Homework Answers
Add Answer to:
You have created a galvanic cell in order to perform the following UNBALANCED reaction. First, balance...
In a galvanic cell, a spontaneous redox reaction occurs. However the reactants are separated such that...
In a galvanic cell, a spontaneous redox reaction occurs. However the reactants are separated such that the transfer of electrons is forced to occur across a wire. The resulting electricity is measured in volts (V) and is the sum of the potentials of the oxidation and reduction half-reactions: E^o cell = E^o red + E^o ox By reversing the reduction half-reactions, you get the corresponding oxidation half-reaction, for which E^o ox has the opposite sign of E^o red You can...
In a galvanic cell a spontaneous redox reaction occurs However, the reactants are separated such that...
In a galvanic cell a spontaneous redox reaction occurs However, the reactants are separated such that the transfer of electrons is forced to occur across a The resulting electricity is measured in volts(V) and is the sum of the potentials of the oxidation and reduction half-reactions: By reversing the reduction half-reactions you get the corresponding oxidation sign of You can also write the equivalent equation in terms of the reduction potentials and avoid manipulating standard potentials A table of standard...
B1. Construction of Galvanic Cells a. For each galvanic cells you construct, calculate the theoretical cell...
B1. Construction of Galvanic Cells a. For each galvanic cells you construct, calculate the theoretical cell potential using the table of the Standard Electrode Potentials from the Chemistry 0130 data booklet. (3 marks) Measured Galvanic Cells Cathode reaction Anode reaction Voltage (V) Cu?*/Cu and Zn/Zn? 0.937 v Zn/Zn2+ and Ag /Ag 1.329v Ag"/Ag and Cu/Cu2+ 0.394v Electrochemistry 9 b. For each galvanic cells, write the overall cell reaction (balanced net ionic equation). • identify the oxidizing agent (OA) and reducing...
Galvanic Cell reaction I am a little confused on what the following questions are asking. For...
Galvanic Cell reaction I am a little confused on what the following questions are asking. For some background: A galvanic cell using 0.200M KBr and 0.100 AgNO3 creates Ag(s) I AgBr(s) I Br - (aq, 0.0500M) II Ag+ (aq, 0.100M) I Ag(s) average cell voltage: 0.530 V what is the overall cell reaction? Show how you calculated the standard cell potential (using the average cell voltage) Show how you calculated the solubility product of AgBr(s) using your experimentally determined standard...
Determine the standard cell potential (in volts) at 25 degree C for the following reaction. You...
Determine the standard cell potential (in volts) at 25 degree C for the following reaction. You will need to look up the relevant reduction potentials in your textbook. 3 Cu^2+ _(aq) + 2 Al_(s) rightarrow 2 Al^3+ _(aq) + 3 Cu_(s) TRUE or FALSE: The above reaction is non-spontaneous and would need the input of electricity to move forward as an electrolytic cell. True False
In a galvanic cell, one half-cell consists of a lead strip dipped into a 1.00 M...
In a galvanic cell, one half-cell consists of a lead strip dipped into a 1.00 M solution of Pb(NO). In the second half-cell, solid germanium is in contact with a 1.00 M solution of Ge(NO), Ge is observed to plate out as the galvanic cell operates, and the initial cell voltage is measured to be 0.250 V at 25°C. (a) Write balanced equations for the half-reactions at the anode and the cathode. Show electrons as e'. Use the smallest integer...
What is the standard potential of the galvanic cell that utilizes the following reaction (unbalanced). ...
What is the standard potential of the galvanic cell that utilizes the following reaction (unbalanced). AuCl2-(aq) + Cu(s) ⇌ Au(s) + 2Cl-(aq) + Cu2+(aq Please show your work, thanks!
Show all steps please :) A galvanic cell is prepared using the following two half-cells: (i)...
Show all steps please :)
A galvanic cell is prepared using the following two half-cells: (i) MnO4 (0.273 M), Mn2+ (0.167 M), and H+ (1.0 M), and (ii) Fe2+ (0.247 M) and Fe3+ (0.389 M). The standard reduction potentials for the two half cells are: Mnoa + 8H+ + 5e – Mn2+ + 4H20 E° = 1.507 V Fe3+ + e- Fe2+ E° = 0.770 V a) Calculate the voltage for this galvanic cell. b) Write the balanced equation for...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red = +0.96 V red0.763 v NO, (ag)+4H(a)+3eNoo)+2 H,Ow Zan2+ (aq)+2e- → Zn(s) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written. Do...
A galvanic cell is powered by the following redox reaction: Br() + H2(0) + 2 OH...
A galvanic cell is powered by the following redox reaction: Br() + H2(0) + 2 OH (aq) → 2 Br" (aq) + 2 H20 (1) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. Write a balanced equation for the half-reaction that takes place at the cathode. Write a balanced equation for the half-reaction that takes place at the anode. x s ? Calculate the cell...
In a galvanic cell, a spontaneous redox reaction occurs. However the reactants are separated such that the transfer of electrons is forced to occur across a wire. The resulting electricity is measured in volts (V) and is the sum of the potentials of the oxidation and reduction half-reactions: E^o cell = E^o red + E^o ox By reversing the reduction half-reactions, you get the corresponding oxidation half-reaction, for which E^o ox has the opposite sign of E^o red You can...
In a galvanic cell a spontaneous redox reaction occurs However, the reactants are separated such that the transfer of electrons is forced to occur across a The resulting electricity is measured in volts(V) and is the sum of the potentials of the oxidation and reduction half-reactions: By reversing the reduction half-reactions you get the corresponding oxidation sign of You can also write the equivalent equation in terms of the reduction potentials and avoid manipulating standard potentials A table of standard...
B1. Construction of Galvanic Cells a. For each galvanic cells you construct, calculate the theoretical cell potential using the table of the Standard Electrode Potentials from the Chemistry 0130 data booklet. (3 marks) Measured Galvanic Cells Cathode reaction Anode reaction Voltage (V) Cu?*/Cu and Zn/Zn? 0.937 v Zn/Zn2+ and Ag /Ag 1.329v Ag"/Ag and Cu/Cu2+ 0.394v Electrochemistry 9 b. For each galvanic cells, write the overall cell reaction (balanced net ionic equation). • identify the oxidizing agent (OA) and reducing...
Determine the standard cell potential (in volts) at 25 degree C for the following reaction. You will need to look up the relevant reduction potentials in your textbook. 3 Cu^2+ _(aq) + 2 Al_(s) rightarrow 2 Al^3+ _(aq) + 3 Cu_(s) TRUE or FALSE: The above reaction is non-spontaneous and would need the input of electricity to move forward as an electrolytic cell. True False
In a galvanic cell, one half-cell consists of a lead strip dipped into a 1.00 M solution of Pb(NO). In the second half-cell, solid germanium is in contact with a 1.00 M solution of Ge(NO), Ge is observed to plate out as the galvanic cell operates, and the initial cell voltage is measured to be 0.250 V at 25°C. (a) Write balanced equations for the half-reactions at the anode and the cathode. Show electrons as e'. Use the smallest integer...
Show all steps please :)
A galvanic cell is prepared using the following two half-cells: (i) MnO4 (0.273 M), Mn2+ (0.167 M), and H+ (1.0 M), and (ii) Fe2+ (0.247 M) and Fe3+ (0.389 M). The standard reduction potentials for the two half cells are: Mnoa + 8H+ + 5e – Mn2+ + 4H20 E° = 1.507 V Fe3+ + e- Fe2+ E° = 0.770 V a) Calculate the voltage for this galvanic cell. b) Write the balanced equation for...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red = +0.96 V red0.763 v NO, (ag)+4H(a)+3eNoo)+2 H,Ow Zan2+ (aq)+2e- → Zn(s) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written. Do...
A galvanic cell is powered by the following redox reaction: Br() + H2(0) + 2 OH (aq) → 2 Br" (aq) + 2 H20 (1) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. Write a balanced equation for the half-reaction that takes place at the cathode. Write a balanced equation for the half-reaction that takes place at the anode. x s ? Calculate the cell...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 11 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 11 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 25 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago