A. Prove that Km equals the substrate concentration at ½ Vmax . (Show solution) B. Why...
A. Prove that Km equals the substrate concentration at ½ Vmax .
(Show solution)
B. Why do structural analogs if the transition-state intermediate of an enzyme inhibit the enzyme competitively and with low Ki values (binds tightly)?
Homework Answers
![MICHAELIS-MENTEN KINETICS AND THE STEADY STATE Review Enzymes make reactions Golfastes. E+s 1ES 23 E+ P Rate = k, [E] [s) Rat](http://img.homeworklib.com/questions/b4218e20-e1eb-11eb-9ff9-03d19193510b.png?x-oss-process=image/resize,w_560)
Add Answer to:
A. Prove that Km equals the substrate concentration
at ½ Vmax .
(Show solution)
B. Why...
3. Why is an allosteric enzyme more sensitive to substrate concentration around Km values than a...
3. Why is an allosteric enzyme more sensitive to substrate concentration around Km values than a Michaelis-Menten enzyme with the same Vmax? 4. Explain how pH and temperature influence enzyme activity. ( A Lineweaver-Burk (double reciprocal) plot was used to compare the effects of three different reversible inhibitors (A, B and C) on an enzyme. The plot of 1/V vs 1/[S] for the enzyme with no inhibitor is shown in a solid black line. The plot of 1/V vs 1/[S]...
Km is: A. the concentration of an inhibitor needed to give 1/2 Vmax B. a measure...
Km is: A. the concentration of an inhibitor needed to give 1/2 Vmax B. a measure of the rate of product formation C. related to the affinity of the enzyme for its substrate D. a measure of the activation energy of the enzyme-catalyzed reaction E. the velocity equal to one-half of the maximum velocity
112 marks] 3. The relationship between initial velocity (V.) and substrate concentration of most of the...
112 marks] 3. The relationship between initial velocity (V.) and substrate concentration of most of the enzyme- catalized reactions are explained by Michaelis-Menten equation. IMPORTANT: Show the calculations and indicate the units for all your answers. a. For an enzyme which follows the Michaelis-Menten enzyme kinetics, Km is 50 mmol L. Calculate the substrate concentration required to obtain the initial velocity (V.) equivalent to 90% of the maximum velocity (Vmax). b. The Vmax of the above reaction is 250 mmol...
Sodium azide is known to inhibit Cytochrome c Oxidase. Using sodium azide at a concentration of...
Sodium azide is known to inhibit Cytochrome c Oxidase. Using sodium azide at a concentration of 2 µM, you run an enzyme assay. After careful data analysis, you determine the following values. Vmax = 50 µM/sec Vmax(app) = 50 µM/sec Km = 6 µM Km (app) = 18 µM Determine the type of inhibition present. Calculate the associated Ki(a), and (or) Ki(b), if applicable. Show your work.
a. what are the values of Vmax and Km in the abscence if the inhibitor what...
a. what are the values of Vmax and Km in the abscence if the
inhibitor what are the values of Vmax and Km in the presence of the
inhibitor?
b. what type of inhibition is it?
c. what is the dissociation constant (Ki) of the
inhibition?
***d. graph a linear scatter plot including equation.
Homework (CHE 407) The initial velocity for an enzyme-catalyzed reaction is measured at various initial substrate concentration [S]o, in the absence and in the presence of...
Rodrigo is an enzyme engineer. He wants to know which of four peptide substrates is bound...
Rodrigo is an enzyme engineer. He wants to know which of four peptide substrates is bound most tightly by his engineered enzyme. Which value should he measure and pay attention to? Km KCAT Vo Both A and B kcat, [S], and [E]t Rodrigo's enzyme was assayed with three substrates (A, B, and C). The SAME enzyme concentration used was for each of the three reactions. The results of the three experiments are plotted as Lineweaver-Burke plots below. Considering what you...
6. What does a buffer do? Why are bicarbonate and phosph Henderson Hasselbalch equation to calculate...
6. What does a buffer do? Why are bicarbonate and phosph Henderson Hasselbalch equation to calculate pH if pKa i ate really good biological buffers? Use the s 4.0, [A-1-10μΜ, and [HA-1000μΜ 7. In what eukaryotic cell structure (cytosol, nucleus, mitochondrion, inner mitochondrial membrane, rough ER, smooth ER, plasma membrane etc.) do the following functions take place? Transcription Translation (2 sites) Glycolysis Kreb's Cycle Electron transport chain AG, of a reaction is +11,600 The standard J/mol. What is K at...
Based on the document below, 1. Describe the hypothesis Chaudhuri et al ids attempting to evaluate;...
Based on the document below,
1. Describe the hypothesis Chaudhuri et al ids attempting to
evaluate; in other words, what is the goal of this paper? Why is he
writing it?
2. Does the data presented in the paper support the hypothesis
stated in the introduction? Explain.
3.According to Chaudhuri, what is the potential role of thew
alkaline phosphatase in the cleanup of industrial waste.
CHAUDHURI et al: KINETIC BEHAVIOUR OF CALF INTESTINAL ALP WITH PNPP 8.5, 9, 9.5, 10,...
The budget surplus trap — why it may prove elusive By business editor Ian Verrender Posted...
The budget surplus trap — why it may prove elusive By business editor Ian Verrender Posted 23 Sep 2019, 4:25am Josh Frydenberg gestures during a press conference. PHOTO: Treasurer Josh Frydenberg announced an end to a decade of deficits on Thursday. (ABC News: Tamara Penniket) RELATED STORY: Balanced budget means the Government is 'working against' the Reserve Bank's efforts to boost the economyRELATED STORY: Budget comes in $13.8 billion better off than first projectedRELATED STORY: 'How'd you go broke? Slow...
biochemistry if you could please help me answer the following questions! EFT i 11) (6 pts)...
biochemistry
if you could please help me answer the following questions!
EFT i 11) (6 pts) Which types of symmetry are possible for a protein with six (6) identical subunits? (Select all correct answers) a) cyclic C b) cyclic C3 c) dihedral D2 d) dihedral D e) octahedral o f) icosahedral ро, Yo₂ - pO₂+ Pso 12) (6 pts) What is the fractional saturation of oxygen binding to myoglobin when the partial pressure of oxygen is 1.5 torr and dissociation...
3. Why is an allosteric enzyme more sensitive to substrate concentration around Km values than a Michaelis-Menten enzyme with the same Vmax? 4. Explain how pH and temperature influence enzyme activity. ( A Lineweaver-Burk (double reciprocal) plot was used to compare the effects of three different reversible inhibitors (A, B and C) on an enzyme. The plot of 1/V vs 1/[S] for the enzyme with no inhibitor is shown in a solid black line. The plot of 1/V vs 1/[S]...
112 marks] 3. The relationship between initial velocity (V.) and substrate concentration of most of the enzyme- catalized reactions are explained by Michaelis-Menten equation. IMPORTANT: Show the calculations and indicate the units for all your answers. a. For an enzyme which follows the Michaelis-Menten enzyme kinetics, Km is 50 mmol L. Calculate the substrate concentration required to obtain the initial velocity (V.) equivalent to 90% of the maximum velocity (Vmax). b. The Vmax of the above reaction is 250 mmol...
a. what are the values of Vmax and Km in the abscence if the
inhibitor what are the values of Vmax and Km in the presence of the
inhibitor?
b. what type of inhibition is it?
c. what is the dissociation constant (Ki) of the
inhibition?
***d. graph a linear scatter plot including equation.
Homework (CHE 407) The initial velocity for an enzyme-catalyzed reaction is measured at various initial substrate concentration [S]o, in the absence and in the presence of...
Rodrigo is an enzyme engineer. He wants to know which of four peptide substrates is bound most tightly by his engineered enzyme. Which value should he measure and pay attention to? Km KCAT Vo Both A and B kcat, [S], and [E]t Rodrigo's enzyme was assayed with three substrates (A, B, and C). The SAME enzyme concentration used was for each of the three reactions. The results of the three experiments are plotted as Lineweaver-Burke plots below. Considering what you...
6. What does a buffer do? Why are bicarbonate and phosph Henderson Hasselbalch equation to calculate pH if pKa i ate really good biological buffers? Use the s 4.0, [A-1-10μΜ, and [HA-1000μΜ 7. In what eukaryotic cell structure (cytosol, nucleus, mitochondrion, inner mitochondrial membrane, rough ER, smooth ER, plasma membrane etc.) do the following functions take place? Transcription Translation (2 sites) Glycolysis Kreb's Cycle Electron transport chain AG, of a reaction is +11,600 The standard J/mol. What is K at...
Based on the document below,
1. Describe the hypothesis Chaudhuri et al ids attempting to
evaluate; in other words, what is the goal of this paper? Why is he
writing it?
2. Does the data presented in the paper support the hypothesis
stated in the introduction? Explain.
3.According to Chaudhuri, what is the potential role of thew
alkaline phosphatase in the cleanup of industrial waste.
CHAUDHURI et al: KINETIC BEHAVIOUR OF CALF INTESTINAL ALP WITH PNPP 8.5, 9, 9.5, 10,...
biochemistry
if you could please help me answer the following questions!
EFT i 11) (6 pts) Which types of symmetry are possible for a protein with six (6) identical subunits? (Select all correct answers) a) cyclic C b) cyclic C3 c) dihedral D2 d) dihedral D e) octahedral o f) icosahedral ро, Yo₂ - pO₂+ Pso 12) (6 pts) What is the fractional saturation of oxygen binding to myoglobin when the partial pressure of oxygen is 1.5 torr and dissociation...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 2 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 59 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago