Because of Erwin Chargaff's experiments on the proportion of DNA nucleotides, what percentage of a DNA...
Because of Erwin Chargaff's experiments on the proportion of DNA nucleotides, what percentage of a DNA molecule would be adenine if you had 30% cytosine?
Group of answer choices
A. 20%
B. 40%
C. 30%
D. 10%
2. Which of the following terms describes all of the genetic material of an organism?
Group of answer choices
A. Genome
B. Chromosome
C. Gene
D. Translation
Homework Answers
Q1 Option A - 20%
G=C = 30%
There fore 100 - Percentage of (G+C) = A+T
G+C = 30+30 = 60%
100-60 = 40%
A+T = 40%
There fore A = 20%.
Q2.
Option A - Genome.
Genome represents all the genes, introns, non-coding regions, repetitive parts, entire DNA in the organism.
Add Answer to:
Because of Erwin Chargaff's experiments on the proportion of DNA
nucleotides, what percentage of a DNA...
What are the three functional groups that comprise a nucleotide? What do nucleotides have in common...
What are the three functional groups that comprise a nucleotide? What do nucleotides have in common with amino acids or simple sugars? When the structure of DNA was first elucidated, many biologists quickly saw how this structure explained the passage of information from one generation to another. How does the structure of DNA explain generation-to-generation flow of information? In other words, give a brief description of the structure of DNA and tell how this structure allows for replication. Which of...
DRAW a DNA molecules consisting of 6 nucleotides in length following the LABELING directions in steps...
DRAW a DNA molecules consisting of 6 nucleotides in length
following the LABELING directions in steps 7 and 8. I recommend
using circles for the phosphate groups, triangles for the sugar
deoxyribose, rectangles for the purines Adenine and Guanine, and
squares for the pyrimidines Thymine and Cytosine.
7. Draw the molecule of DNA you constructed using these symbols: D= deoxyribose, P=phosphate, A = adenine, G = guanine, C = cytosine, T = thymine. 8. Indicate the location of the hydrogen...
Only answers please don’t show work 33) Viral DNA incorporated into host cell DNA is known...
Only answers please don’t show work
33) Viral DNA incorporated into host cell DNA is known as a/an A) phage. B) envelope C) capsid. 33) 34) How is transformation in bacteria most A) the creation of a strand of RNA from DNA molecule B) the type of semiconservative by DNA C) the infection of cells by a phage DNA molecule D) the e of a strand of DNA from an RNA molecule E) assimilation of external DNA into a cell...
compare selection and mutation 1. DNA molecules in the cells exist as a........ 2. DNA carry...
compare selection and mutation
1. DNA molecules in the cells exist as a........ 2. DNA carry the information to build and maintain the cells life by four letters of genetic language True False 3. The term phenotype is used to describe all of the organism's genetic information True / False 4. All of the organism DNA encode genes True/ False 5. Bacteria have one chromosome which is circular structure associated with proteins (no histones) True False 6. In the process...
1. According to the Griffith experiments, what was trait was being transferred in DNA? Group of...
1. According to the Griffith experiments, what was trait was being transferred in DNA? Group of answer choices A smooth coat A new toxin An adhesin DNA-destroying enzyme 2. According to the Hershey and Chase experiments, the radioactive sulfur labelled the _______. Group of answer choices proteins that make up the viral coat DNA that makes up the viral genome viral ribosomes viral polysaccharide capsule layer
What was the major conclusion of the Hershey and Chase bacteriophage experiments? What was the major...
What was the major conclusion of the Hershey and Chase bacteriophage experiments? What was the major conclusion of the Hershey and Chase bacteriophage experiments? A. single gene directs the synthesis of a single polypeptide. B. DNA, but not protein, is the genetic material. D. DNA is a double helix. C. The genetic material is located in the nucleus of cells
Warm Up Questions (6 pts.) a.) Transcription occurs along a ____ template forming an mRNA in...
Warm Up Questions (6 pts.)
a.) Transcription occurs along a ____ template forming
an mRNA in the ____ direction. (0.5 pts.)
A) 5' to 3'; 5' to 3'
B) 5' to 3'; 3' to 5'
C) 3' to 5'; 5' to 3'
D) 3' to 5'; 3' to 5'
b. A DNA molecule has 180 base pairs and is 30% adenine.
How many cytosine nucleotides are present in this molecule of DNA?
(1 pt.)
c. Label all of the enzymes...
14.2 Modeling the Structure and Function of Nucleic Acids and Their Products 2. The following diagram...
14.2 Modeling the Structure and Function of Nucleic Acids and Their Products 2. The following diagram represents some of the puzzle piece pieces used in this section. a Assembled in this form, do they represent an amino acid, c. a portion of messenger RNA, or a deoxyribonucleotide (b) Explain your answer. Opo 3. Why is DNA often called a double helix? 4. State the following ratios. (a) Guanine to cytosine in a double-stranded DNA molecule: (b) Adenine to thymine: -...
c) The steps or rungs of the DNA ladder are composed of phosphate group 4 Deoxyribose...
c) The steps or rungs of the DNA ladder are composed of phosphate group 4 Deoxyribose 15. Use Figure 2 and 3 of the lab to compare the genome of a human with a mouse, fruit fly and yeast. paired in a specific way. d) Adenine in one DNA strand always pain with thymine ) Bases in opposite strands of a DNA molecule are linked together by hydrogen in the other strand and bonds. Yeast Human Mouse Fruit Fly Number...
Question 33 2 pts Which of the following statements about the process of DNA replication is...
Question 33 2 pts Which of the following statements about the process of DNA replication is true? It involves the enzyme DNA ligase, which corrects point mutations. It utilizes DNA polymerase, which catalyzes the reaction that adds a new nucleotide to the growing strand. The sequence on the new strand is always identical to one of the old parent strands. Adenine pairs with guanine, and cytosine pairs with thymine. Question 34 2 pts The DNA base...
DRAW a DNA molecules consisting of 6 nucleotides in length
following the LABELING directions in steps 7 and 8. I recommend
using circles for the phosphate groups, triangles for the sugar
deoxyribose, rectangles for the purines Adenine and Guanine, and
squares for the pyrimidines Thymine and Cytosine.
7. Draw the molecule of DNA you constructed using these symbols: D= deoxyribose, P=phosphate, A = adenine, G = guanine, C = cytosine, T = thymine. 8. Indicate the location of the hydrogen...
Only answers please don’t show work
33) Viral DNA incorporated into host cell DNA is known as a/an A) phage. B) envelope C) capsid. 33) 34) How is transformation in bacteria most A) the creation of a strand of RNA from DNA molecule B) the type of semiconservative by DNA C) the infection of cells by a phage DNA molecule D) the e of a strand of DNA from an RNA molecule E) assimilation of external DNA into a cell...
compare selection and mutation
1. DNA molecules in the cells exist as a........ 2. DNA carry the information to build and maintain the cells life by four letters of genetic language True False 3. The term phenotype is used to describe all of the organism's genetic information True / False 4. All of the organism DNA encode genes True/ False 5. Bacteria have one chromosome which is circular structure associated with proteins (no histones) True False 6. In the process...
Warm Up Questions (6 pts.)
a.) Transcription occurs along a ____ template forming
an mRNA in the ____ direction. (0.5 pts.)
A) 5' to 3'; 5' to 3'
B) 5' to 3'; 3' to 5'
C) 3' to 5'; 5' to 3'
D) 3' to 5'; 3' to 5'
b. A DNA molecule has 180 base pairs and is 30% adenine.
How many cytosine nucleotides are present in this molecule of DNA?
(1 pt.)
c. Label all of the enzymes...
14.2 Modeling the Structure and Function of Nucleic Acids and Their Products 2. The following diagram represents some of the puzzle piece pieces used in this section. a Assembled in this form, do they represent an amino acid, c. a portion of messenger RNA, or a deoxyribonucleotide (b) Explain your answer. Opo 3. Why is DNA often called a double helix? 4. State the following ratios. (a) Guanine to cytosine in a double-stranded DNA molecule: (b) Adenine to thymine: -...
c) The steps or rungs of the DNA ladder are composed of phosphate group 4 Deoxyribose 15. Use Figure 2 and 3 of the lab to compare the genome of a human with a mouse, fruit fly and yeast. paired in a specific way. d) Adenine in one DNA strand always pain with thymine ) Bases in opposite strands of a DNA molecule are linked together by hydrogen in the other strand and bonds. Yeast Human Mouse Fruit Fly Number...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 3 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago