What might early life forms used for genetic carriers and for catalyzing reactions? the early life...
Homework Answers
Answer:- The earliest evidence of life on earth comes from fossils discovered in western australia that date back to about 3.5 billion years ago. The fossils are of structures known as stromatolites which are in many cases formed by the growth of layer upon layer of single celled microbes such as cyanobacteria. The earliest fossils, the most commonly accepted location of root of tree of life is between is between a monophyletic domain bacteria and a clade formed by archae and eukaryota of what is referred to as traditional tree of Life based on several molecular studies. Bacteria are relatively complex suggesting that earth evolved around 4.5 billion years ago.
Add Answer to:
What might early life forms used for genetic carriers and for
catalyzing reactions?
the early life...
1.what advantage does PGD offer over genetic testing of the fetus? 2. PGD is used primarily...
1.what advantage does PGD offer over genetic testing of the fetus? 2. PGD is used primarily to look for embryos that have an abnormal chromosome that is known from a parent or to look for large chromosome structural abnomalities. True or false ? 3. For PGD, embryonic DNA information can be obtained by removing maetrial from the polar body, an early cleavage stage, or from the outer ring of the blastocyst. Using the blastocyst is the newest method, and it...
3. A patient is passing feces that are chalky white in color. What problems might this indicate? Give the genetic disor...
3. A patient is passing feces that are chalky white in color. What problems might this indicate? Give the genetic disorder associated with this condition. 4. A clinical challenge -Certain groups of individuals lack the normal flora of bacteria in their intestines. a. What 2 groups would have such a problem? b. Name one sign or symptom resulting from inadequate bacterial synthesis of Vitamin K.
3. A patient is passing feces that are chalky white in color. What problems might...
What methods of communication might be used in an early childhood education and care facility to...
What methods of communication might be used in an early childhood education and care facility to share information about a child’s progress? List six.
2. Particle Dark Matter (a) What is a WIMP? How might they originate in the Early...
2. Particle Dark Matter (a) What is a WIMP? How might they originate in the Early Universe? Why are these good candidates for dark matter? (b) What are examples of experiments to detect WIMPs? Why are they located underground (or under mountains)? What signal would the dark matter create in a WIMP detector? (c) What is the current status of WIMP experiments? That is, what results do we already have? What controversies exist among the competing experiments?
Part 1: Make a T-chart showing the positive and negative aspects of personal genetic testing. [4...
Part 1: Make a T-chart showing the positive and negative aspects of personal genetic testing. [4 pts] Part 2: Answer the following questions. You decide to have genetic testing completed on you and your partner prior to having children. You find out that you and your partner are both carriers of Cystic Fibrosis. Show your Punnett square below. (NOTE: CF is not a sex-linked trait) How could you use the information given to you by the geneticist to make an...
could somebody pleas help me with these 3 questions? thank you! 2. Research into the origins...
could somebody pleas help me with these 3 questions? thank
you!
2. Research into the origins of life on Earth is based on laboratory observations that mimic hypothesized conditions on early earth. Which of the following has not been observed in laboratory experiments? A. Spontaneous formation of amino acids, simple sugars, and nucleotides from abiotic components B. Reactions catalyzed by RNA molecules isolated from pre-existing cells C. Spontaneous formation self-replicating RNA molecules from abiotic components D. Spontaneous formation of membranes...
B1. Mitosis and Meiosis a) What are the similarities and differences between meiosis I and mitosis?...
B1. Mitosis and Meiosis a) What are the similarities and differences between meiosis I and mitosis? b) What are the differences between binary fusion and mitosis? c) Mention the differences between Prophase in Mitosis and Prophase in Meiosis 1. [10 Marks] B2. Prokaryotic and Eukaryotic Cells a) An organism consists of ribosome, cytoplasm, cell wall, cell membrane and a nucleoide. What type of cell is it? [1 mark] b) Name one feature Prokaryotic and Eukaryotic cells have in common? [1...
Question 1 What might a proponent of evolutionary medicine hypothesize about psychological disorders, such as anxiety an...
Question 1 What might a proponent of evolutionary medicine hypothesize about psychological disorders, such as anxiety and obsessive compulsive disorder (OCD)? OCD likely results from an evolutionary mismatch between psychological traits that were adaptive in hunter gatherer society but cause stress in modern society OCD likely results from a maladaptive psychological trait that would have led to an early death in hunter gatherer society OCD is likely to be an adaptive trait in both hunter gatherer society and in modern...
Question 1 What might a proponent of evolutionary medicine hypothesize about psychological disorders, such as anxiety...
Question 1 What might a proponent of evolutionary medicine hypothesize about psychological disorders, such as anxiety and obsessive compulsive disorder (OCD)? OCD likely results from an evolutionary mismatch between psychological traits that were adaptive in hunter gatherer society but cause stress in modern society OCD likely results from a maladaptive psychological trait that would have led to an early death in hunter gatherer society OCD is likely to be an adaptive trait in both hunter gatherer society and in modern...
1. The protein has been used to increase insect-resistance in plants. What is the origin of...
1. The protein has been used to increase insect-resistance in plants. What is the origin of the Bt protein? a. European corn borer b. Agrobacterium c. Transgenic Bt corn d. Bacillus thuringiensis 2. When ingested, the Bt protein is not toxic to humans because: a. Humans produce antibodies against Bt b. Human saliva breaks down the Bt toxin c. The human blood circulatory system gets rid of the Bt toxic d. Humans do not have Bt receptors in their digestive...
3. A patient is passing feces that are chalky white in color. What problems might this indicate? Give the genetic disorder associated with this condition. 4. A clinical challenge -Certain groups of individuals lack the normal flora of bacteria in their intestines. a. What 2 groups would have such a problem? b. Name one sign or symptom resulting from inadequate bacterial synthesis of Vitamin K.
3. A patient is passing feces that are chalky white in color. What problems might...
2. Particle Dark Matter (a) What is a WIMP? How might they originate in the Early Universe? Why are these good candidates for dark matter? (b) What are examples of experiments to detect WIMPs? Why are they located underground (or under mountains)? What signal would the dark matter create in a WIMP detector? (c) What is the current status of WIMP experiments? That is, what results do we already have? What controversies exist among the competing experiments?
could somebody pleas help me with these 3 questions? thank
you!
2. Research into the origins of life on Earth is based on laboratory observations that mimic hypothesized conditions on early earth. Which of the following has not been observed in laboratory experiments? A. Spontaneous formation of amino acids, simple sugars, and nucleotides from abiotic components B. Reactions catalyzed by RNA molecules isolated from pre-existing cells C. Spontaneous formation self-replicating RNA molecules from abiotic components D. Spontaneous formation of membranes...
B1. Mitosis and Meiosis a) What are the similarities and differences between meiosis I and mitosis? b) What are the differences between binary fusion and mitosis? c) Mention the differences between Prophase in Mitosis and Prophase in Meiosis 1. [10 Marks] B2. Prokaryotic and Eukaryotic Cells a) An organism consists of ribosome, cytoplasm, cell wall, cell membrane and a nucleoide. What type of cell is it? [1 mark] b) Name one feature Prokaryotic and Eukaryotic cells have in common? [1...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago