is it physically possible or meaningful to have a non-whole-number ration of phen/fe2+ like 2.7 or...
is it physically possible or meaningful to have a non-whole-number ration of phen/fe2+ like 2.7 or 3.2? use the laws of chemical composition to justify your answer.
Homework Answers
If we try to understand what the ratio mean we will get that the ratio indicates the coordinations number of the metal actually. Phenanthrin is a bidentate ligand, so if the ratio is 2 it means two phenanthirn units are connected to one Fe metal indicating that Fe is tetrahedrally coordinated.
Similarly when this ratio is 3, the coordination number becomes 6. But when the number is 2.7 or 3.2 the coordination number of metal becomes 5.4 or 6.4 respectively.
Coordination number can not be a fraction at all because metal ligand bond number is interfering which can not be fraction. So it is not possible to have fractional ratios of the given entity.
Add Answer to:
is it physically possible or meaningful to have a
non-whole-number ration of phen/fe2+ like 2.7 or...
Could someone please solve? Complete and balance the following reactions. (Use the lowest possible whole number...
Could someone please
solve?
Complete and balance the following reactions. (Use the lowest possible whole number coefficients. Include states-of-matter under the given conditions in your answer.) (a) NaCl(aq) + Ba(NO3)2(aq) → chemPad Help X. Xº == Greek (b) NaOH(aq) + NH4C2H302(aq) → chemPad Help x.xºm a Greeka (c) Na2S(aq) + Ca(NO3)2(aq) → chemPad Help x.x" = Greek
whole question: Just answer as many as possible, dont have to be 100% 1. Consider the...
whole question: Just answer as many as possible, dont have to be
100%
1. Consider the market for dried beans in a small town of 9,000 consumers. Let each consumer's preferences over beans (B, in pounds) and other goods (G) be given by U(B,G) = 120 +G For the rest of this question, fix the price of other goods at PG = 1 and let each consumer have a total weekly budget of I = 100. (a) Write the budget...
Balance the following equations. (Use the lowest possible whole number coefficients. Include states-of-matter under the given...
Balance the following equations. (Use the lowest possible whole number coefficients. Include states-of-matter under the given conditions in your answer.) (*) PCI, (s) + H200) - Hypo (aq) HCl(a) chemPad YON one or more states-of-matter (b) Co(s) + HNO3(aq) - Co(NO3)(20) + H200) + NO(g) chemPad X.X" Greek (0) P,(s) + 12(5) - P1,(s) chemPad Your answer appears to be missing one or more states-of-matte (d) Co(s) + 0,(0) -- C0,0(s) chemPad Help X.XO - Break Your answer appears to...
Please - answer the whole thing. use complete sentences if possible please. . You have been...
Please - answer the whole thing. use complete sentences if possible please. . You have been admitted to your local hospital for chest pain. An EKG was performed on you and now you are waiting for a lab technician to draw blood to test your cardiac enzyme levels. Moments before the technician arrives your nurse comes in with a puzzled look. You ask what's wrong and they mention that another EKG order has appeared for you. The nurse verifies that...
31. + -10.1 points 0/4 Submissions Used Balance the following equations. (Use the lowest possible whole-number...
31. + -10.1 points 0/4 Submissions Used Balance the following equations. (Use the lowest possible whole-number coefficients. These may be zero.) (a) CIO (aq) + 12() = Cl(aq) + 103 (aq) CIO + 12+ H H20 = + 103 + H+ H2O (b) NO3 (aq) + As2O3(s) = N2O3(aq) + H3ASO4(aq) NO3 + As2O3 + H+ + H20 = N203 + C H3A504 + H+ + H2O (c) Cro42-(aq) + N2H4(aq) = Cr(OH)3(s) + N2(9) croq²+ NaH4+ OH + H20...
Q1) Answer all Multiple Choice questions.i) Newton’s 1st law is:A. PHYSICALLY INDEPENDENT of the...
Q1) Answer all Multiple Choice questions.i) Newton’s 1st law is:A. PHYSICALLY INDEPENDENT of the other two laws
of motion and CANNOT be dispensed with as an axiom
of Newtonian physics.B. PHYSICALLY INDEPENDENT of the other two laws
of motion, but nonetheless it CAN be dispensed
with as an axiom of Newtonian physics.C. Actually a SPECIAL CASE of the 2ND LAW. The
case when the net force is zero. Therefore, logically we need only
two laws of motion. Perhaps for clarity...
Non-financial companies that deal with exchange rates have two strategic choices to safeguard against currency risks:...
Non-financial companies that deal with exchange rates have two strategic choices to safeguard against currency risks: currency hedging and strategic hedging. The former involves the use of forward transactions, which necessitates some expectations or forecasts of future rates. Strategic hedging, meanwhile, entails the spreading out of a firm’s activities in a number of different currency zones in order to offset losses in any one zone. While currency hedging can largely be performed by a small group of experts, strategic hedging...
The number of flaws x on an electroplated automobile grill is known to have the following...
The number of flaws x on an electroplated automobile grill is known to have the following probability mass function: p(0) = 0.6; p(1) = 0.2; p(2) = 0.1; p(3) = 0.1 a) Is this random variable continuous or discrete? Justify your answer. b) Verify that this is a proper mass function c) What is the probability that a randomly selected grill has fewer than 2 flaws? Calculate the probability, and use proper probability notation. d) What is the probability that...
The American Association of Individual Investors (AAII) On-Line Discount Broker Survey polls members on their experiences...
The American Association of Individual Investors (AAII) On-Line Discount Broker Survey polls members on their experiences with electronic trades handled by discount brokers. As part of the survey, members were asked to rate their satisfaction with the trade price and the speed of execution, as well as provide an overall satisfaction rating. Possible responses (scores) were no opinion (0), unsatisfied (1), somewhat satisfied (2), satisfied (3), and very satisfied (4). For each broker, summary scores were computed by computing a...
like this? 3 Q067 Zero Coupon Bonds non bonds are sold at a substantial discount from...
like this?
3 Q067 Zero Coupon Bonds non bonds are sold at a substantial discount from the face value, and the buyer receives the face value of the bond when it matures. The difference between the face value and the price of the bond is the interest earned. To determine the purchase amount of a zero-coupon bond. Calculate the present value of the (Future value) maturity value. Veronica bought a 15-year zero-coupon bond paying 7% (annual rate) interest (compounded semiannually)...
Could someone please
solve?
Complete and balance the following reactions. (Use the lowest possible whole number coefficients. Include states-of-matter under the given conditions in your answer.) (a) NaCl(aq) + Ba(NO3)2(aq) → chemPad Help X. Xº == Greek (b) NaOH(aq) + NH4C2H302(aq) → chemPad Help x.xºm a Greeka (c) Na2S(aq) + Ca(NO3)2(aq) → chemPad Help x.x" = Greek
whole question: Just answer as many as possible, dont have to be
100%
1. Consider the market for dried beans in a small town of 9,000 consumers. Let each consumer's preferences over beans (B, in pounds) and other goods (G) be given by U(B,G) = 120 +G For the rest of this question, fix the price of other goods at PG = 1 and let each consumer have a total weekly budget of I = 100. (a) Write the budget...
Balance the following equations. (Use the lowest possible whole number coefficients. Include states-of-matter under the given conditions in your answer.) (*) PCI, (s) + H200) - Hypo (aq) HCl(a) chemPad YON one or more states-of-matter (b) Co(s) + HNO3(aq) - Co(NO3)(20) + H200) + NO(g) chemPad X.X" Greek (0) P,(s) + 12(5) - P1,(s) chemPad Your answer appears to be missing one or more states-of-matte (d) Co(s) + 0,(0) -- C0,0(s) chemPad Help X.XO - Break Your answer appears to...
31. + -10.1 points 0/4 Submissions Used Balance the following equations. (Use the lowest possible whole-number coefficients. These may be zero.) (a) CIO (aq) + 12() = Cl(aq) + 103 (aq) CIO + 12+ H H20 = + 103 + H+ H2O (b) NO3 (aq) + As2O3(s) = N2O3(aq) + H3ASO4(aq) NO3 + As2O3 + H+ + H20 = N203 + C H3A504 + H+ + H2O (c) Cro42-(aq) + N2H4(aq) = Cr(OH)3(s) + N2(9) croq²+ NaH4+ OH + H20...
Q1) Answer all Multiple Choice questions.i) Newton’s 1st law is:A. PHYSICALLY INDEPENDENT of the other two laws
of motion and CANNOT be dispensed with as an axiom
of Newtonian physics.B. PHYSICALLY INDEPENDENT of the other two laws
of motion, but nonetheless it CAN be dispensed
with as an axiom of Newtonian physics.C. Actually a SPECIAL CASE of the 2ND LAW. The
case when the net force is zero. Therefore, logically we need only
two laws of motion. Perhaps for clarity...
like this?
3 Q067 Zero Coupon Bonds non bonds are sold at a substantial discount from the face value, and the buyer receives the face value of the bond when it matures. The difference between the face value and the price of the bond is the interest earned. To determine the purchase amount of a zero-coupon bond. Calculate the present value of the (Future value) maturity value. Veronica bought a 15-year zero-coupon bond paying 7% (annual rate) interest (compounded semiannually)...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago