Homework Answers
Add Answer to:
For Part A of the Equilibrium experiment, you will be preparing several standard solutions for the...
Bienvenido a Trip.com In Part 1 of the lab you will make the following four solutions:...
Bienvenido a Trip.com In Part 1 of the lab you will make the following four solutions: About 3221 Solution Number 0.500 M Fe3+ 3.00 x 10-4 M SCN' water 2.50 mL 2.50 ml 2.50 mL 2.00 mL 0.50 mL 2.50 mL 1.50 mL 1.00 mL 2.50 mL 1.00 mL 1.50 mL 0 mL Given the data in the table above, determine the initial concentrations of [Fe3+] and [SCN"). Since one of the reactants is in excess, you can determine (FeSCN2+Jeg...
Table A. Preparation of Standard solutions of FeSCN2+ 1.0 M HNO3 0.002 M 0.200 M Solution...
Table A. Preparation of Standard solutions of FeSCN2+ 1.0 M HNO3 0.002 M 0.200 M Solution KSCN (mL) Fe(NO3)3 (mL) 0.5 5 [FeSCN2+] (mol/L)* 1 4.0x10^-5 Add 1.0 M 2 1.0 5 8.0x10^-5 HNO3 3 1.5 5 1.2x10^-10 4 2.0 5 1.6x10-4 to each to adjust the volume to 25 mL. 5 2.5 5 2.0x10-4 * Calculate the concentrations of FeSCN2+ in each beaker, assuming that all SCN-ions exist as FeSCN2+. In other words, [FeSCN2+] (in Soln 1) = [SCN-]...
4. Calculate the initial concentrations of Fe3+ and SCN? in each of the equilibrium mixtures you...
4. Calculate the initial concentrations of Fe3+ and SCN? in each of the equilibrium mixtures you will prepare using the information in Table 2 Volume of delonged water (ml) Total volume ml) Table 2. Preparation of Equilibrium Mixtures Volume of Volume of Volume of 0.10 M Mixture 0.00200 M 0.00200 M HNO, (ml) KSCN (ML) Fe(NO3)3 (ml) 1,50 3.00 1.00 2.00 1.00 2.50 1.00 1.50 350 1.00 1.00 2.50 2.00 4.50 4.50 4.50 4.50 4.50 10.00 10.00 10.00 10.00 10.00...
5. In this experiment, you will prepare a standard solution for a calibration curve for the...
5. In this experiment, you will prepare a standard solution for a calibration curve for the formation of FeSCN2 complex by reaction different volumes of 0.2 M Fe(NO,), and 0.002 M NaSCN. You will use 0.05M HNO, for all dilutions. Using the table, Calculate the equilibrium concentrations of FeSCN2 Vol of Fe Vol of SCN 0.1 M HNO Equilibrium concentration Fe[SCN]2' (mL) (mL.) (mL) 10.00 0.00 10.00 10.00 1.00 9.00 10.00 2.00 8.00 10.00 3.00 7.00 10.00 4.00 6.00 10.00...
For each equilibrium sample, calculate the initial concentrations (assuming no reaction occurred)...
For each equilibrium sample, calculate the initial
concentrations (assuming no reaction occurred) of SCN–
and Fe3+ based on the dilution factors used.
Enter the absorbance values for each sample.
For the standard solution, assume that, when equilibrium is
reached, the [FeSCN2+]eq is equal to
[SCN–]ini. Why is this a good
assumption?
For the equilibrium solutions, calculate the
[FeSCN2+]eq (Ceq) using Eq.
4.
Using Eq. 5 and 6, calculate
[Fe3+(aq)]eq and
[SCN–(aq)]eq for each equilibrium
solution.
Calculate values for the equilibrium...
1) Consider the following equilibrium: Fe3+(aq) + SCN-(aq) ⇌ FeSCN2+(aq) Initial concentrations: [Fe3+] = 0.590; [SCN-]...
1) Consider the following equilibrium: Fe3+(aq) + SCN-(aq) ⇌ FeSCN2+(aq) Initial concentrations: [Fe3+] = 0.590; [SCN-] = 1.239; [FeSCN2+] = 0 The equilibrium concentration of [FeSCN2+]eq = 0.454 M. What is the numerical value of KC for this equilibrium? KC = __________________ 2) Consider the following equilibrium: Fe3+(aq) + SCN-(aq) ⇌ FeSCN2+(aq) Initial concentrations: [Fe3+] = 0.370; [SCN-] = 0.777; [FeSCN2+] = 0 The equilibrium concentration of [FeSCN2+]eq = 0.285 M. What is the equilibrium concentration of Fe3+? [Fe3+]eq =...
Use the following procedure for answering questions given below: 3.00 mL of 2.00 x 10' M...
Use the following procedure for answering questions given below: 3.00 mL of 2.00 x 10' M solution of Fe(NO3)3 was mixed with 4.00 mL of 2.5 x 10-3 M solution of KSCN and 1.00 mL of 0.5M HNO3. After equilibrium: Fe3+ + SCN FeSCN2+ = was established the equilibrium concentration of FeSCN2+ ions was read from the calibration curve as 5.00 x 10-4 M. 01. The initial concentration of Fe3+ ions (assuming no reaction took place) was: [20] a) 1.00...
A student made solution #3 using the experimental method in this lab, and measured an absorbance of 0.559. The starting...
A student made solution #3 using the experimental method in this
lab, and measured an absorbance of 0.559. The starting reagents are
2.00 x 10-3 M Fe(NO3)3 and 2.00 x
10-3 M KSCN.
The amount of absorption is proportional to the concentration
of
FeSCN2+. This relationship – true for many solutions – is called
“Beer’s Law”, and has the simple equation:
A = bc
where “A” is the absorption, “b” is 5174.6 for FeSCN2+ and “c”
is molarity
Make Five...
Beers law solve for E3 and E4 showing work Part II. Equilibrium Constant Calculations Calculate the...
Beers law solve for E3 and E4 showing work
Part II. Equilibrium Constant Calculations
Calculate the initial moles of Fe3+ and SCN- for solutions E2
through E6 and record these values in the table on your Data Sheet.
You obtain the moles of the reactants by multiplying their molarity
by the volume (in L) of their solution used.
Determine the equilibrium concentration of FeSCN2+ for each of
the solutions E2-E6 from your Beer’s Law plot. Using these
equilibrium concentrations, the...
Consider the following: A student mixes 5.00 mL 2.00 × 10−3 M Fe(NO3)3 with 3.00 mL...
Consider the following: A student mixes 5.00 mL 2.00 × 10−3 M Fe(NO3)3 with 3.00 mL 2.00 × 10−3 M KSCN. She finds that in the equilibrium mixture the concentration of FeSCN2+ is 1.28 × 10−4 M. Find Kc for the reaction Fe3+(aq) + SCN−(aq) ↔ FeSCN2+(aq). a. What is the initial concentration of Fe3+ in the reaction mixture? [Fe3+] = ___ x 10-3 M b. What is the initial concentration of SCN- in the reaction mixture? [SCN-] = ___...
Bienvenido a Trip.com In Part 1 of the lab you will make the following four solutions: About 3221 Solution Number 0.500 M Fe3+ 3.00 x 10-4 M SCN' water 2.50 mL 2.50 ml 2.50 mL 2.00 mL 0.50 mL 2.50 mL 1.50 mL 1.00 mL 2.50 mL 1.00 mL 1.50 mL 0 mL Given the data in the table above, determine the initial concentrations of [Fe3+] and [SCN"). Since one of the reactants is in excess, you can determine (FeSCN2+Jeg...
Table A. Preparation of Standard solutions of FeSCN2+ 1.0 M HNO3 0.002 M 0.200 M Solution KSCN (mL) Fe(NO3)3 (mL) 0.5 5 [FeSCN2+] (mol/L)* 1 4.0x10^-5 Add 1.0 M 2 1.0 5 8.0x10^-5 HNO3 3 1.5 5 1.2x10^-10 4 2.0 5 1.6x10-4 to each to adjust the volume to 25 mL. 5 2.5 5 2.0x10-4 * Calculate the concentrations of FeSCN2+ in each beaker, assuming that all SCN-ions exist as FeSCN2+. In other words, [FeSCN2+] (in Soln 1) = [SCN-]...
4. Calculate the initial concentrations of Fe3+ and SCN? in each of the equilibrium mixtures you will prepare using the information in Table 2 Volume of delonged water (ml) Total volume ml) Table 2. Preparation of Equilibrium Mixtures Volume of Volume of Volume of 0.10 M Mixture 0.00200 M 0.00200 M HNO, (ml) KSCN (ML) Fe(NO3)3 (ml) 1,50 3.00 1.00 2.00 1.00 2.50 1.00 1.50 350 1.00 1.00 2.50 2.00 4.50 4.50 4.50 4.50 4.50 10.00 10.00 10.00 10.00 10.00...
5. In this experiment, you will prepare a standard solution for a calibration curve for the formation of FeSCN2 complex by reaction different volumes of 0.2 M Fe(NO,), and 0.002 M NaSCN. You will use 0.05M HNO, for all dilutions. Using the table, Calculate the equilibrium concentrations of FeSCN2 Vol of Fe Vol of SCN 0.1 M HNO Equilibrium concentration Fe[SCN]2' (mL) (mL.) (mL) 10.00 0.00 10.00 10.00 1.00 9.00 10.00 2.00 8.00 10.00 3.00 7.00 10.00 4.00 6.00 10.00...
For each equilibrium sample, calculate the initial
concentrations (assuming no reaction occurred) of SCN–
and Fe3+ based on the dilution factors used.
Enter the absorbance values for each sample.
For the standard solution, assume that, when equilibrium is
reached, the [FeSCN2+]eq is equal to
[SCN–]ini. Why is this a good
assumption?
For the equilibrium solutions, calculate the
[FeSCN2+]eq (Ceq) using Eq.
4.
Using Eq. 5 and 6, calculate
[Fe3+(aq)]eq and
[SCN–(aq)]eq for each equilibrium
solution.
Calculate values for the equilibrium...
Use the following procedure for answering questions given below: 3.00 mL of 2.00 x 10' M solution of Fe(NO3)3 was mixed with 4.00 mL of 2.5 x 10-3 M solution of KSCN and 1.00 mL of 0.5M HNO3. After equilibrium: Fe3+ + SCN FeSCN2+ = was established the equilibrium concentration of FeSCN2+ ions was read from the calibration curve as 5.00 x 10-4 M. 01. The initial concentration of Fe3+ ions (assuming no reaction took place) was: [20] a) 1.00...
A student made solution #3 using the experimental method in this
lab, and measured an absorbance of 0.559. The starting reagents are
2.00 x 10-3 M Fe(NO3)3 and 2.00 x
10-3 M KSCN.
The amount of absorption is proportional to the concentration
of
FeSCN2+. This relationship – true for many solutions – is called
“Beer’s Law”, and has the simple equation:
A = bc
where “A” is the absorption, “b” is 5174.6 for FeSCN2+ and “c”
is molarity
Make Five...
Beers law solve for E3 and E4 showing work
Part II. Equilibrium Constant Calculations
Calculate the initial moles of Fe3+ and SCN- for solutions E2
through E6 and record these values in the table on your Data Sheet.
You obtain the moles of the reactants by multiplying their molarity
by the volume (in L) of their solution used.
Determine the equilibrium concentration of FeSCN2+ for each of
the solutions E2-E6 from your Beer’s Law plot. Using these
equilibrium concentrations, the...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago