Can someone explain how to do this.
Homework Answers
Add Answer to:
Can someone explain how to do this.
11. A certain reaction achieves equilibrium at 742 C....
4. The gas-phase dehydrogenation of propanol (A) to yield propionaldehyde (B) is in equilibrium at 230°C. Standard thermodynamic data for the reaction species at 298 K are: Propanol: Propionaldehyde...
4. The gas-phase dehydrogenation of propanol (A) to yield propionaldehyde (B) is in equilibrium at 230°C. Standard thermodynamic data for the reaction species at 298 K are: Propanol: Propionaldehyde : H.,--186 k/moi s'u-304.40 J/(mol K) Dihydrogen: H A -256 kJ/molSA 322.49 J/(mol K) Soc 130.68 J/(mol K) ) (4 points) Evaluate the standard enthalpy change of reaction (AH)at 298 K. ii (6 points Calculate the equilibrium constant at 298 K ) (8 points) Determine the equilibrium constant for this reaction...
1. Ethylene can be formed by cracking of propane: CH CHA+CH. This reaction is carried out...
1. Ethylene can be formed by cracking of propane: CH CHA+CH. This reaction is carried out in the gas phase. You may assume ideal gas for parts b and c. AH (kJ/mol) AG (kJ/mol) CH 52.4 68.4 -103.8 CHA -74.6 --50.5 a. (10%) Use the provided data (for 1 bar, 298.15 K) to calculate the equilibrium constant of this reaction at 298.15 K. b. (10%) Calculate the equilibrium constant of this reaction at 800 K using the shortent van't Hoff...
Can someone please help with #13 and 14?? Thank you!!! (2 pts) Version A Spring 2019 A * 13. a) Write the enthalpy...
Can someone please help with #13 and 14?? Thank you!!!
(2 pts) Version A Spring 2019 A * 13. a) Write the enthalpy of formation equation for CsHs (gas). 30 +4412 ly Holio b) AG° at 298 K for the formation of C H gas from elements is -23.4 kJ/mol. Calculate the initial value of AG at 298 K for a reaction mixture that initially has... 4.00 grams carbon solid, 0.100 atm H gas, and 4.80 atm C He gas....
only do part (c) **please explain how to solve M^-2 The Haber process is used to...
only do part (c) **please explain how to solve M^-2
The Haber process is used to make ammonia, N2(g) + 3H2(g) = 2NH3(g) a) Write down the condition for equilibrium for this reaction in terms of the concentrations of reactants and products. At 298 K, this reaction has AH° = -46 kJ mol"', and AS° = -100 J K-mol?. Assume that AH° and ASº are independent of temperature. At what temperature does AGº vanish, i.e. AG° = 0? (c) Under...
1. [Suggested time 20-30 minutes] The reverse water gas shift (WGS) reaction occurs during many high temperature processes involving hydrocarbons and typically reaches equilibrium: coag) + H2(g)...
1. [Suggested time 20-30 minutes] The reverse water gas shift (WGS) reaction occurs during many high temperature processes involving hydrocarbons and typically reaches equilibrium: coag) + H2(g) 근 COe) + H2O(g) AG 298K (kJ/mol) AH1298K (kJ/mol) -137.66 -229.25 -395.51 0.00 -110.84 -242.52 -394.64 0.00 H20 (g) CO2(8) o lin 2 [3 points] Determine the standard Gibbs energy change for this reaction at 25°C b) c) [10 points] Calculate the equilibrium composition (molar fractions) for an isothermal reaction carried out at...
1. Ethylene can he farmed hy cracking of propane: CHACHA+CH. This reaction is carried out in...
1. Ethylene can he farmed hy cracking of propane: CHACHA+CH. This reaction is carried out in the gas phase. You may assume ideal gas for parts b and c. 68.4 AH (kJ/Llol AG (LJ/mol 52.4 CIL - 103 -23.1 -74.6 -30.5 a. (10%) Use the provided data for 1 bar, 298.15 K) to calculate the exquilibrium constant of this reaction at 298.15 K. b. (10%) Calculate the equilibrium constant of this reaction at 800 K using the shortcut van't Holl...
SOS Question 11 (5 points) What is the equilibrium expression for the following reaction? 2Ag (s)...
SOS
Question 11 (5 points) What is the equilibrium expression for the following reaction? 2Ag (s) + Cl2 (g) = 2AgCl (s) OK = 1/[C12] OK = [Agci12 / [Ag] OK = [Ag]?[c12] OK = [Agci12 / ([Ag]?[Cl2)) OK = (AgCl2 Question 12 (5 points) What is true of the percent inition OK = [AgCl2 Question 12 (5 points) What is true of the percent ionization of a weak acid as the concentration of the weak acid increases? the percent...
T(N)=352 please I need the answer urgent Question 1 The following gas phase reaction produces ethanol...
T(N)=352 please I need the answer urgent
Question 1 The following gas phase reaction produces ethanol (C2H5OH) by catalytic hydrogenation of acetaldehyde (CH3CHO). The reaction reaches equilibrium at a temperature of T= T(N) and a pressure of 3 bar: CH,CHO(g) + H, (g) C,H,OH (8) The reactive system initially contains 1.5 moles of Hydrogen (Ha) for each mole of acetaldehyde (CH3CHO). The mixture is assumed to be an ideal gas. T(N) is the temperature corresponding to the student number as...
Calcium carbonate can decompose into calcium oxide and carbon dioxide gas with the (c) reaction: CaCO3...
Calcium carbonate can decompose into calcium oxide and carbon dioxide gas with the (c) reaction: CaCO3 СаО + СО2 The change in enthalpy for this reaction is AH = +178 kJ/mol and the change in entropy is AS = +0.16 kJ/(K. mol) (i) Describe the concept of the Gibbs energy and how it is related to the enthalpy and entropy (ii Hence calculate the minimum temperature for the decomposition of calcium carbonate to proceed spontaneously An Einstein solid consists of...
56,57,58,59,60,61,62 56) For the reaction 3H2(g) + N2(g)s-2NH(g), determine the equilibrium constant at 600°C if at this temperature, the equilibrium concentrations are: [N2 453 M; H:-2.49 M and [...
56,57,58,59,60,61,62
56) For the reaction 3H2(g) + N2(g)s-2NH(g), determine the equilibrium constant at 600°C if at this temperature, the equilibrium concentrations are: [N2 453 M; H:-2.49 M and [NHs] 7.62 M 57) When a sample of aqueous hydrochloric acid was neutralized with aqueous sodium hydroxide in a calorimeter, the temperature of 100.0 g of water surrounding the reaction increased from 25.0°C to 31.50. If the specific heat of water is 1.00 calV(g.°C), calculate the quantity of energy in calories involved...
4. The gas-phase dehydrogenation of propanol (A) to yield propionaldehyde (B) is in equilibrium at 230°C. Standard thermodynamic data for the reaction species at 298 K are: Propanol: Propionaldehyde : H.,--186 k/moi s'u-304.40 J/(mol K) Dihydrogen: H A -256 kJ/molSA 322.49 J/(mol K) Soc 130.68 J/(mol K) ) (4 points) Evaluate the standard enthalpy change of reaction (AH)at 298 K. ii (6 points Calculate the equilibrium constant at 298 K ) (8 points) Determine the equilibrium constant for this reaction...
1. Ethylene can be formed by cracking of propane: CH CHA+CH. This reaction is carried out in the gas phase. You may assume ideal gas for parts b and c. AH (kJ/mol) AG (kJ/mol) CH 52.4 68.4 -103.8 CHA -74.6 --50.5 a. (10%) Use the provided data (for 1 bar, 298.15 K) to calculate the equilibrium constant of this reaction at 298.15 K. b. (10%) Calculate the equilibrium constant of this reaction at 800 K using the shortent van't Hoff...
Can someone please help with #13 and 14?? Thank you!!!
(2 pts) Version A Spring 2019 A * 13. a) Write the enthalpy of formation equation for CsHs (gas). 30 +4412 ly Holio b) AG° at 298 K for the formation of C H gas from elements is -23.4 kJ/mol. Calculate the initial value of AG at 298 K for a reaction mixture that initially has... 4.00 grams carbon solid, 0.100 atm H gas, and 4.80 atm C He gas....
only do part (c) **please explain how to solve M^-2
The Haber process is used to make ammonia, N2(g) + 3H2(g) = 2NH3(g) a) Write down the condition for equilibrium for this reaction in terms of the concentrations of reactants and products. At 298 K, this reaction has AH° = -46 kJ mol"', and AS° = -100 J K-mol?. Assume that AH° and ASº are independent of temperature. At what temperature does AGº vanish, i.e. AG° = 0? (c) Under...
1. [Suggested time 20-30 minutes] The reverse water gas shift (WGS) reaction occurs during many high temperature processes involving hydrocarbons and typically reaches equilibrium: coag) + H2(g) 근 COe) + H2O(g) AG 298K (kJ/mol) AH1298K (kJ/mol) -137.66 -229.25 -395.51 0.00 -110.84 -242.52 -394.64 0.00 H20 (g) CO2(8) o lin 2 [3 points] Determine the standard Gibbs energy change for this reaction at 25°C b) c) [10 points] Calculate the equilibrium composition (molar fractions) for an isothermal reaction carried out at...
1. Ethylene can he farmed hy cracking of propane: CHACHA+CH. This reaction is carried out in the gas phase. You may assume ideal gas for parts b and c. 68.4 AH (kJ/Llol AG (LJ/mol 52.4 CIL - 103 -23.1 -74.6 -30.5 a. (10%) Use the provided data for 1 bar, 298.15 K) to calculate the exquilibrium constant of this reaction at 298.15 K. b. (10%) Calculate the equilibrium constant of this reaction at 800 K using the shortcut van't Holl...
SOS
Question 11 (5 points) What is the equilibrium expression for the following reaction? 2Ag (s) + Cl2 (g) = 2AgCl (s) OK = 1/[C12] OK = [Agci12 / [Ag] OK = [Ag]?[c12] OK = [Agci12 / ([Ag]?[Cl2)) OK = (AgCl2 Question 12 (5 points) What is true of the percent inition OK = [AgCl2 Question 12 (5 points) What is true of the percent ionization of a weak acid as the concentration of the weak acid increases? the percent...
T(N)=352 please I need the answer urgent
Question 1 The following gas phase reaction produces ethanol (C2H5OH) by catalytic hydrogenation of acetaldehyde (CH3CHO). The reaction reaches equilibrium at a temperature of T= T(N) and a pressure of 3 bar: CH,CHO(g) + H, (g) C,H,OH (8) The reactive system initially contains 1.5 moles of Hydrogen (Ha) for each mole of acetaldehyde (CH3CHO). The mixture is assumed to be an ideal gas. T(N) is the temperature corresponding to the student number as...
Calcium carbonate can decompose into calcium oxide and carbon dioxide gas with the (c) reaction: CaCO3 СаО + СО2 The change in enthalpy for this reaction is AH = +178 kJ/mol and the change in entropy is AS = +0.16 kJ/(K. mol) (i) Describe the concept of the Gibbs energy and how it is related to the enthalpy and entropy (ii Hence calculate the minimum temperature for the decomposition of calcium carbonate to proceed spontaneously An Einstein solid consists of...
56,57,58,59,60,61,62
56) For the reaction 3H2(g) + N2(g)s-2NH(g), determine the equilibrium constant at 600°C if at this temperature, the equilibrium concentrations are: [N2 453 M; H:-2.49 M and [NHs] 7.62 M 57) When a sample of aqueous hydrochloric acid was neutralized with aqueous sodium hydroxide in a calorimeter, the temperature of 100.0 g of water surrounding the reaction increased from 25.0°C to 31.50. If the specific heat of water is 1.00 calV(g.°C), calculate the quantity of energy in calories involved...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 43 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago