lructions Ondus LockDown! Question 19 Which of the following represents an acid-base neutralization reaction? SO2(g) +...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S B) HI C) HBr D) H2SO4 E) HCIO 2. Identify the major ionic species present in an aqueous solution of H2SO4. A) S6, 036-(plus H2O as a neutral species) B) H', OH, 56,302- C) 2H, 56, 402- D) H', HS04 E) 24*, SO42- 3. Which of the following represents an acid-base neutralization reaction? A) 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g) B) SO2(g) +...
9. Based on the solubility rules, which one of the following compounds should be insoluble in water? A) Na SO B) BaSO C) CuSO. D) MgSO E) Rb SO 10. Identify the reducing agent in the following chemical reaction. Cd + NiO2 + 2H2O → Ca(OH)2 + Ni(OH)2 A) Cd B) NiO2 c) H2O D) Ca(OH)2 E) Ni(OH)2 11. The oxidation number of Cl in CIO, is A) -1 B) +7 C) +5 D) +3 E) None of the above....
can you please explain the answers
9. Based on the solubility rules, which one of the following compounds should be insoluble in water? A) Na2SO4 B) BaSO4 C) CuSO4 D) MgSO4 E) Rb2SO4 10. Identify the reducing agent in the following chemical reaction. Cd + NiO2 + 2H2O → Ca(OH)2 + Ni(OH)2 A) Cd B) Ni02 C) HO D) Ca(OH)2 E) Ni(OH)2 11. The oxidation number of Cl in CIO3 is A) -1 B) +7 D) +3 E) None of...
Question 5 4 pts Which of the following is an oxidation-reduction reaction? OKOH + HNO3 H20() + KNO3 Al2(SO4)3 +6KOH — 2Al(OH)3(g) + 3K2504 O CaCl2 + Na2S04 - CaSO4(s) + 2Nacı O AgNO3 + NaCl – AgCl (s)+ NaNO3 ON2(8) + O2(g) + 2NO(g)
Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s)+3H2SO4(aq)-----=Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 14.9g . What minimum mass of H2SO4 would you need? What mass of H2 gas would be produced by the complete reaction of the aluminum block? Express your answer in grams.
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
CHEM 1411. Review Exercises for Chapter 3, 7, 8. F19 1. Give the number of lone pairs around the central atom and the geometry of the ion CIO2 A) 0 lone pairs, linear 1 lone pair, bent B) C) 2 lone pairs, bent D) 3 lone pairs, bent E) 3 lone pairs, linear 2. Predict the geometry and polarity of the CS2 molecule. A) linear, polar B) linear, nonpolar C) tetrahedral, nonpolar D) bent, nonpolar E) bent, polar 3. Which...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...