.20 M 0.30 M 0.20 M 1.26 x 102 0.10 M 0.10 M 0.20 M 2.1 x 102
A
certain reactant disappears by a first order reaction that has a
rate constant K= 3.5x10^-3 s-1. If the initial concentration of the
reactant is 0.500 M , how long will it take for the concentration
to drop to
0.200 M ?
4. A certain reactant disappears by a first-order reaction that has a rate constant k=3.5 x 10 s. If the initial concentration of the reactant is 0.500 M, how long will it take for the concentration to drop...
Incorrect Question 9 0/2 pts A first order reaction with a k=0.216 (with units expressed in hours). How long in hours, to have 87.5% of the original concentration remaining. Answer to 2 decimal places. 0.62 Partial Question 6 1.5/3 pts The following reaction was run four times: NO(g) + Cl2le) - NOCIE) What is the order of reaction with respect to: NO- 1/2 C12= 1 Solve for the reaction constant (proportionality constant): k= 1.14 X10 -5 (Answer to 2 decimal...
please help. question 62
s is first order in the reac ich reaction is fastest if the reactants are the same? All be reactant abled. -Br₂(g) → and [Br.] ed [NO] The fol reaction ] is increased 14.59. Each of the following reactions is for and second order overall. Which res initial concentrations of the reactants reactions are at 298 K. 2. C10 (8) + O2(g) → CIO(g) + O. = 3.0 X 10-cm/(molecules) b. CIO.(g) + NO(g) → NO2(g)...
26. Hydrogen peroxide decomposes into water and oxygen in a first-order process. H2O2(aq) → H2O(l) + 1/2 O2(g) 26. Hydrogen peroxide decomposes into water and oxygen in a first-order process. H2O2(aq) → H2O(2) + 1/2O2(g) At 20.0 °C, the half-life for the reaction is 3.05 x 104 seconds. If the initial concentration of hydrogen peroxide is 0.52 M, what is the concentration after 8.00 days?
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago