CH2-O-C-(CH2) 14CH3 O CH-O-C-(CH2)7-g=-(CH2),CH3 + 3H2 POR CH2-O-C-(CH2)-=9-CH2-9 9-(CH2); CH3 Show the product or products of...
Question 7 What is the major product of the reaction shown below? H+ CH3-CH2-CH=CH2 + HOH A) OH OH CH3 - CH2 -CH-CH2 B) OH | CH3 - CH2 -CH-CH3 OH OH CH3 -CH-CH - CH3 D) OH CH3 - CH2 -C=CH2 Choice A Choice B Choice C Choice D
answer the problem show work thanks CH3 H2O + 1. H-C-CH-CH-CH2 CH3 CH C 2, CHy-CH2-CH-CHOHPCC 25°C 50-55°C + HNO H2SO4 он H2CrO4 CH,CHCH acetone, 35°c Et O 2150113H20 5. CH3(CH2)2MgBr+ CH3(CH2)sC(CH2)sCH3 Nall CH2-CHCH2l H2SO4 140°C 6. CH3CH2CH2OH 7. CHCH CHOH 1) LiAIH(O-t-Bu)3,-78°C 2) H20 8. CH,C-CI HBr 9. CH2 CH-CH-CH2 40°C 10. H3C CIH2 Benzene 100℃ H3C 1. LiAIH/Et2O 11. CH,CH2CH,COH 2. H,0 12. + CH,CH,cCI AIC Benzene, 80°C 13. Br2 heat CH3 AlcI 15. 25°C conc. H2SO4 NaBH4...
Part A The product of this reaction is CH2-0-C-(CH2)7-CH=CH-(CH2)2-CHz Ni, CH-0C-(CH3)3-CH=CH-(CHỊ)-CH, + 3H, 10 CH2-0-C-(CH2)-CH=CH-(CH2)-CH glyceryl trioleate. e glyceryl tristearate. glyceryl tripalmitate glyceryl tricaprate. Submit Request Answer Provide Feedback
CH2-0-CO-(CH2)10-CH3 | CH-O-CO-(CH2)10-CH3 | CH2-0-CO-(CH2)10-CH3 part-C Write the condensed structural formula(s) of the Products formed & identify the type of reaction taking place when the given Structure reacts with water in the presence of an enzyme. part-D Write the condensed structural formula(s) of the Products formed & identify the type of reaction taking place when the given Structure reacts with potassium hydroxide in the presence of an enzyme.
Classify each of the following organic reactions. Addition CH3-CH2-CH-CH3 – CH3-CH2-CH=CH2 + HCI CH3-C-O-CH3 + CH3-NH-CH3-C-NH-CH3 + CH2-OH CH3-CH2-CH2-OH + HBr -- CH3-CH2-CH2-Br + H20 Elimination OH CH2-CH + HCN – CH3-CH-CN CH3-CH=CH-CH3 + HBr + CH3-CH-CH2-CH3 Br Substitution CH3-CH2-CH2-CH3 + Cl2 → CH-CH2-CH2-CH3 + HCI СІ CH3-CH=CH-CH3 + Cl2 - CH3-CH-CH-CH3 CICI Reset
What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3 CH3 -CH2-C-CH3 -CH-¢- I. IV. OH CH3 -CH2-C=CH2 OH H CH -CH=C-CH3 II. V. CH3 -CH2-CH-CH2OH -CH II. OT OI O III O TV OV
I need the mechanism for this Fischer Esterification CH3 Reaction CH3 H+ CH3-C-OH HO-CH2-CH2-CH-CHCHz-C-O-CH2-CH2-CH-CHaH20 Name Acetic acid Isopentyl alcoho H2SO Isopentyl acetatewater
What is the correct product for the following addition reaction: CH3-C=CH2 + Brz CH₃ Br-CH2-CH-CH -Br CH; Br Br CH3-C=C
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
Part D CH2= CH- CH2 o CH CH, CH, c=o c=o =O c=o CEO CH2 CH2 CH2 CH CH2 CH2 CH2 CH2 CH2CH2CH2 CH2 CH2 CH CH2 CH2 CH2CH2 CH2CH2CH2 Сн, СН, Сн, CH2 CH2 Сн, Сн, сн, CH2 CH2 CH2 CH, CH, CH2 CH, CH, CH, CH2CH2CH2 CH3 CH3 CH3 CH O a steroid. a glycolipid. O a lipoprotein O a saturated triglyceride. This molecule is an unsaturated triglyceride O a saturated fatty acid. an unsaturated fatty acid. O...