UCJION What is the product of the reaction? CH3-CHC-CI+ CH3-NI+CH, CHE ch gra - онлинсь, —...
N 2. Complete the chart: CONDENSED FORMULA STRUCTURAL FORMULA NAME CH,CH2CHCHCH(CH3)2 CHC(CH2)SCH,CI (CH3)3CCHCH(CH2)2CHCH2
16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol heat ? сні -CH2-C-CH OH IV. I CH3 -CH-CACH OHH CHE -CH=C-CH3 сн -CH2-C=CH2 II. V. CH3 -CH2-CH-CH2OH TIL A) B) 11 OC) IV D) v
are these structures chiral or achiral CI CI CH3- C - CH2- CH - CH3 СНЗ ОН ОН
Part A The product of this reaction is CH2-0-C-(CH2)7-CH=CH-(CH2)2-CHz Ni, CH-0C-(CH3)3-CH=CH-(CHỊ)-CH, + 3H, 10 CH2-0-C-(CH2)-CH=CH-(CH2)-CH glyceryl trioleate. e glyceryl tristearate. glyceryl tripalmitate glyceryl tricaprate. Submit Request Answer Provide Feedback
6) What is the product of the following reaction? 1. CHECHE *CI AICI: 2. H₂O A) CH.CH; B) CH.CH.CH ОН Сң CH.CH D) CH-CH2 CHE E) CH-CH:CH OH
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
What is/are the carbonyl product(s) formed when the alcohol below is oxidized with K Cr07 HỌC-CHE-CH, A) HỌC-CHy-c-CH, CH3 -CHE C) HyC-CH2-2-OH D) HC-CH3--CH, then Hyc-CH2-C-OH E) No reaction occurs. O Type here to search HEWLE
For the SN2 reaction, the absolute configuration of the product will be … CH3 CH3 CHE Format - -----C----Br - - C- H + Br Br H3C(H2C) (CH2)CH3 (CH2)SCH3 (The representation of the product is not a Fischer proejection and is not meant to indicate anything about stereochemistry.) The product is not chiral. OS OR The stereochemistry of the product cannot be predicted. 50% R and 50% S
Section: 17-14 63. Give the major product for the reaction. Justify your answer. 1. CH, CHECHE CH2CH3 CHC осн; 2. HCI excess B) A) C) OO DO DEO CH,CHE CH2CH2 CH:CHE CHCH3 CH, CH2 CHCH CH CH:09 OH CHO D) E) OH =O CH CH3 CH,CHE CHCH CH,CHE CHO O CHO “Η