Homework Answers
Ans 2) Myosin-II cant relax muscles. CapZ protein bind (+ end) of actin to Z-disc. Nebulin length is equal to the actin filament.Titin extends from Z-disc to M-line . Tropomodulin caps the (- end of actin). During muscle contration by (ATP and Ca2+ ions),Myosin head moves towards positive end of actin and thus actin comes to the centre of sarcomere and this will reduce the Z-disc length or muscle will contract.
For muscle relaxation, Ca2+ ions should be released from the Actin-Tropomyosin-Troponin complex so that the Myosin binding site will get masked and muscle contration will occur. (Binding of Ca2+ ions expose the Myosin binding site which will result in muscle contraction (since actin can bind to myosin now as the myosin binding site is exposed).
Add Answer to:
2. Muscle contraction involves the "pulling" of actin filaments by myosin II heads of a bipolar...
As actin and myosin filaments slide past each other during muscle contraction. actin filaments shorten, while...
As actin and myosin filaments slide past each other during muscle contraction. actin filaments shorten, while myosin filaments do not myosin filaments shorten, while actin filaments do not both actin and myosin filaments shorten neither actin nor myosin filaments shorten The Ca^2+ required for skeletal muscle contraction is released from the sarcoplasmic reticulum. enters the cell due to the opening of voltage regulated Ca^2+ channels from the T tubules. is actively transported into the cell. is released from mitochondria Myocardial...
As actin and myosin filaments slide past each other during muscle contraction, i. actin filaments shorten,...
As actin and myosin filaments slide past each other during muscle contraction, i. actin filaments shorten, while myosin filaments do not ii. myosin filaments shorten, while actin filaments do not iii. both actin and myosin filaments shorten iv. neither actin nor myosin filaments shorten The Ca^2+ required for skeletal muscle contraction i. is released from the sarcoplasmic reticulum. ii. enters the cell due to the opening of voltage regulated Ca^2+ channels from the T tubules. iii. is actively transported into...
1. If you add short actin filaments marked by bound myosin heads (myosin-decorated filaments) to a...
1. If you add short actin filaments marked by bound myosin heads
(myosin-decorated filaments) to a solution with an excess of actin
monomers, wait for a few minutes, and then examine the filaments by
electron microscopy, you see the picture shown in Figure 16-5.
A. Which is the plus end of the myosin-decorated filaments and
which is the minus end? Which is the "barbed" end and which is the
"pointed" end? How can you tell?
B. If you diluted the...
Muscle contraction: Select one O a occurs when myosin pulls on actin and the sarcomere shortens...
Muscle contraction: Select one O a occurs when myosin pulls on actin and the sarcomere shortens b. occurs when actin pushes on myosin and the sarcomere elongates O c occurs when the myosin tail splits the actin filament in half Od occurs when actin and myosin entangle, generating more distance between Z lines
2. Actin filaments are polarized. Intermediate filaments are non-polar. Myosin thick filaments are bipolar. a. Explain...
2. Actin filaments are polarized. Intermediate filaments are non-polar. Myosin thick filaments are bipolar. a. Explain how the assembly of these filaments from their soluble monomers determines whether they are polar, nonpolar or bipolar. b. Why are the two ends of actin filaments designated as being ‘plus’ or ‘minus’? c. Why do intermediate filaments have such high tensile strength?
NAME SID 25. Usted below are different steps that occur during the excitation and contraction of...
NAME SID 25. Usted below are different steps that occur during the excitation and contraction of a muscle fiber. Please select the correct sequence in which these stages occur. 1) Ca2+ binds to Tropomyosin, causing a conformational change that unblocks cross-bridge binding sites. 2) The Sarcoplasmic Reticulum is depolarized, which opens up Voltage-Gated Channels that release Ca2+ into the cytoplasm. 3) The Action Potential then travels along the cell membrane and down transverse tubules that extend into the muscle fiber....
13. During skeletal musele contraction, whet substance does the sarcoplasmic reticulum store and release? A. acetyicholine...
13. During skeletal musele contraction, whet substance does the sarcoplasmic reticulum store and release? A. acetyicholine B. sodium D. calcium 34. What stimalates the sarcoplasmic reticulum (SR) to release this chemical? A. the voltage change from the muscular action potential traveling down the transverse (1) tubules B. the binding of acetylcholine to ligand-gated channels in the transverse tubules C. direct stimulus from the neural action potential D, the binding of myosin to actin 35. Transverse (T) tubales are extensions of...
66) The successful transmission of a nervous impulse to a muscle fiber leads to the release...
66) The successful transmission of a nervous impulse to a muscle fiber leads to the release of Calcium (Ca2+) from the Sarcoplasmic Reticulum. The role of Ca2+ in muscle contraction is: Bind to myosin, which cleaves ATP such that energy can be input into the myosin “heads”, allowing it to perform a power stroke needed to move actin. Ca2+ acts in a process that breaks up actin filaments, removing subunits to make them shorter and thus leading to the contraction...
1. List the steps of muscle contraction from the brain to muscle fiber 2. List the...
1. List the steps of muscle contraction from the brain to muscle fiber 2. List the steps of muscle relaxation 3. List steps of synaptic transmission of nerves 4. List Five glial cells and their functions 5. What is excitatory post synaptic potential or facilitation? 6. What is inhibitory post synaptic potential or inhibition? Define the following! 1. Sarcolemma 2. Troponin 3. Tropomyosin 4. Myosin 5. Actin 6. Cross Bridge 7. Titin 8. H zone 9. I band 10. A...
1. (2 points) If you were given a microscope slide with an unknown type of muscle...
1. (2 points) If you were given a microscope slide with an unknown type of muscle tissue, what features would you look for to determine whether the tissue was smooth muscle or skeletal muscle? Give 2 characteristics that would allow you to distinguish between these tissue types. Be sure to state which type of muscle has the characteristics you describe.) 2. Give 3 examples of different types of connective tissues found within the body and briefly note one function of...
As actin and myosin filaments slide past each other during muscle contraction. actin filaments shorten, while myosin filaments do not myosin filaments shorten, while actin filaments do not both actin and myosin filaments shorten neither actin nor myosin filaments shorten The Ca^2+ required for skeletal muscle contraction is released from the sarcoplasmic reticulum. enters the cell due to the opening of voltage regulated Ca^2+ channels from the T tubules. is actively transported into the cell. is released from mitochondria Myocardial...
As actin and myosin filaments slide past each other during muscle contraction, i. actin filaments shorten, while myosin filaments do not ii. myosin filaments shorten, while actin filaments do not iii. both actin and myosin filaments shorten iv. neither actin nor myosin filaments shorten The Ca^2+ required for skeletal muscle contraction i. is released from the sarcoplasmic reticulum. ii. enters the cell due to the opening of voltage regulated Ca^2+ channels from the T tubules. iii. is actively transported into...
1. If you add short actin filaments marked by bound myosin heads
(myosin-decorated filaments) to a solution with an excess of actin
monomers, wait for a few minutes, and then examine the filaments by
electron microscopy, you see the picture shown in Figure 16-5.
A. Which is the plus end of the myosin-decorated filaments and
which is the minus end? Which is the "barbed" end and which is the
"pointed" end? How can you tell?
B. If you diluted the...
Muscle contraction: Select one O a occurs when myosin pulls on actin and the sarcomere shortens b. occurs when actin pushes on myosin and the sarcomere elongates O c occurs when the myosin tail splits the actin filament in half Od occurs when actin and myosin entangle, generating more distance between Z lines
NAME SID 25. Usted below are different steps that occur during the excitation and contraction of a muscle fiber. Please select the correct sequence in which these stages occur. 1) Ca2+ binds to Tropomyosin, causing a conformational change that unblocks cross-bridge binding sites. 2) The Sarcoplasmic Reticulum is depolarized, which opens up Voltage-Gated Channels that release Ca2+ into the cytoplasm. 3) The Action Potential then travels along the cell membrane and down transverse tubules that extend into the muscle fiber....
13. During skeletal musele contraction, whet substance does the sarcoplasmic reticulum store and release? A. acetyicholine B. sodium D. calcium 34. What stimalates the sarcoplasmic reticulum (SR) to release this chemical? A. the voltage change from the muscular action potential traveling down the transverse (1) tubules B. the binding of acetylcholine to ligand-gated channels in the transverse tubules C. direct stimulus from the neural action potential D, the binding of myosin to actin 35. Transverse (T) tubales are extensions of...
1. (2 points) If you were given a microscope slide with an unknown type of muscle tissue, what features would you look for to determine whether the tissue was smooth muscle or skeletal muscle? Give 2 characteristics that would allow you to distinguish between these tissue types. Be sure to state which type of muscle has the characteristics you describe.) 2. Give 3 examples of different types of connective tissues found within the body and briefly note one function of...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 23 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago