Homework Answers
4 ) Solution :
a )Chlorophyll is mainly a green color pigment which is responsible for the plants to appear in green color . Chlorophyll is mainly present in Chloroplast cell organel . Chlorophyll absorbs red light from the sun in long wavelength and blue color with short wavelength and reflects the green color . Chlorophyll A is the most abundant pigments in plants . Chlorophyll a absorbs light with wavelengths of 430nm(blue) and 662nm(red) .chlorophyll B has the highest absorption at 450 nm (blue) and 640 nm (red) in their spectrum.
b ) Chlorophyll plays a major role in photosynthesis by absorbing energy from light. During photosynthesis occurance in a chloroplast of a thin-walled mesophyll cell and a 4-carbon acid is handed off to a thick-walled bundle sheath cell where the Calvin cycle occurs in a chloroplast of that second cell. This protects the Calvin cycle from the effects of photorespiration.
Add Answer to:
4. a) Why is chlorophyll green? (Discuss this in terms of wavelengths of light these pigments...
can someone answer these please!! I NEED HELP!! Of the following events from the light reactions...
can someone answer these please!! I NEED HELP!!
Of the following events from the light reactions of photosynthesis, which would be expected to occur first? While being split, electrons are taken out of water. Acceptance of electrons by Pc from the cytochrome complex Donation of electrons from reduced Pq to the cytochrome complex Light-induced reduction of the primary elecetron acceptor in the reaction center of PS Il takes place. Question 2 (2 points) The following figure depicts the absorption spectra...
Chlorophyll a Absorption Spectrum of Visible Light Absorption of light (%) Which of the following wavelengths...
Chlorophyll a Absorption Spectrum of Visible Light Absorption of light (%) Which of the following wavelengths of light are not absorbed by chlorophyll a to power photosynthesis? Check all that apply. 430 nm 660 nm 530 nm 400 450 500 550 600 Wavelength (nm) 650 700 wavelength (nm) In a laboratory experiment, you take three plants and put them each under a lamp that mimics sunlight. You have three colored light filters that fit over each of the lamps: a...
can yall please help me figure out these questions 1-10? PLEASE I NEED HELP!! Of the...
can
yall please help me figure out these questions 1-10? PLEASE I NEED
HELP!!
Of the following events from the light reactions of photosynthesis, which would be expected to occur first? While being split, electrons are taken out of water. Acceptance of electrons by Pc from the cytochrome complex Donation of electrons from reduced Pq to the cytochrome complex Light-induced reduction of the primary elecetron acceptor in the reaction center of PS ll takes place. Question 2 (2 points) The...
1. Select all of the true statements about photosynthesis. a. NADPH is the final electron acceptor...
1. Select all of the true statements about photosynthesis. a. NADPH is the final electron acceptor b. During the Calvin cycle, energy stored in the electrons from water is used to build ATP c. During the light reactions, energy stored in the electrons from water is used to build ATP d. During the Calvin Cycle, ATP and NADPH are used to make glucose e. During the light reactions, ATP and NADPH are used to make glucose f. carbon dioxide and...
4. _____Carotenoid are found in all photosynthetic organisms and are called accessary pigments. What is their...
4. _____Carotenoid are found in all photosynthetic organisms and are called accessary pigments. What is their major role in plant leaves? A. Light capturing B. Protection of chloroplasts C. Fixing CO2 D. Pathogen defense 5. _____A chlorophyll molecule has a hydrophobic tail and a porphyrin ring. The core of the porphyrin ring is occupied by an atom of ______________. A) N B) C C) Mg D) H 6. _____The life of an aerobic organisms depends on oxygen which is the...
8. The light reactions are made up of two photosystems. Describe each of the photosystems. Where...
8. The light reactions are made up of two photosystems. Describe each of the photosystems. Where do these reactions occur? When do they occur? 9. How are pigments used in the photosystems? How is it possible for pigments to catch light or absorb light to fuel the reactions of the chloroplast? 10. What is carbon focation? What is nitrogen fixation? The Calvin Cycle is also called the dark reactions. Why? 11. What are the steps in the dark reactions? What...
4. Which wavelengths of light do plants absorb? For what purpose? What makes plants green? 5....
4. Which wavelengths of light do plants absorb? For what purpose? What makes plants green? 5. Which Group 2 metal is and important component of chlorophyll? What is its oxidation state and what role does it play in the structure of chlorophyll? 6. Who is Bruce Ames? How many publications does he have? 7. Which micronutrient is a Group 2 metal and also missing in many people's diets? Which age related diseases are negative consequences of this specific micronutrient deficiency?...
que photosynthetic pigment instead of chlorophyll. The leaves of this plant always appear to be green....
que photosynthetic pigment instead of chlorophyll. The leaves of this plant always appear to be green. What colors of light would be least effective for photosynthesis for this plant? A plant has a unique photo yellow, not green. What co A. green B. white C. red D. blue E yellow 25. Which of the following is NOT a product of the light reactions? A. NADPH В. АТР C. oxygen D. carbon dioxide 26. Which of the following are products of...
Why do plants tend to absorb the wavelengths 500-625 nm less than other wavelengths of light?...
Why do plants tend to absorb the wavelengths 500-625 nm less than other wavelengths of light? (5 pts): If we conducted an experiment to cut Chlorophyll in half where we cleaved the hydrophobic tail from the porphyrin ring how would either part behave on the chromatography sheet when separated? (5pts): Now isolated on the sheet how would the individual subunits of Chlorophyll behave when we analyze their optic densities? Make sure to provide comments on both subunits. (5 pts): If...
-Give a brief background on the role of pigments in photosythensis. -state your hypothesis. -finish with...
-Give a brief background on the role of pigments in
photosythensis.
-state your hypothesis.
-finish with stating the rationale for your hypothesis (how
did you arrive at these hypothesis?)
this is an introduction piece, so it doesn't need the results to
write the papee. introduction sections set up the background,
purpose, rationale, and hypothesis for a study.
Biod 20 PHOTOSYNTHESIS Background Plants harness the energy of the sun through a process called photosynthesis. The leaf is the plant organ that...
can someone answer these please!! I NEED HELP!!
Of the following events from the light reactions of photosynthesis, which would be expected to occur first? While being split, electrons are taken out of water. Acceptance of electrons by Pc from the cytochrome complex Donation of electrons from reduced Pq to the cytochrome complex Light-induced reduction of the primary elecetron acceptor in the reaction center of PS Il takes place. Question 2 (2 points) The following figure depicts the absorption spectra...
Chlorophyll a Absorption Spectrum of Visible Light Absorption of light (%) Which of the following wavelengths of light are not absorbed by chlorophyll a to power photosynthesis? Check all that apply. 430 nm 660 nm 530 nm 400 450 500 550 600 Wavelength (nm) 650 700 wavelength (nm) In a laboratory experiment, you take three plants and put them each under a lamp that mimics sunlight. You have three colored light filters that fit over each of the lamps: a...
can
yall please help me figure out these questions 1-10? PLEASE I NEED
HELP!!
Of the following events from the light reactions of photosynthesis, which would be expected to occur first? While being split, electrons are taken out of water. Acceptance of electrons by Pc from the cytochrome complex Donation of electrons from reduced Pq to the cytochrome complex Light-induced reduction of the primary elecetron acceptor in the reaction center of PS ll takes place. Question 2 (2 points) The...
8. The light reactions are made up of two photosystems. Describe each of the photosystems. Where do these reactions occur? When do they occur? 9. How are pigments used in the photosystems? How is it possible for pigments to catch light or absorb light to fuel the reactions of the chloroplast? 10. What is carbon focation? What is nitrogen fixation? The Calvin Cycle is also called the dark reactions. Why? 11. What are the steps in the dark reactions? What...
4. Which wavelengths of light do plants absorb? For what purpose? What makes plants green? 5. Which Group 2 metal is and important component of chlorophyll? What is its oxidation state and what role does it play in the structure of chlorophyll? 6. Who is Bruce Ames? How many publications does he have? 7. Which micronutrient is a Group 2 metal and also missing in many people's diets? Which age related diseases are negative consequences of this specific micronutrient deficiency?...
que photosynthetic pigment instead of chlorophyll. The leaves of this plant always appear to be green. What colors of light would be least effective for photosynthesis for this plant? A plant has a unique photo yellow, not green. What co A. green B. white C. red D. blue E yellow 25. Which of the following is NOT a product of the light reactions? A. NADPH В. АТР C. oxygen D. carbon dioxide 26. Which of the following are products of...
-Give a brief background on the role of pigments in
photosythensis.
-state your hypothesis.
-finish with stating the rationale for your hypothesis (how
did you arrive at these hypothesis?)
this is an introduction piece, so it doesn't need the results to
write the papee. introduction sections set up the background,
purpose, rationale, and hypothesis for a study.
Biod 20 PHOTOSYNTHESIS Background Plants harness the energy of the sun through a process called photosynthesis. The leaf is the plant organ that...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 49 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 1 hour ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 5 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 5 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 6 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago