Homework Answers
Add Answer to:
How do I solve this problem?
18. For a reaction: A products, [AJo 4.2M and the...
A certain first-order reaction (A products) has a rate constant of 5.40 10-3 s I at...
A certain first-order reaction (A products) has a rate constant of 5.40 10-3 s I at 45 °C How many minutes does it take for the concentration of the reactant, [A], to drop to 6.25% of the original concentration? at 27 °C A certain second-order reaction (B-products) has a rate constant of 1.05x10-3 M 1.s and an initial half-life of 266 s What is the concentration of the reactant B after one half-life?
1. For the following second order reaction, the half-life is 52.4 and the [A]0 = 3.04....
1. For the following second order reaction, the half-life is 52.4 and the [A]0 = 3.04. Calculate the rate constant. 2 A →→ 3 B 2. Consider the following reaction. aA +bB →→ cC whose first and second half-lives are 20.9 and 20.9 minutes respectively. If the rate constant is equal to 0.03316 and [A]0 = 10.66, calculate the [A] at t = 19.85 minutes.
18. In a first-order reaction, the half-life is 3 minutes. What is the rate constant? A)...
18. In a first-order reaction, the half-life is 3 minutes. What is the rate constant? A) 5490 s B) 8.75 x 105 s D) 1.26 x 104s E) 0.315 s C) 5.25 x 103s
hi, i understand how to solve this problem but how do we get 5 electrons in...
hi, i understand how to solve this problem but how do we get 5
electrons in the reduction part. All the oxidation number make
sense. I'm confused on where the 5 electrons came from.
o0 EXPLANATION As always, when you need to analyze a redox reaction, it's a good idea to start by identifying what's reduced and what's oxidized: +7-2 +1 2+ 2+ MnO (aq) 8H (aq) + 5 Fe (aq) Mn (aq) 4H,O)5 Fe(ag) Assigning oxidation states tells you...
Consider the reaction below: N2O4 (g) → 2 NO2 (g) Which of the following techniques be...
Consider the reaction below: N2O4 (g) → 2 NO2 (g) Which of the following techniques be used to determine the rate law is second order with respect to the concentration of dinitrogen tetroxide? O A graph of In([N204]) versus time will produce a straight line. A graph of [N204] versus time will produce a curved line. A graph of (N2O.) versus time will produce a straight line. The balanced chemical equation tells us that the reaction is first order with...
Answers are C, B, A but how do you solve them? Problems 18, 19 and 20...
Answers are C, B, A but how do you solve them?
Problems 18, 19 and 20 pertain to the following: A straight 2.5m long silver wire of diameter 0.30mm is connected across a 3.0V potential difference. 18.) [2 points] How many electrons have passed through the wire in 5 minutes? a.) 5.8 b.) 1731 c.) 1.1x1022 d.) 3.1x1027 e.) none of these 19.) [2 points] How much energy does this wire dissipate during 5 minutes? a.) 17.3J b.) 5.2x103 c.)...
How do I solve for this? Use the data table below to determine the value of...
How do I solve for this? Use the data table below to determine the value of the rate law constant for the first order reaction: Experiment Initial [A]/M Initial rate/M s-1 1 0.10 0.0004 2 0.20 0.0010 3 0.30 0.0018
The reaction, aA products, is a first order reaction with a rate constant of 1.248...
The reaction, aA products, is a first order reaction with a rate constant of 1.248 x 10-4 s-1 . a. How long (in seconds) does it take for the initial amount of A to decrease by 30%? b. What fraction of reactant remains after 30 minutes? c. What is the half-life for the reaction? d. How long does it take for the initial amount of reactant to decrease by 87.5%?
How do you calculate the half life for this reaction? The first-order reaction of decomposition of...
How do you calculate the half life for this reaction?
The first-order reaction of decomposition of azomethane is given below: At a certain temperature, the rate constant for this reaction equals 3.05 X 10^-3 s^-1. Calculate the half-life of this reaction (in seconds) at the same temperature.
How do I solve it what do I need to do to get the answer 26,...
How do I solve it what do I need to do to get the answer
26, A certam radiou tive decay process 'fint order) is 45% complete in 66 secon s. what is the half ase for this process? HINTS: Firstsolve for rate constant. Assume initial concentration of 100M. ~1n(ト0.45) GS し3.3 seconds b. 56.4 seconds С. 81 ,7 seconds d 75.3 seconds
A certain first-order reaction (A products) has a rate constant of 5.40 10-3 s I at 45 °C How many minutes does it take for the concentration of the reactant, [A], to drop to 6.25% of the original concentration? at 27 °C A certain second-order reaction (B-products) has a rate constant of 1.05x10-3 M 1.s and an initial half-life of 266 s What is the concentration of the reactant B after one half-life?
18. In a first-order reaction, the half-life is 3 minutes. What is the rate constant? A) 5490 s B) 8.75 x 105 s D) 1.26 x 104s E) 0.315 s C) 5.25 x 103s
hi, i understand how to solve this problem but how do we get 5
electrons in the reduction part. All the oxidation number make
sense. I'm confused on where the 5 electrons came from.
o0 EXPLANATION As always, when you need to analyze a redox reaction, it's a good idea to start by identifying what's reduced and what's oxidized: +7-2 +1 2+ 2+ MnO (aq) 8H (aq) + 5 Fe (aq) Mn (aq) 4H,O)5 Fe(ag) Assigning oxidation states tells you...
Consider the reaction below: N2O4 (g) → 2 NO2 (g) Which of the following techniques be used to determine the rate law is second order with respect to the concentration of dinitrogen tetroxide? O A graph of In([N204]) versus time will produce a straight line. A graph of [N204] versus time will produce a curved line. A graph of (N2O.) versus time will produce a straight line. The balanced chemical equation tells us that the reaction is first order with...
Answers are C, B, A but how do you solve them?
Problems 18, 19 and 20 pertain to the following: A straight 2.5m long silver wire of diameter 0.30mm is connected across a 3.0V potential difference. 18.) [2 points] How many electrons have passed through the wire in 5 minutes? a.) 5.8 b.) 1731 c.) 1.1x1022 d.) 3.1x1027 e.) none of these 19.) [2 points] How much energy does this wire dissipate during 5 minutes? a.) 17.3J b.) 5.2x103 c.)...
How do you calculate the half life for this reaction?
The first-order reaction of decomposition of azomethane is given below: At a certain temperature, the rate constant for this reaction equals 3.05 X 10^-3 s^-1. Calculate the half-life of this reaction (in seconds) at the same temperature.
How do I solve it what do I need to do to get the answer
26, A certam radiou tive decay process 'fint order) is 45% complete in 66 secon s. what is the half ase for this process? HINTS: Firstsolve for rate constant. Assume initial concentration of 100M. ~1n(ト0.45) GS し3.3 seconds b. 56.4 seconds С. 81 ,7 seconds d 75.3 seconds
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 41 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago