What is the difference between sat and unsaturated fat? What is polyunsaturated fatty acid?
What is the difference between sat and unsaturated fat? What is polyunsaturated fatty acid?
Homework Answers
Add Answer to:
What is the difference between sat and unsaturated fat? What is
polyunsaturated fatty acid?
What is the difference in structure between a polyunsaturated fat and a trans fat? Please draw...
What is the difference in structure between a polyunsaturated fat and a trans fat? Please draw a diagram.
Explain each term and give an example: saturated fat, unsaturated fat, monounsaturated fat, polyunsaturated fat, cis fa...
Explain each term and give an example: saturated fat, unsaturated fat, monounsaturated fat, polyunsaturated fat, cis fat, trans fat Explain each term and give an example: carbohydrate, monosaccharide, disaccharide, polysaccharide What is the definition of a foodprint? How specifically might each of these affect your foodprint: eating a veggie burger instead of a hamburger, eating corn instead of a veggie burger What are the monomer units of proteins? DNA? Polysaccharides?
Explain each term and give an example: saturated fat, unsaturated...
which fatty acid is unsaturated Lipids b. Which fatty acid is unsaturated? c. The melting point...
which fatty acid is unsaturated
Lipids b. Which fatty acid is unsaturated? c. The melting point of stearic acid is 70°C, and that of oleic acid is 4°C. Explain the difference. From the results of experiment C, how can you tell which is more unsaturated, oleic acid or steari d. acid? 04. How does omitting triethanolamine affect the properties and appearance of the hand lotion? Q5. How does omitting stearic acid affect the properties and appearance of the hand lotion?...
this type of fatty acid is classified as Question 18 18. This type of fatty acid is classified as: a). polyunsat...
this type of fatty acid is classified as
Question 18 18. This type of fatty acid is classified as: a). polyunsaturated b). mono saturated c). mono unsaturated 19. This type of fat is classified as: a) poly saturated b) tri unsaturated c) poly unsaturated d) unsaturated e) saturated 20. Identify the class of lipid to which the following molecule belongs. 1. a) fatty acid 2.b) triglyceride 3. c) wax 4.d) glycerophospholipid H.C-o HC-0 H,C- 21. Hydrophilic head Aqueous solution "Hydrophobic...
14. Draw an unsaturated fatty acid with that is unsaturated at carbon #2. (You do not...
14. Draw an unsaturated fatty acid with that is unsaturated at carbon #2. (You do not need to name it.) 15. Draw glycerol and a fatty acid. Show the mechanism for attachment. 17. Snakes, and particularly poisonous snakes, are awesome. I AGREE I DISAGREE (choose one) What class of enzymes do they use to rock your world when they bite you? What do you think happens to your cells (red blood cells, specifically) as you writhe on the ground in...
What is the difference between cis, trans, sat fat, and unsat fats? How are they grouped...
What is the difference between cis, trans, sat fat, and unsat fats? How are they grouped as far as good/bad fats and oils?
Draw a simple saturated and an unsaturated fatty acid. Which one can be densely packed? Which...
Draw a simple saturated and an unsaturated fatty acid. Which one can be densely packed? Which one helps make membranes fluid? What is the key difference between them? What major macromolecule are these?
How does oxidation of a saturated fatty acid differ from the oxidation of an unsaturated fatty...
How does oxidation of a saturated fatty acid differ from the oxidation of an unsaturated fatty acid?
Distinguish between the structure of saturated and unsaturated fatty acids and describe why saturated and unsaturated...
Distinguish between the structure of saturated and unsaturated fatty acids and describe why saturated and unsaturated fatty acids have different melting temperatures
Question 14 4 pts For the following fatty acid molecules, which of the following is correct?...
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
Explain each term and give an example: saturated fat, unsaturated fat, monounsaturated fat, polyunsaturated fat, cis fat, trans fat Explain each term and give an example: carbohydrate, monosaccharide, disaccharide, polysaccharide What is the definition of a foodprint? How specifically might each of these affect your foodprint: eating a veggie burger instead of a hamburger, eating corn instead of a veggie burger What are the monomer units of proteins? DNA? Polysaccharides?
Explain each term and give an example: saturated fat, unsaturated...
which fatty acid is unsaturated
Lipids b. Which fatty acid is unsaturated? c. The melting point of stearic acid is 70°C, and that of oleic acid is 4°C. Explain the difference. From the results of experiment C, how can you tell which is more unsaturated, oleic acid or steari d. acid? 04. How does omitting triethanolamine affect the properties and appearance of the hand lotion? Q5. How does omitting stearic acid affect the properties and appearance of the hand lotion?...
this type of fatty acid is classified as
Question 18 18. This type of fatty acid is classified as: a). polyunsaturated b). mono saturated c). mono unsaturated 19. This type of fat is classified as: a) poly saturated b) tri unsaturated c) poly unsaturated d) unsaturated e) saturated 20. Identify the class of lipid to which the following molecule belongs. 1. a) fatty acid 2.b) triglyceride 3. c) wax 4.d) glycerophospholipid H.C-o HC-0 H,C- 21. Hydrophilic head Aqueous solution "Hydrophobic...
14. Draw an unsaturated fatty acid with that is unsaturated at carbon #2. (You do not need to name it.) 15. Draw glycerol and a fatty acid. Show the mechanism for attachment. 17. Snakes, and particularly poisonous snakes, are awesome. I AGREE I DISAGREE (choose one) What class of enzymes do they use to rock your world when they bite you? What do you think happens to your cells (red blood cells, specifically) as you writhe on the ground in...
Draw a simple saturated and an unsaturated fatty acid. Which one can be densely packed? Which one helps make membranes fluid? What is the key difference between them? What major macromolecule are these?
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
Most questions answered within 3 hours.
-
Kylie is a single mom with two dependent children,
Tanner, age 7 and Olivia, age 11....
asked 44 minutes ago -
Phosphorous + bromine = phosphorous tribromide. If 35.0 g of
bromine are reacted and 27.9 grams...
asked 2 hours ago -
Derive the long wavelength limit of the Planck energy density
distribution
asked 2 hours ago -
Calculate the pH of each of the following solutions.
0.50 M HBr
3.1×10−4 M KOH
4.2×10−5...
asked 5 hours ago -
For the year ended December 31, Depot Max’s cost of merchandise
sold was $85,600. Inventory at the...
asked 5 hours ago -
Week 10 - Professional Memo Assignment
Professional Memo Assignment
Your mission for this week, should you...
asked 5 hours ago -
Write a Python program that stores the data for each
player on the team, and it...
asked 5 hours ago -
In
the last 3 months, mike never knows when he is going to get his
allowance...
asked 6 hours ago -
Is Ca(OH)2 a Bronsted base, Lewis base, or both? Why?
asked 6 hours ago -
1A- Why don’t voters complain about U.S. tariffs on imported
sugar?
Because sugar is only a...
asked 6 hours ago -
Cash Payback Period
Primera Banco is evaluating two capital investment proposals for
a drive-up ATM kiosk,...
asked 6 hours ago -
Create a button in Swift (Xcode) that will create a charge,
create a charge using Stripe's...
asked 6 hours ago