Why is ice-cold water needed to rinse the aspirin product? What will happen if warm water...
Why is ice-cold water needed to rinse the aspirin
product?
What will happen if warm water was used?
Homework Answers
Aspirin is less soluble in water.
Aspirin product is washed with cold water so that the water soluble impurities can be removed.
At lower temperature, the aspirin is very less soluble in water.
If it is dissolved in water at high temperature the solubility slightly increased and the yield of the product is decreased.
Add Answer to:
Why is ice-cold water needed to rinse the aspirin
product?
What will happen if warm water...
Recrystallization Experiment Postlab Questions 1. Calculate the percent recovery of benzoic acid and aspirin. 2. What...
Recrystallization Experiment Postlab Questions 1. Calculate the percent recovery of benzoic acid and aspirin. 2. What are some of the properties of an ideal recrystallization solvent? 3. Why is ice cold solvent used to rinse the purified crystals? 4. If the hot solution were immediately placed in an ice water bath during the recrystallization process instead of first cooling to room temperature, how might this affect the results?
3.2.3 The device shown mixes saturated steam and cold water and produces warm water. The cold...
3.2.3 The device shown mixes saturated steam and cold water and produces warm water. The cold water flows in at 12 kg/s at 50°C. The steam flows in at 0.2 kg/s at 160 C. The resulting water flows out at 60°C. The pressure for all three is a constant 100 kPa. If the pipe out has a 0.03 m diameter, what is the mass flow rate and velocity of the water coming out. Cool feedwater Warm feedaner Ans: 12.2 kg/s,...
An ice cube floats in a beaker of ice cold water. Since the water is ice...
An ice cube floats in a beaker of ice cold water. Since the water is ice cold, the ice cube is not melting and hence its volume is not changing. The density of water and ice are, respectively, ρw = 1,000 kg/m3 and ρi = 917 kg/m3. (Assume one of the ice cube's faces is parallel to the water's surface.) (a) If the ice cube is 17.0 mm on each side, how far below the surface (in mm) is the...
A couple of small ice cubes at 0 °C are added to glass of warm water...
A couple of small ice cubes at 0 °C are added to glass of warm water (mass = 0.255 kg, temperature = 65.9 °C) to cool it. All of the ice melts and the final temperature is measured to be 14.4 °C. What was the mass of the ice used?
1.7 grams of benzoic acid dissolves in 1 liter of water at 0 degrees Celsius 56.3...
1.7 grams of benzoic acid dissolves in 1 liter of
water at 0 degrees Celsius
56.3 grams of benzoic acids dissolves in 1 liter of
water at 100 degrees Celsius
1. Calculate the percent recovery of benzoic acid and aspirin. 2. What are some of the properties of an ideal recrystallization solvent? 3. Why is ice cold solvent used to rinse the purified crystals? 4. If the hot solution were immediately placed in an ice water bath during the recrystallization...
why is it essential to wash the recrystallized material with cold, not warm or hot, solvent?...
why is it essential to wash the recrystallized material with cold, not warm or hot, solvent? What might occur if the wash with cold solvent was omitted?
for this experiment of syntheis of aspirin, was the product obtained pure (based on color)? how...
for this experiment of syntheis of aspirin, was the product
obtained pure (based on color)? how do you know? the color was
white
Experimental Procedure HAZARD: Sulfuric acid, acetic anhydride and glacial acetic acid are corrosive to the skin. They are also irritants, and all operations in which these substances are used should be carried out under the hood. Prepare a hot-water bath by heating a 400-ml beaker containing about 200 mL of water. 1. Use a centigram balance and...
QUESTION 1 Specimens for cold agglutinins must be: A. transported on ice © B. kept warm...
QUESTION 1 Specimens for cold agglutinins must be: A. transported on ice © B. kept warm O C. drawn in a green top tube D. processed in a refrigerated centrifuge QUESTION 2 The fasting specimen for a GTT is drawn at 0700, and the patient finishes drinking the glucola A. 0800 OB. 0815 C. 0845 D. 0915 QUESTION 3 When collecting units of donor blood, the most frequently used needle gauge is: A. 26 B. 23
one of the test tubes will be put in the cold water bath(ice,on scoop of salt...
one of the test tubes will be put in the cold water bath(ice,on scoop of salt and water in a 250ml beaker)for five minutes.one of the test tubes will be put in a 60 degrees celcius warm water bath for 5 minutes.Put all three test tubes in 125 ml erlenmeyer flasks to stand them up,and compare the colors,below is the equillibrium equation that governs the reaction. Bases on this,determine if the reaction is exothermic or endothermic. [Co(H2O)6]2+ +4HCL------[CoCL4]2- + 6h20
Orgo lab formation of ether by sn2 rxn Why is it important to fully cool the...
Orgo lab formation of ether by sn2 rxn
Why is it important to fully cool the product in an ice bath prior to isolation by suction filtration? Why do you need to rinse your product with ice water instead of room temperature water? Based on what you have learned in lecture, what would happen if you used 2-iodo-2-methylpropune as your electrophile in this reaction? Based on what you have learned in lecture, w hat would be the impact of changing...
Recrystallization Experiment Postlab Questions 1. Calculate the percent recovery of benzoic acid and aspirin. 2. What are some of the properties of an ideal recrystallization solvent? 3. Why is ice cold solvent used to rinse the purified crystals? 4. If the hot solution were immediately placed in an ice water bath during the recrystallization process instead of first cooling to room temperature, how might this affect the results?
3.2.3 The device shown mixes saturated steam and cold water and produces warm water. The cold water flows in at 12 kg/s at 50°C. The steam flows in at 0.2 kg/s at 160 C. The resulting water flows out at 60°C. The pressure for all three is a constant 100 kPa. If the pipe out has a 0.03 m diameter, what is the mass flow rate and velocity of the water coming out. Cool feedwater Warm feedaner Ans: 12.2 kg/s,...
1.7 grams of benzoic acid dissolves in 1 liter of
water at 0 degrees Celsius
56.3 grams of benzoic acids dissolves in 1 liter of
water at 100 degrees Celsius
1. Calculate the percent recovery of benzoic acid and aspirin. 2. What are some of the properties of an ideal recrystallization solvent? 3. Why is ice cold solvent used to rinse the purified crystals? 4. If the hot solution were immediately placed in an ice water bath during the recrystallization...
for this experiment of syntheis of aspirin, was the product
obtained pure (based on color)? how do you know? the color was
white
Experimental Procedure HAZARD: Sulfuric acid, acetic anhydride and glacial acetic acid are corrosive to the skin. They are also irritants, and all operations in which these substances are used should be carried out under the hood. Prepare a hot-water bath by heating a 400-ml beaker containing about 200 mL of water. 1. Use a centigram balance and...
QUESTION 1 Specimens for cold agglutinins must be: A. transported on ice © B. kept warm O C. drawn in a green top tube D. processed in a refrigerated centrifuge QUESTION 2 The fasting specimen for a GTT is drawn at 0700, and the patient finishes drinking the glucola A. 0800 OB. 0815 C. 0845 D. 0915 QUESTION 3 When collecting units of donor blood, the most frequently used needle gauge is: A. 26 B. 23
Orgo lab formation of ether by sn2 rxn
Why is it important to fully cool the product in an ice bath prior to isolation by suction filtration? Why do you need to rinse your product with ice water instead of room temperature water? Based on what you have learned in lecture, what would happen if you used 2-iodo-2-methylpropune as your electrophile in this reaction? Based on what you have learned in lecture, w hat would be the impact of changing...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 24 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago