Reaction is--C6H5COOH(aq) = C6H5COO-(aq) + H+(aq)
Initial: 0.375 0 0
Change: -x +x +x
Equilibrium: 0.375-x x x
Ka = [C6H5COO-][H+]/[C6H5COOH]
=> x^2/(0.375-x) = 6.3*10^-5
=> x = 0.004829 M
So, [H+] = x = 0.004829 M
pH = -log[H+] = -log(0.004829) = 2.3
If you have any questions please comment
If you satisfied with the solution please rate it thanks...
Question 5 What is the pH of a 0.375 M solution of benzoic acid? Ka=6.3E-5 11.7...
What is the pH of a 0.0327 M aqueous solution of benzoic acid? Ka (C6H5COOH) = 6.5x10-5
What is the pH of a 0.0717 M aqueous solution of benzoic acid? Ka (C6H5COOH) = 6.5x10-5
33. What is the pH of a 0.75 M Benzoic Acid (HC-H502) solution? We (Ka for Benzoic Acid is 6.4 x 10-5 34. What is the pH of a 0.040 M Pyridine (CsH5N) solution? Kb for Pyridine is 1.7 x 10-9 Weal
What is the concentration of benzoic acid, C.H.COOH if if the solution has a pH of 2.3 ? Benzoic acid (CGHSCOOH) (Ka = 6.3x10-5).
calculate the pH of a 0.30 M solution of benzoic acid (HC7H5O2, Ka = 6.5x10-5)
Question 1 10 pts Calculate the pH of a solution containing 0.375 M hypochlorous acid (Ka = 3.0e-8) combined with 0.25 M calcium hypochlorite.
A buffer solution contains 0.41 mol of benzoic acid (HC7H5O2) and 0.43 mol of sodium benzoate (NaC7H5O2) in 2.50 L. The Ka of benzoic acid (HC7H5O2) is Ka = 6.3e-05. (a) What is the pH of this buffer? pH = (b) What is the pH of the buffer after the addition of 0.16 mol of NaOH? (assume no volume change) pH = (c) What is the pH of the original buffer after the addition of 0.05 mol of HI? (assume...
What is the pH of a 0.1M solution of benzoic acid? ( Write answer to the hundredths place) KA(benzoic acid) = 6.46x10-5
What is the pH of 0.7 mol/L benzoic acid solution? benzoic acid = (C6H5COOH, Ka = 6.6 x 10-5) A. 2.17 B. 11.8 C. 4.34 D. 9.80
Calculate the pH of a 0.496 M aqueous solution of benzoic acid (C6H5COOH, Ka = 6.3×10-5) and the equilibrium concentrations of the weak acid and its conjugate base. pH = _____ [C6H5COOH ]equilibrium = _____M [C6H5COO- ]equilibrium = _____M